Which of following complex hashigher Ao value?OA) [Fe(H20)6]3+OB) [Fe(H20)6]2+C) [Fe(H20)6]3-D) [Co(NH3)6]C13OE) All have equal

To calculate the crystal field splitting parameter Δo for a complex, one needs to consider…

Answered: Which of following complex has higher…

Which of following complex has higher Ao value? OA) [Fe(H20)6]3+ OB) [Fe(H20)6]2+ OC) [Fe(H20)6]3- OD) [CO(NH3)6]C13 OE) All have equal

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter21: Transition Metals And Coordination Chemistry

Section: Chapter Questions

Problem 35E

See similar textbooks

Related questions

Q: What is the product when [PtL4]2+ reacts with 2 Y ligands? L has weaker trans effec strength than Y.…

A: Solution: Given a complex [PtL4]2+ reacts with 2 Y ligands. The trans effect of L is weaker than…

Q: Name the following complex ions. formula [V(CN)]* [Co (CN),] [Crc14] name

A: Name the following complex ions---

Q: Which of the following complexes would exhibit cis- and trans- geometric isomers?

A: Cis and Trans isomerism in an octahedral complex is possible if the complex has a general formula of…

Q: [Cr(H2O)6] 2+ is violet. Another CrL6 complex is green. Can ligand L be CN-? Can it be Cl-? Explain.

A: The octahedral splitting energy of transition elements is the difference in the energy of the…

Q: Identify the ligands in the following complex ions. [AlCl4] - [Cu (NH3)4]2+ [Fe EDTA ]3+ 1 How…

Q: An equilibrium of [Cu(H2O)6 ]2+ [Cu(NH3)4(H2O)2]2+ Would the complexes have the same max wavelength…

A: In the Cu2+ (d9) complexes, the eq orbitals are asymmetrically filled. The color of the complexes is…

Q: Cu (NH3) 4] SO4.H2O complex is a tetrahedral, dark blue hydrate compound that degrades in air.…

A: In this question, we will discuss about color, geometry and property of this complex.

Q: The reaction between OH- and which of the following complexes could be made to occur faster (or be…

Q: Which complex will absorb visible light with the longest wavelength? O IVIH20)6]3+ [VBr6]3- [VCI6]3-…

A: In this question, we have to find out the correct answer of given problem by the help of the…

Q: In the visible region of the spectrum, the trans-[Co(NH3)4Cl2] ion + shows a band at 15,000 cm-1.…

A: This question is related to Crystal field theory which explains the breaking of degeneracies of…

Q: 1_The complex [Co(CN)6]3- does not exhibit Jahn-Teller distortion. Explain 2_[Ni(NH3)4Cl2] does not…

A: Hello. Since the question contains more than three sub-parts, the first three sub-parts shall onl be…

Q: For the complexes [Co (NH3)5NO2]Cl2 and [Co(NH3)5ONO]Cl2: 1- What is the relationship between the…

A: Given: Two complexes are given CoNH35NO2Cl2 and CoNH35ONOCl2 To find: The relationship between…

Q: Na2[Fe(CN)4(en)] The complex ion of this compound is known to be diamagnetic. Draw the d-orbital…

Q: Which of the following complexes exhibits a metal-to-ligand charge transfer (MLCT) transition? Group…

A: The concept used in this question is from Coordination chemistry. The MLCT Or we can say Metal to…

Q: [Cu(NH3)5Cl]2+ - name the complex

A: The name of inorganic coordination complexes are written according to the following general rules:…

Q: The molar mass of the coordination compound [M(NH3)4Cl2]Cl is 381.5 g/mol and the atomic mass of…

Q: 3 - What is the correct order of the crystal field splitting energies for the following complex…

A: In an octahedral complex the d orbital of the central metal ion divided into two sets of different…

Q: Identify the ligands in the following complex ions. [AlCl4] - [Cu (NH3)4]2+…

A: From given Ligand calculation is done for all the given complexes and free ion of AlF4- is…

Q: a) Naz[Fe(CN)4(en)] b) The complex ion of this compound is known to be diamagnetic. Draw the…

A: Since CN- is a strong field ligand, it forms low spin complex and has large crystal field splitting.…

Q: Which of the following complex ions is paramagnetic? A) [ZnCl₂]²- B) [Fe(H₂O)]²+ (H₂O is weak field…

A: Paramagnetic nature - contains unpaired d electrons

Q: Which complex has the highest crystal field stabilization energy? Group of answer choices MnO4-…

Q: Which one of the following complexes could be resolved into a pair of optical isomers? (ox = C2O42-)…

A: Optical isomers are two compounds which contain the same number and kinds of atoms, and bonds but…

Q: Depict and explain the Crystal field stabilization theory based on the color the below complexes.…

