Problem 1PE: In what way dots the chapter-opening photo represent a dynamic equilibrium and in what ways does it... Problem 2PE: Write the equilibrium law for each of the following:... Problem 3PE: The equilibrium law for a reaction is [NO2]4[N2O3]2[O2]=Kc Write the chemical equation for this... Problem 4PE: At25C,Kc=7.01025forthereaction2SO2(g)+O2(g)2SO3(g) What is the value of Kc for the reaction:... Problem 5PE: At 25C, the following reactions have the equilibrium constants noted to the right of their... Problem 6PE: Write the equilibrium law in terms of partial pressures for the following reaction. (Hint: Keep in... Problem 7PE: Using partial pressures, write the equilibrium law for the reaction H2(g)+I2(g)2HI(g) Problem 8PE: Nitrous oxide, , is a gas used as an anesthetic; ir is sometimes called “laughing gas." This... Problem 9PE: Methanol, CH5OH, is a promising fuel that can be synthesized from carbon monoxide and hydrogen... Problem 10PE: Write the equilibrium law for the following reaction. (Hint: Follow the reasoning above.)
Problem 11PE: Write the equilibrium law for each of the following heterogeneous reactions.... Problem 12PE: Suppose a mixture contained equal concentrations of H2,Br2,andHBr. Given that the reaction... Problem 13PE: Arrange the following reactions in order of their increasing tendency to proceed toward... Problem 14PE: Consider the equilibrium PCl5(g)+4H2O(g)H3PO4(l)+5HC1(g) How will the amount of H3PO4 at equilibrium... Problem 15PE: Consider the equilibrium PCl3(g)+Cl2(g)PCl5(g) for which H=-88kJ. How will the amount of Cl2 at... Problem 16PE: In a particular experiment, it was found that when were mixed and allowed to react according to the... Problem 17PE: An equilibrium was established for the reaction CO(g)+H2O(g)CO2(g)+H2(g) at 500C. (This is an... Problem 18PE: A student placed 0.200 mol of PCl3(g) and 0.100 mol of Cl2(g) into 1.00 liter container at 250C.... Problem 19PE: The decomposition of ,
has vessel contained 0.0466 mol at equilibrium. What was the concentration... Problem 20PE Problem 21PE: During an experiment, 0.200molofH2and0.200molofI2 were placed into a 1.00 liter vessel where the... Problem 22PE: In an experiment, were placed in a 1.00 L vessel where the following equilibrium was... Problem 23PE: At 25C, the reaction 2NH3(g)N2(g)+3H2(g)hasKc=2.310-9. If 0.041 mol NH3 is placed in a 1.00 L... Problem 24PE: In air at and 1.00 atm, the concentration is 0.033 M and the concentration is 0.00810 M. The... Problem 1RQ: Dynamic Equilibrium in Chemical Systems 14.1 Sketch a graph showing how the concentrations of the... Problem 2RQ: Dynamic Equilibrium in Chemical Systems
14.2 Using black circles to represent A and open circles to... Problem 3RQ: Dynamic Equilibrium in Chemical Systems Repeat the exercise in Question 14.1 but this time start... Problem 4RQ: Dynamic Equilibrium in Chemical Systems
14.4 Using black circles to represent A and open circles to... Problem 5RQ: 14.5 What meanings do the terms reactants and products have when describing a chemical equilibrium? Problem 6RQ: Equilibrium Laws
14.6 What is an equilibrium law?. How does it differ from the mass action... Problem 7RQ: Equilibrium Laws
14.7 How is the term reaction quotient defined? What symbol is it given?
Problem 8RQ: Equilibrium Laws
14.8 When a chemical equation and its equilibrium constant are given, why is it not... Problem 9RQ: Equilibrium Laws 14.9 Under what conditions does the reaction quotient equal Kc. Problem 10RQ: Equilibrium Laws
