Chemistry with Access Code, Hybrid Edition
9th Edition
ISBN: 9781285188492
Author: Steven S. Zumdahl
Publisher: CENGAGE L
expand_more
expand_more
format_list_bulleted
Concept explainers
Textbook Question
Chapter 8, Problem 130AE
Write Lewis structures for CO32–, HCO3–, and H2CO3. When acid is added to an aqueous solution containing carbonate or bicarbonate ions, carbon dioxide gas is formed. We generally say that carbonic acid (H2CO3) is unstable. Use bond energies to estimate ΔH for the reaction (in the gas phase)
H2CO3 → CO2 + H2O
Specify a possible cause for the instability of carbonic acid.
Expert Solution & Answer
Want to see the full answer?
Check out a sample textbook solutionStudents have asked these similar questions
23.
Given that the enthalpy of neutralization for the reaction of HCl (a strong acid) and NaOH (a strong base) is always -55.90 kJ per mole of H2O formed, what is the concentration of a 55 mL sample of HCl if the enthalpy of neutralization for the reaction was found to be -4.85 kJ, ΔTsoln = 4.5 ºC and the calorimeter constant value is 0.17 kJ/ºC
2.34 M
0.73 M
4.15 M
1.33 M
1.52 M
What is the average bond energy in CO2?
CO2(g) ΔH°f, = –393.5 kJ mol–1
CO(g) ΔH°f, = –110.5 kJ mol–1
C(g) ΔH°f, = +715 kJ mol–1
CO32–(aq) ΔH°f, = –676.3 kJ mol–1
O(g) ΔH°f, = +249.0 kJ mol–1
Question 5 options:
207 kJ mol–1
1607 kJ mol–1
804 kJ mol–1
Decide whether each of the following reactions is product or reactant-favored. Then, calculate the standard enthalpy change of the reaction in each case and draw an energy level diagram to represent it.
a) The decomposition of ozone, O3, to oxygen molecules
b) the decomposition of MgCO3 (s) to give MgO(s) and CO2(g)
Chapter 8 Solutions
Chemistry with Access Code, Hybrid Edition
Ch. 8 - Distinguish between the terms electronegativity...Ch. 8 - When an element forms an anion, what happens to...Ch. 8 - Define the term lattice energy. Why,...Ch. 8 - Explain how bond energies can be used to estimate...Ch. 8 - Prob. 5RQCh. 8 - Explain the terms resonance and delocalized...Ch. 8 - Define formal charge and explain how to calculate...Ch. 8 - Give two requirements that should be satisfied for...Ch. 8 - Consider the following compounds: CO2, SO2, KrF2,...Ch. 8 - Explain the electronegativity trends across a row...
Ch. 8 - The ionic compound AB is formed. The charges on...Ch. 8 - Prob. 3ALQCh. 8 - The bond energy for a CH bond is about 413 kJ/mol...Ch. 8 - Prob. 5ALQCh. 8 - Which has the greater bond lengths: NO2 or NO3?...Ch. 8 - The following ions are best described with...Ch. 8 - The second electron affinity values for both...Ch. 8 - What is meant by a chemical bond? Why do atoms...Ch. 8 - Why are some bonds ionic and some covalent?Ch. 8 - How does a bond between Na and Cl differ from a...Ch. 8 - Arrange the following molecules from most to least...Ch. 8 - Does a Lewis structure tell which electron come...Ch. 8 - Describe the type of bonding that exists in die...Ch. 8 - Some plant fertilizer compounds are (NH4)2SO4,...Ch. 8 - Some of the important properties of ionic...Ch. 8 - What is the electronegativity trend? Where does...Ch. 8 - Give one example of a compound having a linear...Ch. 8 - When comparing the size of different ions, the...Ch. 8 - In general the higher the charge on the ions in an...Ch. 8 - Combustion reactions of fossil fuels provide most...Ch. 8 - Which of the following statements is/are true?...Ch. 8 - Three resonance structures can be drawn for CO2....Ch. 8 - Which of the following statements is(are) true?...Ch. 8 - Without using Fig. 3-4, predict the order of...Ch. 8 - Without using Fig. 3-4, predict the order of...Ch. 8 - Without using Fig. 3-4, predict which bond in each...Ch. 8 - Without using Fig. 3-4, predict which