Using data from this chapter, calculate the change inenergy expected for each of the following processes.
a.
b.
c.
d.
Want to see the full answer?
Check out a sample textbook solutionChapter 12 Solutions
EBK WEBASSIGN FOR ZUMDAHL'S CHEMICAL PR
- xplain why aluminum cans make good storage containers for soft drinks. Styrofoam cups can be used to keep coffee hot and cola cold. How can this be?arrow_forwardWhat quantity of heat energy must have en applied to a block of aluminum weighing 42.7 g if the temperature of the block of aluminum increased by 15.2 °C? (See Table 10.1.)arrow_forwardThe equation for the fermentation of glucose to alcohol and carbon dioxide is: C6H12O6(aq) 2C2H5OH(aq) + 2CO2(g) The enthalpy change for the reaction is 67 kJ. Is this reaction exothermic or endothermic? Is energy, in the form of heat, absorbed or evolved as the reaction occurs?arrow_forward
- The second law of thermodynamics has been called the arrow of time. Explain why this is so.arrow_forwardEnergy consumption in the United States amounts to the equivalent of the energy obtained by burning 7.0 gal of oil or 70. lb of coal per day per person. Using data in Table 20.4, carry out calculations to show that the energy evolved from these quantities of oil and coal is approximately equivalent. The density of fuel oil is approximately 0.8 g/mL. (1.00 gal = 3.785 L and 1.00 lb = 454 g)arrow_forwardThe first step in the preparation of lead from its ore (galena, PbS) consists of roasting the ore. PbS(s)+32O2(g)SO2(g)+PbO(s) Calculate the standard enthalpy change for this reaction, using enthalpies of formation (see Appendix C).arrow_forward
- Hydrogen gas and oxygen gas react violently to form water. ol type='a'> Which is lower in energy: a mixture of hydrogen gases, or water? Explain. i>Sketch an energy-level diagram (like Fig. 10.5) for this reaction and explain it.arrow_forwardLiquid hydrogen peroxide has been used as a propellant for rockets. Hydrogen peroxide decomposes into oxygen and water, giving off heat energy equal to 686 Btu per pound of propellant. What is this energy in joules per gram of hydrogen peroxide? (1 Btu = 252 cal; see also Table 1.4.)arrow_forwardHigh-quality audio amplifiers generate large amounts of heat. To dissipate the heat and prevent damage to the electronic components, heat-radiating metal fins are used. Would it be better to make these fins out of iron or aluminum? Why? (See Table 7- l for specific heat capacities.)arrow_forward
- Which of the following processes is endothermic? a. ice melting b. a piece of paper burning c. a bomb exploding d. an organisms metabolism producing a certain amount of heatarrow_forwardNiagara Falls has a height of 167 ft (American Falls). What is the potential energy in joules of 1.00 lb of water at the top of the falls if we take water at the bottom to have a potential energy of zero? What would be the speed of this water at the bottom of the falls if we neglect friction during the descent of the water?arrow_forwardThermal Interactions Part 1: In an insulated container, you mix 200. g of water at 80C with 100. g of water at 20C. After mixing, the temperature of the water is 60C. a How much did the temperature of the hot water change? How much did the temperature of the cold water change? Compare the magnitudes (positive values) of these changes. b During the mixing, how did the heat transfer occur: from hot water to cold, or from cold water to hot? c What quantity of heat was transferred from one sample to the other? d How does the quantity of heat transferred to or from the hot-water sample compare with the quantity of heat transferred to or from the cold-water sample? e Knowing these relative quantities of heat, why is the temperature change of the cold water greater than the magnitude of the temperature change of the hot water. f A sample of hot water is mixed with a sample of cold water that has twice its mass. Predict the temperature change of each of the samples. g You mix two samples of water, and one increases by 20C, while the other drops by 60C. Which of the samples has less mass? How do the masses of the two water samples compare? h A 7-g sample of hot water is mixed with a 3-g sample of cold water. How do the temperature changes of the two water samples compare? Part 2: A sample of water is heated from 10C to 50C. Can you calculate the amount of heat added to the water sample that caused this temperature change? If not, what information do you need to perform this calculation? Part 3: Two samples of water are heated from 20C to 60C. One of the samples requires twice as much heat to bring about this temperature change as the other. How do the masses of the two water samples compare? Explain your reasoning.arrow_forward
- Chemistry & Chemical ReactivityChemistryISBN:9781133949640Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781337399074Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage Learning
- Chemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage LearningIntroductory Chemistry: A FoundationChemistryISBN:9781337399425Author:Steven S. Zumdahl, Donald J. DeCostePublisher:Cengage Learning