14.10 Describe in words how the mass action expression is written.
Problem 11RQ: Equilibrium Laws Based on Pressures or Concentrations State in words how Kp is written. Problem 12RQ: Equilibrium Laws Based on Pressures or Concentrations
14.12 State the equation relating and define... Problem 13RQ: Equilibrium Laws Based on Pressures or Concentrations Consider the following equilibrium.... Problem 14RQ: Equilibrium Laws Based on Pressures or Concentrations Use the ideal gas law to show that the partial... Problem 15RQ: Equilibrium Laws for Heterogeneous Reactions 14.15 What is the difference between a heterogeneous... Problem 16RQ: Equilibrium Laws for Heterogeneous Reactions 14.16 Why do we omit the concentrations of pure liquids... Problem 17RQ: Position of Equilibrium and the Equilibrium Constant 14.17 Suppose for the reaction AB the value of... Problem 18RQ: Position of Equilibrium and the Equilibrium Constant For the reaction in Question 14.17, sketch a... Problem 19RQ: Position of Equilibrium and the Equilibrium Constant At 225C,Kp=6.310-3 for the reaction... Problem 20RQ: Position of Equilibrium and the Equilibrium Constant Here are some reactions and their equilibrium... Problem 21RQ: Equilibrium and Le Chtelier's Principle State Le Chtelier's principle in your own words. Problem 22RQ: Equilibrium and Le Chtelier's Principle Explain, using its effect on the reaction quotient, why... Problem 23RQ: Equilibrium and Le Chteliers Principle Halving the volume of a gas doubles its pressure. Using the... Problem 24RQ: Equilibrium and Le Chteliers Principle How will the value of Kp for the following reactions be... Problem 25RQ: Equilibrium and Le Châtelier's Principle
14.25 Why doesn’t a catalyst affect the position of... Problem 26RQ: Equilibrium and Le Chtelier's Principle Why doesnt adding an inert gas to increase the pressure,... Problem 27RQ: Equilibrium Laws
14.27 Write the equilibrium law for each of the following gas phase reactions in... Problem 28RQ: Equilibrium Laws
14.28 Write the equilibrium law for each of the following gas phase reactions in... Problem 29RQ: Write the equilibrium law for the following reactions in aqueous solution.... Problem 30RQ: Write the equilibrium law for the following reactions in aqueous solution.... Problem 31RQ: At 25C,Kc=11085 for the reaction 7IO3(aq)+9H2O+7H+(aq)I2(aq)+5H5IO6(aq) What is the value of Kc for... Problem 32RQ: Use the following equilibria... Problem 33RQ: Write the equilibrium law for each of the following reactions in terms of molar concentrations:... Problem 34RQ: 14.34 Write the equilibrium law for the reaction
How does for this reaction compare with for... Problem 35RQ: Equilibrium Laws Based on Pressures and Concentrations
14.35 Write the equilibrium law for the... Problem 36RQ: 14.36 Write the equilibrium law for the reactions in Problem 14.28 in terms of partial... Problem 37RQ Problem 38RQ Problem 39RQ: For which of the following reactions does Kp=Kc? (a) CO2(g)+H2(g)CO(g)+H2O(g) (b)... Problem 40RQ: For which of the following reactions does KpKc? (a) 2H2(g)+C2H2(g)C2H6(g) (b) N2(g)+O2(g)2NO(g) (c)... Problem 41RQ: 14.41 The reaction has a . What is the value of at this temperature?
Problem 42RQ: 14.42 The reaction has a . What is the value of for this reaction at this temperature?
Problem 43RQ: 14.43 The reaction has a . What is the value of at this temperature?