bond in each...Ch. 8 - Prob. 31ECh. 8 - Prob. 32ECh. 8 - Which of the following incorrectly shows the bond...Ch. 8 - Indicate the bond polarity (show the partial...Ch. 8 - Predict the type of bond (ionic, covalent, or...Ch. 8 - List all the possible bonds that can occur between...Ch. 8 - Hydrogen has an electronegativity value between...Ch. 8 - Rank the following bonds in order of increasing...Ch. 8 - State whether or not each of the following has a...Ch. 8 - The following electrostatic potential diagrams...Ch. 8 - Prob. 41ECh. 8 - Prob. 42ECh. 8 - Predict the empirical formulas of the ionic...Ch. 8 - Predict the empirical formulas of the ionic...Ch. 8 - Write electron configurations for a. the cations...Ch. 8 - Write electron configurations for a. the cations...Ch. 8 - Which of the following ions have noble gas...Ch. 8 - What noble gas has the same electron configuration...Ch. 8 - Give the formula of a negative ion that would have...Ch. 8 - Prob. 50ECh. 8 - Give three ions that are isoelectronic with neon....Ch. 8 - Consider the ions Sc3+, Cl, K+, Ca2+, and S2....Ch. 8 - Prob. 53ECh. 8 - For each of the following groups, place the atoms...Ch. 8 - Which compound in each of the following pairs of...Ch. 8 - Which compound in each of the following pairs of...Ch. 8 - Use the following data for potassium chloride to...Ch. 8 - Use the following data for magnesium fluoride to...Ch. 8 - Consider the following energy changes: E(kJ/mol)...Ch. 8 - Compare the electron affinity of fluorine to the...Ch. 8 - Prob. 61ECh. 8 - Use the following data (in kJ/mol) to estimate E...Ch. 8 - Rationalize the following lattice energy values:...Ch. 8 - The lattice energies of FeCl3, FeCl2, and Fe2O3...Ch. 8 - Use bond energy values (Table 3-3) to estimate E...Ch. 8 - Use bond energy values (Table 3-3) to estimate E...Ch. 8 - Prob. 67ECh. 8 - Acetic acid is responsible for the sour taste of...Ch. 8 - Use bond energies to predict E for the following...Ch. 8 - The major industrial source of hydrogen gas is by...Ch. 8 - Use bond energies to estimate E for the combustion...Ch. 8 - Prob. 72ECh. 8 - Prob. 73ECh. 8 - Consider the following reaction: A2+B22AB E =...Ch. 8 - Compare your answers from parts a and b of...Ch. 8 - Compare your answers from Exercise 72 to the H...Ch. 8 - The standard enthalpies of formation for S(g),...Ch. 8 - Use the following standard enthalpies of formation...Ch. 8 - The standard enthalpy of formation for N2H2(g) is...Ch. 8 - The standard enthalpy of formation for NO(g) is...Ch. 8 - Write Lewis structures that obey the octet rule...Ch. 8 - Write Lewis structures that obey the octet rule...Ch. 8 - Write Lewis structures that obey the octet rule...Ch. 8 - Write Lewis structures that obey the octet rule...Ch. 8 - One type of exception to the octet rule are...Ch. 8 - Lewis structures can be used to understand why...Ch. 8 - The most common exceptions to the octet rule are...Ch. 8 - Prob. 88ECh. 8 - Write Lewis structures for the following. Show all...Ch. 8 - Prob. 90ECh. 8 - Benzene (C6H6) consists of a six-membered ring of...Ch. 8 - Borazine (B3N3H6) has often been called inorganic...Ch. 8 - An important observation supporting the concept of...Ch. 8 - Consider the following bond lengths: CO143pmC9O123...Ch. 8 - A toxic cloud covered Bhopal, India, in December...Ch. 8 - Peroxyacetyl nitrate, or PAN, is present in...Ch. 8 - Prob. 99ECh. 8 - Use formal charge arguments to explain why CO has...Ch. 8 - Write Lewis structures that obey the octet rule...Ch. 8 - Write Lewis structures for the species in Exercise...Ch. 8 - Oxidation of the cyanide ion produces the stable...Ch. 8 - When molten sulfur reacts with chlorine gas, a...Ch. 8 - Prob. 106ECh. 8 - Prob. 108ECh. 8 - Predict the molecular