1) Sketch out a structure showing the geometry about the metal center as accurately as possil clearly show the electron counting for the complexes below. a) [Cu(pyridine), (MeCN)]* b) trans-W(CO)4(1²CH2=CH₂)2 c) HRh(CO)(PPh₂)2

1) Sketch out a structure showing the geometry about the metal center as accurately as possil clearly show the electron counting for the complexes below. a) [Cu(pyridine), (MeCN)]* b) trans-W(CO)4(1²CH2=CH₂)2 c) HRh(CO)(PPh₂)2

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter20: Chemistry Of Selected Transition Elements And Coordination Compounds

Section: Chapter Questions

Problem 95QRT

See similar textbooks

Related questions

Q: Determine the CFSE in terms of A. and P for the following complexes: W a) [Fe(CN)6]4 b) [Ru(NH3)6]³+…

A: The objective of the question is to determine the Crystal Field Stabilization Energy (CFSE) for the…

Q: Rank the following complexes in order of increasing wavelength of absorption. Cu(CN)₂ Cul2 CuBra…

A: The question is based on the concept of coordination chemistry . we need to arrange the complexes in…

Q: If you want to use any of the [IrCl(CO)(PPh3)2] and [(η6-C6H6)Cr(CO)3] complexes as a catalyst in…

A: The given compound are organometallic compound. We know if the total electron count of the metal is…

Q: Identify the total number of unique structures for the following complex. Do not include decimal…

A: In the given complex Cl is monodentate ligand Pyridine is also monodentate ligand But en i.e.…

Q: i=20. €/0=5₂ 0. co 1013=0 Co CI

A: Isomers are similar in empirical formula but their arrangement of atoms differs.

Q: 7. MO Diagram. Consider the molecule [Cr(CO)6]²*. e) bonding (nb), and antibonding (*) orbitals,…

Q: [Cu(C204)2(H20)(NH3)] a.) What is the coordination number for the complex? b.) What is the charge on…

A: Oxalate is a bidendate ligand. It has two binding sites. Since Cu atom is bonded to two bidendate…

Q: Indicate the (i) metal oxidation state, (ii) d-electron count, and (iii) the spin only magnetic…

A: Given compound = [CuCl6]3- Now we will find oxidation state of copper which is central atom .x +…

Q: What is the IUPAC name for the complex [(CH3CH2)2NH2]2[CuCl4]

A: 1) Name of cation is written followed by name of anion 2) while writing we should name the ligand…

Q: Draw all possible stereoisomers, including any enantiomers for the following compounds. a.…

Q: Cis-[PtCl2(NH3)2] is a complex commonly known as cisplatin. When the two chloride ligands in this…

Q: Draw all isomers of each species. Cleary indicate chiral enantiomers. Name the isomers using the…

A: Guideline message: As per the guidelines, in case of a multipart question, first three subparts need…

Q: Write the dissociation equations and expressions for the instability constant of the following…

A: A coordination complex does not loose its entity in aqueous solutions and a single ion is obtained…

Q: 1-According to Werner formulation, open the structure of the following complexes and predict the…

Q: Draw the structure and determine the metal-metal bond order consistent with the 18-electron rule for…

A: In this problem, we need to draw the structure of metal complexes and need to find the metal-metal…

Q: Question : Draw and name the geometric isomer of the complex you have obtained. Indicate which of…

A: Stereoisomers are the isomers with the same connectivity of atoms in the bonds but different spatial…

Q: 2. For the following redox reaction, please indicate whether the metal center is inert or labile…

Q: Which complex below is an organometallic complex? [Pd(acac)2] O [PdC12(PM@3)2] [Pd(OH)2(H2O)2] O…

Q: How we calculate the charge of ligands in this complex? [Ir(C≡C-Ph)(PMe3)4]

A: Given complex is [Ir(C≡C-Ph)(PMe3)4] We have to find the charge on ligand

Q: a) Draw the structure and the systematic name of the following d-metal complexes: (0) [Mn(CO),H₂]…

A: As per the rules only the first three subparts of the first question can be answered

Q: Which complex undergoes the slowest ligand exchange of ligands at room temperature A) [Fe(H2O)e]**…

Q: Draw and name the following compounds. Na2[Cu(H2O)2Cl4] [Cr(C2H8N2)3]Cl3, how do you even start with…

Q: a. Determine the number of unpaired electrons, mag- netic moment, and ligand field stabilization…

Q: If A, B, C, and D are four - electrically neutral - different single-tooth substituents, what kind…

A: To show the kind of isomerism shown by the tetrahedral complex [ZnABCD]2+, where A, B, C and D are…

Q: Which of the following pairs are coordination isomers? a. [Pt Br2Cl2(H20)2]CO3 and [PtBr2Cl2]CO3…

A: Correct answer about coordination isomerism is given below.

Q: 18-electron rule

Q: [Cu (NH3) 4] SO4.H20 Draw and name the shapes of all possible isomeric structures.