Problem 44RQ: One possible way of removing NO from the exhaust of a gasoline engine is to cause it to react with... Problem 45RQ: At 773C the reaction CO(g)+2H2(g)CH3OH(g) has Kc=0.40. What is KP at this temperature? Problem 46RQ: The reaction COCl2(g)CO(g)+Cl2(g)hasKp=4.610-2at395C. What is Kc at this temperature? Problem 47RQ: Equilibrium Laws for Heterogeneous Reactions Calculate the molar concentration of water in (a)... Problem 48RQ: Equilibrium Laws for Heterogeneous Reactions The density of sodium chloride is 2.164gcm-3. What is... Problem 49RQ: Equilibrium Laws for Heterogeneous Reactions
14.49 Write the equilibrium law corresponding to for... Problem 50RQ: Equilibrium Laws for Heterogeneous Reactions
14.50 Write the equilibrium law corresponding to for... Problem 51RQ: The heterogeneous reaction 2HCl(g)+I2(s)2HI(g)+Cl2(g)hasKc=1.610-34 at 25C. Suppose 0.100molofHCl... Problem 52RQ: At 25C,Kc=360 for the reaction AgCl(s)+Br-(aq)AgBr(s)+Cl-(aq) If solid AgCl is added to a solution... Problem 53RQ: Equilibrium and Le Chtelier's Principle The reaction CO(g)+2H2(g)CH3OH(g) has H=18kJ. How will the... Problem 54RQ: Equilibrium and Le Chtelier's Principle How will the position of equilibrium in the reaction... Problem 55RQ: 14.55 Consider the equilibrium
In which direction will this equilibrium be shifted by the following... Problem 56RQ: Consider the equilibrium 2NO(g)+Cl2(g)2NOCl(g) for which H=77.07kJ. How will the amount of Cl2 at... Problem 57RQ: Calculating Equilibrium Constants At 773C, a mixture of CO(g),H2(g),andCH3OH(g) was allowed to come... Problem 58RQ: Calculating Equilibrium Constants Ethylene, C2H4, and water react under appropriate conditions to... Problem 59RQ: At high temperature, 2.00 mol of HBr was placed in a 4.00 L container where it decomposed in the... Problem 60RQ: A 0.050 mol sample of formaldehyde vapor, CH2O, was placed in a heated 500 mL vessel and some of it... Problem 61RQ: The reaction NO2(g)+NO(g)N2O(g)+O2(g) reached equilibrium at a certain high temperature. Originally,... Problem 62RQ: At 25C,0.0560molO2and0.020molN2O were placed in a 1.00 L container where the following equilibrium... Problem 63RQ: Using Equilibrium Constants to Calculate Concentrations
14.63 At a certain temperature, for the... Problem 64RQ: Using Equilibrium Constants to Calculate Concentrations At 460C, the reaction... Problem 65RQ: 14.65 At a certain temperature, the reaction
has . If a reaction mixture at equilibrium contains... Problem 66RQ: 14.66 for the reaction
at a certain temperature. Suppose it was found that in an equilibrium... Problem 67RQ: At 25C,Kc=0.145 for the following reaction in the solvent CCl4. 2BrClBr2+Cl2 If the initial... Problem 68RQ: At 25C,Kc=0.145 for the following reaction in the solvent CC14. 2BrClBr2+Cl2 If the initial... Problem 69RQ: 14.69 The equilibrium constant, Kc, for the reaction
was found to be 0.500 at a certain... Problem 70RQ: For the reaction in Problem 14.69, a reaction mixture is prepared in which 0.120 mol NO2 and 0.120... Problem 71RQ: 14.71 At a certain temperature the reaction
has . Exactly 1.00 mol of each gas was placed in a... Problem 72RQ: At 25C,Kc=0.145 for the following reaction in the solvent CCl4. 2BrClBr2+Cl2 If the initial... Problem 73RQ: The reaction 2HCl(g)H2(g)+Cl2(g)hasKc=3.210-34at25C. If a reaction vessel contains initially... Problem 74RQ: 14.74 At for the reaction
If and are placed in a 4.00 L container, what would the NO... Problem 75RQ: 14.75 At , the decomposition of , has . If a 1.00 L container holding of is heated to , what will... Problem 76RQ: At 500C, the decomposition of water into hydrogen and oxygen, 2H2O(g)2H2(g)+O2(g) Has Kc=6.01028.... Problem 77RQ: 14.77 At a certain temperature, for the equilibrium
If 0.026 mol of is placed in a 2.00 L vessel... Problem 78RQ: At 460C, the reaction SO2(g)+NO2(g)NO(g)+SO3(g) has Kc=85.0. Suppose... Problem 79RQ: 14.79 At a certain temperature, for the reaction