structure and bond angles...Ch. 8 - Predict die molecular structure and bond angles...Ch. 8 - There are several molecular structures based on...Ch. 8 - Two variations of the octahedral geometry (see...Ch. 8 - Predict the molecular structure (including bond...Ch. 8 - Predict the molecular structure (including bond...Ch. 8 - Predict the molecular structure (including bond...Ch. 8 - Predict the molecular structure (including bond...Ch. 8 - Prob. 117ECh. 8 - Which of the molecules in Exercise 120 have net...Ch. 8 - Which of the molecules in Exercise 121 have net...Ch. 8 - Which of the molecules in Exercise 122 have net...Ch. 8 - Write Lewis structures and predict the molecular...Ch. 8 - Write Lewis structures and predict whether each of...Ch. 8 - Consider the following Lewis structure where E is...Ch. 8 - Consider the following Lewis structure where E is...Ch. 8 - Prob. 125ECh. 8 - Two different compounds have the formula XeF2Cl2....Ch. 8 - Arrange the following in order of increasing...Ch. 8 - For each of the following, write an equation that...Ch. 8 - Use bond energies (table 3-3), values of electron...Ch. 8 - Write Lewis structures for CO32, HCO3, and H2CO3....Ch. 8 - Which member of the following pairs would you...Ch. 8 - What do each of the following sets of...Ch. 8 - Prob. 133AECh. 8 - Although both Br3 and I3 ions are known, the F3...Ch. 8 - Which of the following molecules have not dipole...Ch. 8 - Prob. 137AECh. 8 - Look up the energies for the bonds in CO and N2....Ch. 8 - Classify the bonding in each of the following...Ch. 8 - List the bonds PCl, PF, OF, and SiF from least...Ch. 8 - Arrange the atoms and/or ions in the following...Ch. 8 - Use the following data to estimate E for the...Ch. 8 - Use bond energy values to estimate E for the...Ch. 8 - Which of the following compounds or ions exhibit...Ch. 8 - The formulas of several chemical substances are...Ch. 8 - Predict the molecular structure, bond angles, and...Ch. 8 - Use Coulombs Jaw, V=Q1Q240r=2.311019Jnm(Q1Q2r) to...Ch. 8 - Prob. 148CPCh. 8 - Calculate the standard heat of formation of the...Ch. 8 - Given the following information: Energy of...Ch. 8 - Prob. 151CPCh. 8 - Think of forming an ionic compound as three steps...Ch. 8 - The compound NF3 is quite stable, but NCl3, is...Ch. 8 - Three processes that have been used for the...Ch. 8 - The compound hexaazaisowurtzitane is one of the...Ch. 8 - Many times extra stability is characteristic of a...Ch. 8 - The study of carbon-containing compounds and their...Ch. 8 - Draw a Lewis structure for the N,...Ch. 8 - Prob. 159CPCh. 8 - Consider the following computer-generated model of...Ch. 8 - A compound, XF5, is 42.81% fluorine by mass....Ch. 8 - Identify the following elements based on their...
Knowledge Booster
Learn more about
Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.Similar questions
- Use the appropriate tables to calculate H for (a) the reaction between copper(II) oxide and carbon monoxide to give copper metal and carbon dioxide. (b) the decomposition of one mole of methyl alcohol (CH3OH) to methane and oxygen gases.arrow_forwardThe reaction of quicklime, CaO, with water produces slaked lime, Ca(OH)2, which is widely used in the construction industry to make mortar and plaster. The reaction of quicklime and water is highly exothermic: CaO(s)+H2O(l)Ca(OH)2(s)H=350kJmol1 (a) What is the enthalpy of reaction per gram of quicklime that reacts?. (b) How much heat, in kilojoules, is associated with the production of 1 ton of slaked lime?arrow_forwardFrom the data given in Appendix I, determine the standard enthalpy change and the standard free energy change for each of the following reactions: (a) BF3(g)+3H2O(l)B(OH)3(s)+3HF(g) (b) BCl3(g)+3H2O(l)B(OH)3+3HCl(g) (c) B2H6(g)+6H2O(l)2B(OH)3(s)+6H2(g)arrow_forward
