Zinc-air batteries are actively being researched because one reactant (oxygen) is provided in infinite supply for free. The standard cell potential for this battery is 1.65 V. If the cell potential is 1.61 V, what is the partial pressure of oxygen in the cell and a temperature is 25.0\deg C? The reaction in the cell converts Zn(s) and O2(g) into ZnO(s). (5 points) 2Zn(s) + O2(g) --> 2ZnO(s)

Calculate the standard cell potential of the following cell at 25C. Sn(s)Sn2+(aq)I2(aq)I(aq)

The half-cells Ag+(aq. 1.0 M)|Ag(s) and H+(aq, ? M)|H2(1.0 bar) are linked by a salt bridge to create a voltaic cell. With the silver electrode as the cathode, a value of 0.902 V is recorded tor kcell at 298 K. Determine the concentration of H+ and the pH of the solution.

At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.

Halide ions can he deposited at a silver anode, the reaction being Ag(s) + X- AgX(s) +e- Suppose that a cell was formed by immersing a silver anode in an analyte solution that was 0.0250 M Cl-,Br-, and I -ions and connecting the half-cell to a saturated calomel cathode via a salt bridge. (a) Which halide would form first and at what potential? Is the cell galvanic or electrolytic? (b) Could I- and Br- be separated quantitatively? (Take 1.00 l0-5 M as the criterion for quantitative removal of an ion.) If a separation is feasible, what range of cell potential could he used? (c) Repeat part (b) for I- and Cl-. (d) Repeat part (b) for Br- and Cl-.

What is the standard cell potential you would obtain from a cell at 25C using an electrode in which Hg22+(aq) is in contact with mercury metal and an electrode in which an aluminum strip dips into a solution of Al3+(aq)?

Consider a concentration cell that has both electrodes made of some metal M. Solution A in one compartment of the cell contains 1.0 M M2+. Solution B in the other cell compartment has a volume of 1.00 L. At the beginning of the experiment 0.0100 mole of M(NO3)2 and 0.0100 mole of Na2SO4 are dissolved in solution B (ignore volume changes), where the reaction M2+(aq)+SO42(aq)MSO4(s) occurs. For this reaction equilibrium is rapidly established, whereupon the cell potential is found to be 0.44 V at 25C. Assume that the process M2++2eM has a standard reduction potential of 0.31 V and that no other redox process occurs in the cell. Calculate the value of Ksp for MSO4(s) at 25C.

At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.

What is the voltage of a concentration cell of Cl ions where the concentrations are 1.045 and 0.085 M? What the spontaneous reaction?

Calculate K at 25°C for each of the reactions referred to in Question 32. Assume smallest whole-number coefficients.