If 0. and 0.200 mol NO are placed in a 2.00 L... Problem 80RQ: At 25C,Kc=0.145 for the following reaction in the solvent CCl4. 2BrClBr2+Cl2 A solution was prepared... Problem 81RQ: *14.81 At a certain temperature, for the reaction
If is placed in a 1.00 L vessel, what will be... Problem 82RQ: The reaction H2(g)+Br2(g)2HBr(g)hasaKc=2.0109at25C.If0.100molofH2and0.200molofBr2 are placed in a... Problem 83RQ: 14.83 The reaction at
. In a reaction vessel containing these gases in equilibrium at this... Problem 84RQ: 14.84 At , the following concentrations were found for the gases in an equilibrium mixture for the... Problem 85RQ: The following reaction in aqueous solution has Kc=11085 at a temperature of 25C.... Problem 86RQ: At a certain temperature, Kc=0.914 for the reaction NO2(g)+NO(g)N2O(g)+O2(g) A mixture was prepared... Problem 87RQ: At 27C,Kc=1.51018 for the reaction 3NO(g)N2O(g)+NO2(g) If 0.030 mol of NO were placed in a 1.00 L... Problem 88RQ: Consider the equilibrium 2NaHSO3(s)Na2SO3(s)+H2O(g)+SO2(g) How will the position of equilibrium be... Problem 89RQ: At a certain temperature, Kc=0.914 for the reaction NO2(g)+NO(g)N2O(g)+O2(g) A mixture was prepared... Problem 90RQ: At a certain temperature, Kc=0.914 for the reaction NO2(g)+NO(g)N2O(g)+O2(g) Equal amounts of... Problem 91RQ: 14.91 Two 1.00 L bulbs are filled with 0.500 atm of , respectively, as illustrated in the... Problem 92RQ: For the equilibrium 3NO2(g)N2O5(g)+NO(g) Kc=1.01011. If a 4.00 L container initially holds... Problem 93RQ: To study the following reaction at 20C, NO(g)+NO2(g)+H2O(g)2HNO2(g) a mixture of... Problem 94RQ: Describe in words how the mass action expression is written. At 100.0C,Kc=0.135 for the reaction... Problem 95RQ: *14.95 For the reaction below,
A mixture of was prepared in a 2.00 L reaction vessel at in which... Problem 96RQ: At 2000C, the decomposition of CO2, 2CO2(g)2CO(g)+O2(g) has Kc=6.410-7. If a 1.00 L container... Problem 97RQ: *14.97 At , the reaction
has are placed in a 10.0 L container at this temperature, what is the... Problem 98RQ: At 200.0C,Kc=1.410-10 for the reaction N2O(g)+NO2(g)3NO(g) If 300 mL of NO measured at 800 torr and... Problem 99RQ: At 400C,Kc=2.9104 for the reaction: HCHO2(g)CO(g)+H2O(g) A mixture was prepared with the following... Problem 100RQ: *14.100 The reaction . Into a 4.50 L reaction vessel at this temperature was placed . What will be... Problem 101RQ: 14.101 In an equilibrium law, coefficients in the balanced equation appear as exponents on... Problem 102RQ: Why are equilibrium concentrations useful to know? Problem 103RQ: 14.103 Suppose we set up a system in which water is poured into a vessel having a hole in the... Problem 104RQ: 14.104 Do equilibrium laws apply to other systems outside of chemistry? Give examples.
Problem 105RQ: What might prevent a system from reaching dynamic equilibrium? Illustrate your answer with examples. Problem 106RQ: 14.106 After many centuries the earth’s atmosphere still has not come to equilibrium with the oceans... Problem 107RQ: 14.107 If a mixture consisting of many small crystals in contact with a saturated solution is... Problem 108RQ: Why doesnt Le Chteliers principle apply to the removal of some of a solid or pure liquid from a... Problem 109RQ: 14.109 Le Châtelier’s principle qualitatively describes what will occur if a reactant or product is... format_list_bulleted
Principles of Modern ChemistryChemistryISBN:9781305079113Author:David W. Oxtoby, H. Pat Gillis, Laurie J. ButlerPublisher:Cengage Learning
Chemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage Learning
General, Organic, and Biological ChemistryChemistryISBN:9781285853918Author:H. Stephen StokerPublisher:Cengage Learning
Chemistry: Principles and PracticeChemistryISBN:9780534420123Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward MercerPublisher:Cengage Learning
Chemistry: Matter and ChangeChemistryISBN:9780078746376Author:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl WistromPublisher:Glencoe/McGraw-Hill School Pub Co
Chemistry & Chemical ReactivityChemistryISBN:9781337399074Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage Learning