Concept explainers
Interpretation: The standard enthalpy of formation of atomic Hydrogen has to be calculated.
Concept Introduction:
The change in enthalpy that is associated with the formation of one mole of a substance from its related elements being in standard state is called standard enthalpy of formation
(
The standard enthalpy of reaction is the enthalpy of reaction that takes place under standard conditions.
The equation for determining the standard enthalpies of compound and element can be given by,
To calculate: The standard enthalpy of formation of atomic Hydrogen
Want to see the full answer?
Check out a sample textbook solutionChapter 10 Solutions
CHEMISTRY:ATOMS FIRST-2 YEAR CONNECT
- A 0.470-g sample of magnesium reacts with 200 g dilute HCl in a coffee-cup calorimeter to form MgCl2(aq) and H2(g). The temperature increases by 10.9 C as the magnesium reacts. Assume that the mixture has the same specific heat as water and a mass of 200 g. (a) Calculate the enthalpy change for the reaction. Is the process exothermic or endothermic? (b) Write the chemical equation and evaluate H.arrow_forwardWhich of the enthalpies of combustion in Table 5.2 the table are also standard enthalpies of formation?arrow_forwardThe equation for the fermentation of glucose to alcohol and carbon dioxide is: C6H12O6(aq) 2C2H5OH(aq) + 2CO2(g) The enthalpy change for the reaction is 67 kJ. Is this reaction exothermic or endothermic? Is energy, in the form of heat, absorbed or evolved as the reaction occurs?arrow_forward
- Hydrazine, N2H4, is a colorless liquid used as a rocket fuel. What is the enthalpy change for the process in which hydrazine is formed from its elements? N2(g)+2H2(g)N2H4(l) Use the following reactions and enthalpy changes: N2H4(l)+O2(g)N2(g)+2H2O(l);H=622.2kJH2(g)+12O2(g)H2O(l);H=285.8kJarrow_forwardThe first step in the preparation of lead from its ore (galena, PbS) consists of roasting the ore. PbS(s)+32O2(g)SO2(g)+PbO(s) Calculate the standard enthalpy change for this reaction, using enthalpies of formation (see Appendix C).arrow_forwardWhen 2.50 g of methane burns in oxygen, 125 kJ of heat is produced. What is the enthalpy of combustion per mole of methane under these conditions?arrow_forward
- What mass of acetylene, C2H2(g), must be burned to produce 3420 kJ of heat, given that its enthalpy of combustion is 1301 kJ/mol? Compare this with the answer to Exercise 5.91 and determine which substance produces more heat per gram.arrow_forwardThe enthalpy change for the following reaction is 393.5 kJ. C(s,graphite)+O2(g)CO2(g) (a) Is energy released from or absorbed by the system in this reaction? (b) What quantities of reactants and products are assumed? (c) Predict the enthalpy change observed when 3.00 g carbon burns in an excess of oxygen.arrow_forwardA compound is 82.7% carbon and 17.3% hydrogen, and has a molar mass of approximately 60 g/mol. When 1.000 g of this compound burns in excess oxygen, the enthalpy change is 49.53 kJ. (a) What is the empirical formula of this compound? (b) What is the molecular formula of this compound? (c) What is the standard enthalpy of formation of this compound? (d) Two compounds that have this molecular formula appear in Appendix G. Which one was used in this exercise?arrow_forward
- Hydrogen, H2, is prepared by steam reforming, in which hydrocarbons are reacted with steam. For CH4, CH4(g)+H2O(g)CO(g)+3H2(g) Calculate the enthalpy change H for this reaction, using standard enthalpies of formation.arrow_forwardThe enthalpy change for the reaction of hydrogen gas with fluorine gas (o produce hydrogen fluoride is 542 U for the equation as written: mg src=Images/HTML_99425-10-41QAP_image001.jpg alt="" align="top"/> l type='a'> What is the enthalpy change per mole of hydrogen fluoride produced? Is the reaction exothermic or endothermic as written? What would be the enthalpy change for the reverse of the given equation (that 1%, for the decomposition of HF into its constituent elements)?arrow_forwardIs the following reaction the appropriate one to use in determining the enthalpy of formation of methane, CH4(g)? Why or why not? C(g)+4H(g)CH4(g)arrow_forward
- General Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage LearningChemistry: Matter and ChangeChemistryISBN:9780078746376Author:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl WistromPublisher:Glencoe/McGraw-Hill School Pub CoChemistry by OpenStax (2015-05-04)ChemistryISBN:9781938168390Author:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark BlaserPublisher:OpenStax
- Chemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781133949640Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningChemistry: Principles and PracticeChemistryISBN:9780534420123Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward MercerPublisher:Cengage Learning