- Which molecule, F2, Cl2, Br2, or I2, has the weakest chemical bond?arrow_forwardGiven the following data: NO2(g) NO(g) + O(g)H = 233 kJ 2O3(g) 3O2(g)H = 427 kJ NO(g) + O3(g) NO2(g) + O2(g)H = 199 kJ Calculate the bond energy for the O2 bond, that is, calculate H for: O2(g) 2O(g)H = ?arrow_forwardConsider the reaction 2 S(g) + 3 O2(g) → 2 SO3(g). Using the standard enthalpies of formation listed in Appendix G of your text and the bond energy of 498.4 kJ/mol in molecular oxygen, calculate the average sulfur-oxygen bond energy, in units of kJ/mol, in sulfur trioxide gas. The answer is not 380/381.arrow_forward
- Bromine monofluoride (BrF) disproportionates to bromine gas and bromine tri- and pentafluorides. Use the following to find ΔH°rxn for the decomposition of BrF to its elements 3BrF(g) →Br₂(g)+BrF₃(l) ΔH°rxn=-125.3 kJ 5BrF(g) →2Br₂(g)+BrF₅(l) ΔH°rxn=-166.1 kJ BrF₃(l)+F₂(g) →BrF₅(l) ΔH°rxn=-158.0 kJarrow_forwardCalculate AH for the reaction NH3 (g) + CH4 (g) → HCN (g) + 3 H2 (g) , from the following data. N2 (g) + 3 H2 (g) → 2 NH3 (g) ΔΗ- – 91. 8 kJ /mol C (s, graphite) + 2 H2 (g) → CH4 (g) - 74. 9 kJ / mol AH = 2 C (s, graphite) + H2 (g) + N2 (g) → 2 HCN (g) AH = ΔΗ: 270. 3 kJ / molarrow_forward22. Given that the enthalpy of neutralization for the reaction of HCl (a strong acid) and NaOH (a strong base) is always -55.90 kJ per mole of H2O formed, what is the concentration of a 65 mL sample of HCl if the enthalpy of neutralization for the reaction was found to be -5.38 kJ, assuming no heat is lost to the calorimeter? 0.96 M 1.48 M 1.60 M 0.38 M 4.63 Marrow_forward
- Hello, I need assistance with solving the following General Chemistry questions. Two in total, both attachments have been added.arrow_forwardCalculate ΔH (in kJ/mol) for the reaction described by the equation. 6 NH3(g) + 5 O3(g) → 6 NO(g) + 9 H2O(l)arrow_forwardGiven the following reactions: 2S (s) + 3O2 (g) → 2SO3 (g) ΔH = -790 kJ S (s) + O2 (g) → SO2(g) ΔH = -297 kJ calculate the enthalpy of the reaction in which sulfur dioxide is oxidized to sulfur trioxide: 2SO2 (g) + O2 (g) → 2SO3 (g) ΔH = ?arrow_forward
arrow_back_ios
SEE MORE QUESTIONS
arrow_forward_ios
Recommended textbooks for you
- ChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage LearningChemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage LearningChemistry: Principles and ReactionsChemistryISBN:9781305079373Author:William L. Masterton, Cecile N. HurleyPublisher:Cengage Learning
- Chemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781133949640Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781337399074Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage Learning
Chemistry
Chemistry
ISBN:9781305957404
Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste
Publisher:Cengage Learning
Chemistry: An Atoms First Approach
Chemistry
ISBN:9781305079243
Author:Steven S. Zumdahl, Susan A. Zumdahl
Publisher:Cengage Learning
Chemistry: Principles and Reactions
Chemistry
ISBN:9781305079373
Author:William L. Masterton, Cecile N. Hurley
Publisher:Cengage Learning
Chemistry: The Molecular Science
Chemistry
ISBN:9781285199047
Author:John W. Moore, Conrad L. Stanitski
Publisher:Cengage Learning
Chemistry & Chemical Reactivity
Chemistry
ISBN:9781133949640
Author:John C. Kotz, Paul M. Treichel, John Townsend, David Treichel
Publisher:Cengage Learning
Chemistry & Chemical Reactivity
Chemistry
ISBN:9781337399074
Author:John C. Kotz, Paul M. Treichel, John Townsend, David Treichel
Publisher:Cengage Learning
Calorimetry Concept, Examples and Thermochemistry | How to Pass Chemistry; Author: Melissa Maribel;https://www.youtube.com/watch?v=nSh29lUGj00;License: Standard YouTube License, CC-BY