Q: In which of the following complexes does the transition metal have a d¹ electron configuration? A)…

A: The given question belongs to electronic configuration of d block elements in their compounds

Q: Which of the following is the most stable complex? а. [Fe(CN)6]3- b. [Fe(CO)s] С. [Fe(C204)3]3- d.…

Q: Which complex ion is diamagnetic? [PdCl4]2− [Cr(H2O)4Cl2]+ [Mn(NH3)6]2+ [CoCl6]3−

A: Paramagnetic materials are pulled in by outer attractive fields whereas diamagnetic materials are…

Q: What is the transition metal-containing product for the following reaction, where [Rh(CO)Br3]2- is a…

A: The substitution reaction in square planar complexes is governed by trans directing nature of…

Q: When a certain strong-field ligand forms an octahedral complex with Mn* cation, the energies of the…

A: Electronic configuration of Mn = [Ar] 3d5 4s2 Electronic configuration of Mn3+ = [Ar] 3d4 Under…

Q: Answer the following questions about the following coordination complex: [Co(en)2Cl2]Cl a) Provide…

A: Answer - Coordination complex - A coordination complex is the product of a Lewis acid-base…

Q: 3. Draw each of the following complexes. Give the formal oxidation state and d-electron count of…

Q: [Mn(H2O)6]?* complex has an extremely pale color, attributable to transitions which are formally…

Q: According to the equilibrium equation, which ion(s) do you have when the solution dissolved? Explain…

A: The reaction involves

Q: For each of the following compounds identify the ionization sphere the coordination spere the…

Q: Which of the following complexes would exhibit cis- and trans- geometric isomers? A) [Ni(phen)]²+ B)…

A: Cis and Trans isomerism in an octahedral complex is possible if the complex has a general formula of…

Concept explainers

Coordination Chemistry

It is a part of chemistry, in which the study of compounds that have central atoms surrounded by molecules or ions, known as ligand, is known as coordination chemistry.

Question

Which of following complex has
higher Ao value?
OA) [Fe(H20)6]3+
OB) [Fe(H20)6]2+
C) [Fe(H20)6]3-
D) [Co(NH3)6]C13
OE) All have equal

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1: Choosing the correct option

VIEW

Step 2: Calculations for the crystal field splitting parameter,

VIEW

Solution

VIEW

Step by step

Solved in 3 steps with 5 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Which of the following statement(s) is( are) true? a. The coordination number of a metal ion in an octahedral complex ion is 8. b. All tetrahedral complex ions are low-spin. c. The formula for triaquatrianuninechromiwn(III) sulfate is [Cr(H2O)3(NH3)](SO4)3. d. The electron configuration of Hf2+ is [Xe]4f126s2. e. Hemoglobin contains Fe3+.
The square-planar complex Pt(en)Cl2 has chloride ligands in a cis configuration. No trans isomer is known. Based on the bond lengths and bond angles of carbon and nitrogen in the ethylenediamine ligand, explain why the trans compound is not possible.
A certain coordination compound has the simplest formula PtN2H6Cl2. It has a molar mass of about 600 g/mol and contains both a complex cation and a complex anion. What is its structure?
Sketch and explain the most likely crystal field diagram for the following complex ion: Note: The CN ligand produces a much stronger crystal field than NH3. Assume the NH3 ligands lie on the z axis.
Trimethylphosphine, P(CH3)3, can act as a ligand by donating the lone pair of electrons on the phosphorus atom. If trimethylphosphine is added to a solution of nickel(Il) chloride in acetone, a blue compound that has a molecular mass of approximately 270 g and contains 21.5% Ni, 26.0% Cl, and 52.5% P(CH3)3 can be isolated. This blue compound does not have any isomeric forms. What are the geometry and molecular formula of the blue compound?
Experiments show that K4[Cr(CN)6] is paramagnetic and has two unpaired electrons. The related complex K4[Cr(SCN)6] is paramagnetic and has four unpaired electrons. Account for the magnetism of each compound using the ligand field model. Predict where the SCN ion occurs in the spectro-chemical series relative to CN.
Is it possible to have a paramagnetic d4-tetrahedral complex ion? Explain.
a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
(a) Name this coordination compound: [Ag(NH3)2]NO3. (b) Write the formula of pentaaquaisothiocyanatoiron(III) chloride.
Give the number of unpaired electrons in octahedral complexes with strong-field ligands for (a) Rh3+ (b) Mn3+ (c) Ag+ (d) Pt4+ (e) Au3+
How many geometric isomers are possible for the square-planar complex ion [Pt(NH3)(CN)Cl2)?
Draw the Crystal field diagrams for [Fe(NO2)6]4- and [FeF6]3-. State whether each complex is high spin or low spin, paramagnetic or diamagnetic, and compare ?oct to P for each complex.