1. How many moles of NaOH (FW = 40g/mol) are there in 2.0 grams NaOH?2. How many grams of Na2CO3 (FW=106g/mo10 are there in 0.50 moles Na2CO3?3. How much does 6.02 x 1023 molecules of CO2 (FW = 44g/mol) weigh?4. Calculate the formula weight of aluminum phosphate.5. What is the percentage composition of the elements present in sodium carbonate?6. Determine the empirical formula of the compound containing 87.5% nitrogen and 12.5%H by mass.7. What is the molecular formula of the compound if its empirical formula is HCO2 and itsmolecular weight is 90.0 almu?

moles of NaOH = mass / FW = 2.0 g / 40 g/mol = 0.05 moles NaOH

1. How many moles of NaOH (FW = 40g/mol) are there in 2.0 grams NaOH? 2. How many grams of Na2CO3 (FW=106g/mo10 are there in 0.50 moles Na2CO3? 3. How much does 6.02 x 1023 molecules of CO2 (FW = 44g/mol) weigh?

1. How many moles of NaOH (FW = 40g/mol) are there in 2.0 grams NaOH? 2. How many grams of Na2CO3 (FW=106g/mo10 are there in 0.50 moles Na2CO3? 3. How much does 6.02 x 1023 molecules of CO2 (FW = 44g/mol) weigh?

Chemistry: Principles and Practice

3rd Edition

ISBN:9780534420123

Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Publisher:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Chapter3: Equation, The Mole, And Chemical Formulas

Section: Chapter Questions

Problem 3.114QE

See similar textbooks

Similar questions

The molecular formula of acetylsalicylic acid (aspirin), one of the most commonly used pain relievers, is C9H8O4. a. Calculate the molar mass of aspirin. b. A typical aspirin tablet contains 500. mg C9H8O4. What amount (moles) of C9H8O4 molecules and what number of molecules of acetylsalicylic acid are in a 500.-mg tablet?
The sugar sucrose, which is present in many fruits and vegetables, reacts in the presence of certain yeast enzymes to produce ethanol and carbon dioxide gas. Balance the following equation for this reaction of sucrose. C12H22O11(aq) + H2O(l) C2H5OH(aq) + CO2(g)
4.69 The pictures below show a molecular-scale view of a chemical reaction between H2 and CO to produce methanol, CH3OH. The box on the left represents the reactants at the instant of mixing, and the box on the right shows what is left once the reaction has gone to completion. Was there a limiting reactant in this reaction? If so, what was it? Write a balanced chemical equation for this reaction. As usual, your equation should use the smallest possible whole number coefficients for all substances.
The space shuttle environmental control system handles excess CO2 (which the astronauts breathe out; it is 4.0% by mass of exhaled air) by reacting it with lithium hydroxide, LiOH, pellets to form lithium carbonate, Li2CO3, and water. If there are seven astronauts on board the shuttle, and each exhales 20. L of air pee minute, how long could clean air be generated if there were 25,000 g of LiOH pellets available for each shuttle mission? Assume the density of air is 0.0010 g/mL.
Ethanol, C2H5OH, is a gasoline additive that can be produced by fermentation of glucose. C6H12O62C2H5OH+2CO2 (a) Calculate the mass (g) of ethanol produced by the fermentation of 1.000 lb glucose. (b) Gasohol is a mixture of 10.00 mL ethanol per 90.00 mL gasoline. Calculate the mass (in g) of glucose required to produce the ethanol in 1.00 gal gasohol. Density of ethanol = 0.785 g/mL. (c) By 2022, the U. S. Energy Independence and Security Act calls for annual production of 3.6 1010 gal of ethanol, no more than 40% of it produced by fermentation of corn. Fermentation of 1 ton (2.2 103 lb) of corn yields approximately 106 gal of ethanol. The average corn yield in the United States is about 2.1 105 lb per 1.0 105 m2. Calculate the acreage (in m2) required to raise corn solely for ethanol production in 2022 in the United States.
Calculate the mass in grams of 3.839 moles of (a) hydrazine, a rocket propellant. (b) caffeine, C4H5N2O. (c) theobromine, C7H8N4O2, the alkaloid present in chocolate and cocoa.
How many moles of beryllium (Be) are needed to completely react with 10.0 moles of N2 in the synthesis of the compound Be3N2?
Tungsten (W) metal, which is used to make incandescent bulb filaments, is produced by the reaction WO3+3H23H2O+W How many grams of H2 are needed to produce 1.00 g of W?
Phosphoric acid, H3PO4, can be prepared by the reaction of phosphorus(V) oxide, P4O10, with water. 14P4O10(s)+32H2O(l)H3PO4(aq);H=96.2kJ What is H for the reaction involving 1 mol of P4O10? P4O10(s)+6H2O(l)4H3PO4(aq)
Write the balanced chemical equation for the complete combustion of adipic acid, an organic acid containing 49.31% C, 6.90% H, and the remainder O, by mass.
The reaction of methane and water is one way to prepare hydrogen for use as a fuel: CH4(g) + H2O(g) CO(g) + 3 H2(g) If you begin with 995 g of CH4 and 2510 g of water, (a) Which reactant is the limiting reactant? (b) What is the maximum mass of H2 that can be prepared? (c) What mass of the excess reactant remains when the reaction is completed?
Boron forms an extensive series of compounds with hydrogen, all with the general formula BxHy. To analyze one of these compounds, you burn it in air and isolate the boron in the form of B2O3 and the hydrogen in the form of water. You find that 0.1482 g BxHy gives 0.4221 g B2O3 when burned in excess O2. Determine the empirical I formula of BxHy.