Q: Draw a structure with accurate geometry for the following complexes, assuming that all donor atoms…

A: The ligands consisting of more than one donor atoms which can be bonded to the central metal ion are…

Q: Represent the energy diagram of the d orbitals according to the ligand field theory and predict the…

Q: The coordination compound [Co(NH3)5Cl]Cl2 is analogous to which simple salt? a) NaOH b) AlCl3…

A: We are given a coordination compound [Co(NH3)5Cl]Cl2

Q: Name the following according to the rules provided in this course: a) Nag[FeBr] b) [Cr(CN)2(H2O)]²+…

A: Answer:- This question is answered by using the simple concept of writing the name og the complex…

Q: 3. Draw each of the following complexes. Give the formal oxidation state and d-electron count of…

Q: Q/ Calculate the oxidation state of Lead in [Pb(SC(NH₂)2}6](NO3)2] ? and Calculate the molecular…

Q: Name the compound [η2-C2H4)(η5-Cp)Ru(CO)2]+ and show whether it obeys the 18 electron rule.

Q: 1. The Cp2Rh2[p-(CF3C=CCF3)](CO)(CNR) complex has a Rh-Rh bond distance of 2.67 Å, strongly…

A: In the given question we have to calculate the electron count of the given compound and to show it…

Q: ) trans-[Co(en)2Cl2]Cl is a chiral compound ) The coordination number for the anionic complex in…

Concept explainers

Coordination Chemistry

It is a part of chemistry, in which the study of compounds that have central atoms surrounded by molecules or ions, known as ligand, is known as coordination chemistry.

Question

1) Sketch out a structure showing the geometry about the metal center as accurately as possil
clearly show the electron counting for the complexes below.
a) [Cu(pyridine) (Me CN)]*
b) trans-W(CO)4(n²CH2=CH2)2
c) HRh(CO) (PPH3)2
d) [CpFe(n°C,H;)]*
e) [Pd(bipy)(n3-allyl)]+ (bipy - bipyridine)

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1: Determination of electron counting

VIEW

Step 2: Geometry of [Cu(pyridine)3MeCN]+

VIEW

Step 3: Electron counting of [Cu(pyridine)3MeCN]+

VIEW

Step 4: Geometry of trans- [W(CO)4(η2CH2=CH2)2]

VIEW

Step 5: Electron counting of trans- [W(CO)4(η2CH2=CH2)2]

VIEW

Step 6: Geometry of HRhCO(PPh3)3

VIEW

Step 7: Electron counting of HRhCO(PPh3)3

VIEW

Solution

VIEW

Step by step

Solved in 8 steps with 21 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
Trimethylphosphine, P(CH3)3, can act as a ligand by donating the lone pair of electrons on the phosphorus atom. If trimethylphosphine is added to a solution of nickel(Il) chloride in acetone, a blue compound that has a molecular mass of approximately 270 g and contains 21.5% Ni, 26.0% Cl, and 52.5% P(CH3)3 can be isolated. This blue compound does not have any isomeric forms. What are the geometry and molecular formula of the blue compound?
Sketch and explain the most likely crystal field diagram for the following complex ion: Note: The CN ligand produces a much stronger crystal field than NH3. Assume the NH3 ligands lie on the z axis.
Give the coordination number for each metal ion in the following compounds: (a) [Co(CO3)3]3- (note that CO32- is bidentate in this complex). (b) [Cu(NH3)4]2+. (c) [Co(NH3)4Br2]2(SO4)3. (d) [Pt(NH3)4][PtCl4]. (e) [Cr(en)3](NO3)3. (f) [Pd(NH3)2Br2] (square planar). (g) K3[Cu(Cl)5]. (h) [Zn(NH3)2Cl2]
Which of the following statement(s) is( are) true? a. The coordination number of a metal ion in an octahedral complex ion is 8. b. All tetrahedral complex ions are low-spin. c. The formula for triaquatrianuninechromiwn(III) sulfate is [Cr(H2O)3(NH3)](SO4)3. d. The electron configuration of Hf2+ is [Xe]4f126s2. e. Hemoglobin contains Fe3+.
Is the correct answer D?? Why?
Complex that obeys the 18-electron rule would be A) [(n' -C,H.) Fe(CO),]. B) [(n° -C,H,)Mo(CO), 1 C) [Ir(CO), Br, D) Os (CO)(= CPh)(PPh,), Cl 2-
Name the following according to the rules provided in this course: a) Nag[FeBr] b) [Cr(CN)2(H2O)]²+ c) [COC12(NH3)(en)2]CI Give formulas for the following according to the rules provided in this course: d) dihydroxotetraaquaaluminum (IV) ion e) lithium tetranitrodiaminozincate (II)
Question 1 Consider the following metal ion d-electron configuration and crystal field in octahedral complexes: (i) dº strong field (ii) d³ weak field; (iii) dº weak field; (v) dº strong field. d) Correlate the above metal ion d-electron configuration and crystal field splitting with the following complexes: [Co(CN)c]* ; [Fe(H2O)cJ**; [Fe(CN)«J³; [Co(H2O)6J*.
which complex have the highest magnitude of Ao? Select one: 3- O a. [Co(CN)J 2+ b. [Co(NH, 3'6 3+ C. [CO(H,0),J B- d. [Co(C,0] O O O O
how do you solve 12?
5. Which of the following complexes would you expect to exhibit a Jahn-Teller distortion? Explain your reasoning with d-orbital splitting diagrams. Note, this problem requires you to first determine which coordination geometry will predominate for each complex. a) K4[CuF6] b) Pd(PPh4) c) [Mn(H₂O)6]Cl4 d) VC14