Concept explainers
Interpretation:
The standard enthalpy of formation
Concept Introduction:
The standard enthalpy of formation
Hess's law of constant heat summation states that the total enthalpy change for a given reaction can be expressed as a sum of the enthalpies of the intermediate reactions i.e.
Here, ΔH = total enthalpy change
ΔH1, ΔH2… ΔHn are the enthalpy changes of the intermediate steps.
Want to see the full answer?
Check out a sample textbook solutionChapter 4 Solutions
Thermodynamics, Statistical Thermodynamics, & Kinetics
- What mass of acetylene, C2H2(g), must be burned to produce 3420 kJ of heat, given that its enthalpy of combustion is 1301 kJ/mol? Compare this with the answer to Exercise 5.91 and determine which substance produces more heat per gram.arrow_forwardThe enthalpy change for the following reaction is 393.5 kJ. C(s,graphite)+O2(g)CO2(g) (a) Is energy released from or absorbed by the system in this reaction? (b) What quantities of reactants and products are assumed? (c) Predict the enthalpy change observed when 3.00 g carbon burns in an excess of oxygen.arrow_forwardGasohol, a mixture of gasoline and ethanol, C2H5OH, is used as automobile fuel. The alcohol releases energy in a combustion reaction with O2. C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) If 0.115 g ethanol evolves 3.62 kJ when burned at constant pressure, calculate the combustion enthalpy for ethanol.arrow_forward
- Is the following reaction the appropriate one to use in determining the enthalpy of formation of methane, CH4(g)? Why or why not? C(g)+4H(g)CH4(g)arrow_forwardThe thermochemical equation for the burning of methane, the main component of natural gas, is CH4(g)+2O2(g)CO2(g)+2H2O(l)H=890kJ (a) Is this reaction endothermic or exothermic? (b) What quantities of reactants and products are assumed if H = 890 kJ? (c) What is the enthalpy change when 1.00 g methane burns in an excess of oxygen?arrow_forward9.41 Under what conditions does the enthalpy change equal the heat of a process?arrow_forward
- Under what circumstances is the heat of a process equal to the enthalpy change for the process?arrow_forwardUsing the data in Appendix G, calculate the standard enthalpy change for each of the following reactions: (a) Si(s)+2F2(g)SiF4(g) (b) 2C(s)+2H2(g)+O2(g)CH3CO2H(l) (c) CH4(g)+N2(g)HCN(g)+NH3(g) ; (d) CS2(g)+3Cl2(g)CCl4(g)+S2Cl2(g)arrow_forwardA 0.470-g sample of magnesium reacts with 200 g dilute HCl in a coffee-cup calorimeter to form MgCl2(aq) and H2(g). The temperature increases by 10.9 C as the magnesium reacts. Assume that the mixture has the same specific heat as water and a mass of 200 g. (a) Calculate the enthalpy change for the reaction. Is the process exothermic or endothermic? (b) Write the chemical equation and evaluate H.arrow_forward
- Give the definition of the standard enthalpy of formation for a substance. Write separate reactions for the formation of NaCl, H2O , C6H12O6, and PbSO4 that have H values equal to Hf for each compound.arrow_forwardCompounds with carboncarbon double bonds, such as ethylene, C2H4, add hydrogen in a reaction called hydrogenation. C2H4(g)+H2(g)C2H6(g) Calculate the enthalpy change for this reaction, using the following combustion data: C2H4(g)+3O2(g)2CO2(g)+2H2O(l);H=1411kJC2H6(g)+72O2(g)2CO2(g)+3H2O(l);H=1560kJH2(g)+12O2(g)H2O(l);H=286kJarrow_forwardThe first step in the preparation of lead from its ore (galena, PbS) consists of roasting the ore. PbS(s)+32O2(g)SO2(g)+PbO(s) Calculate the standard enthalpy change for this reaction, using enthalpies of formation (see Appendix C).arrow_forward
- ChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage LearningChemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage Learning
- Chemistry & Chemical ReactivityChemistryISBN:9781133949640Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781337399074Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningChemistry: Matter and ChangeChemistryISBN:9780078746376Author:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl WistromPublisher:Glencoe/McGraw-Hill School Pub Co