Write a balanced half-reaction for the oxidation of chromium ion (Cr³+) to dichromate ion (C₁₂0²7-) ₁ in basic aqueous solution. Be sure to add physical state symbols where appropriate.

Q: alance the following equation: Cu(s)+NO3-(aq) yields NO(g) +Cu2+(aq) and explain why redox reaction

A:

Q: Hydrazine has been employed as a reducing agent for metals.Using standard reduction potentials,…

A: EXPLANATION: Hydrazine is used as a reducing agent thus itself get oxidised. Reduction potential of…

Q: Balance the following redox reactions: HCOOH + Mn04 2+ CO2 + Mn in acidic solution 2- Fe(OH)3 + OCI…

A: To find: The balanced equation for the given reaction

Q: Cadmium sulfide (CdS) is used in some semiconductor applications. Calculate the value of the…

A: Recall the given redox reactions,CdS  +  2 e-  →  Cd  +  S2-                            ؏° = -…

Q: Write a balanced half-reaction for the reduction of nitrate ion NO−3 to gaseous nitric oxide

A: NO3- -----> NO (Oxidation number of N decreased from +5 to +2 (by 3 units)

Q: The following chemical reaction takes place in aqueous solution: 2FeCl3 (aq) + 3Na2S (aq) → Fe2S3…

A: Molecular equation:                              2FeCl3(aq) + 3Na2S(aq) →  Fe2S3(s) + 6NaCl(aq)

Q: For the following redox reaction, balance the equation under ACIDIC CONDITIONS. Cu   +   NO3-…

A: 1) Oxidation Half Reaction :  In this half reaction two electrons removed from the Cu and forming…

Q: Balance the following Redox reaction for basic conditions.  Please show your work.…

A: Given that - CrO42-   +    AsH3  -->   Cr(OH)3  +  As   The Oxidation states of Cr in CrO42-…

Q: The chief chemist of the Brite-Metal Electroplating Co. isrequired to certify that the rinse…

A: Given: In devising the analytical procedure to calculate concentration, a 100 g sample is taken from…

Q: Balance the following oxidation - reduction reaction. Identify the oxidizing and the reducing agent.…

A: Oxidation/reducing agent means adding of oxygen and reduction /oxidising agent means removal of…

Q: Use standard reduction potentials to calculate the equilibrium constant for the reaction: 2Cr3+(aq)…

A: Answer: This question is based on the relations between standard cell potential, equilibrium…

Q: How long will it take to deposit 75 g of Fe(s) by electrolysis of molten iron (III) chloride using…

A: Here we have to determine the time required to deposit 75 g of iron in the elctrosysis of FeCl3 by…

Q: Balance the following redox equations by the half-reaction method: 2+ (a) Mn²+ + H₂O₂ →→ MnO₂ + H₂O…

A:

Q: Complete and balance the following half-reaction in basic solution CIO3 (aq) → CIO2(g)

A: Here, the reaction will be: ClO3- (aq) -------------> ClO2(g)

Q: Consider the following two half-reactions and their standard reduction potentials, and answer the…

A:

Q: Calculate the gibbs free energy (ΔGo)  in kilojoules (KJ) for ColCo2+ II Cd2+I Cd   The faraday…

A: In an electrochemical cell, the electrode with higher electrode potential acts as cathode. The…

Q: Write Half Redox reaction of   (Cr2O7)^2-  = Cr(OH)3 . Please Write step by step

A: The hald redox reaction is

Q: Write a balanced half-reaction for the reduction of XO42 (aq) to X(OH)3(S) in a basic solution. Use…

A: Reduction reaction:- XO4-(aq) ==> X(OH)3(s) •We have to balance this reaction in basic medium.

Q: A 100.0 mL sample of spring water was treated to convert any iron Fe2+. Addition of 25.00 mL of…

A:

Q: Write a balanced half-reaction for the oxidation of solid manganese dioxide (MnO₂) to permanganate…

A: Oxidation : Loss of electrons with increase in the oxidation state .Solid manganese dioxide MnO2…

Q: Complete and balance the following half-reaction in acidic solution. Be sure to include the proper…

A: Complete and balance the following half-reaction in acidic solution-

Q: onsider the following equilibrium system:  MnO4− + 4 H+ + 3 e− ⇌ MnO2(s) + 2 H2O(l) (a) Calculate…

A:

Q: Give the balanced Oxidation and Reduction half reactions for CO2(g)+H2O(l)C6H12O6+O2(g)

A: During photosynthesis in presence of sunlight (hv) carbon-di-oxide and water reacts to form…

Q: magnesium + cobalt (II) nitrate;Balanced chemical equation'Reaction type:

A:

Q: Write the balanced equation that shows the reaction that occurs when 1.0 M CrCl3 undergoes…

A: To write the balanced chemical equation when 1.0 M CrCl3 is undergoes electrolysis

Q: Using the table of standard reduction potentials, determine the net redox potential of the reaction,…

A:

Q: Four metals, A, B, C, and D, exhibit the following properties. (a) Only A and C react with l.0 M…

A: The reducing agent is defined as the species( elements, compounds, metals) which tend to give away…

Q: 8. [Ch. 20] Chlorine dioxide (CIO) is produced by the reaction 2NaCIO:(aq) + Cl;(g) → 2C1O:(g) +…

A: Given that, the preparation reaction of chlorine dioxide is shown below 2NaClO2aq + Cl2g →2ClO2g +…

Q: Potassium metal can be prepared by electrolysis of its aqueous salts. True or False?

A: Given statement is false or true

Q: The reaction occurring in the cell in which Al2O3 and aluminum salts are electrolyzed is Al³+ (aq) +…

A: Given electroyzed reaction-Using current =1.0 X 105 ATotal time=24 hour day =(24 X 60 X60 )second…

Q: Identify the oxidizing and reducing agents in the skeletal (unbalanced) reaction. Then, balance the…

A:

Q: Use the half-reaction method to balance each of the following equations. (a) MnO₂ + Cl → Mn + Cl₂…

A: Given Unbalanced chemical reaction

Q: can cadmium metal (Cd(s)) reduce cobalt (II) ions (Co2+(aq)) to cobalt metal

A: cadmium can only reduce cobalt if its reduction potential is smaller than that of cobalt.

Q: Complete and balance the following redox reaction in acidic solution. Be sure to include the proper…

A:

Q: The Fe2+Fe2+ (55.845 g/mol) content of a 2.063 g steel sample dissolved in 50.00 mL of an acidic…

A:

Q: Vrite a balanced half-reaction for the reduction of permanganate ion (MnO4) to solid manganese…

A: Since, In redox reaction, Oxidation and reduction reaction both takes place simultaneously. In…

Q: Balance the following reactions in acidic solution: Cr2O72- (aq) + Cu (s) =  Cr3+ (aq) + Cu(OH)2…

A: In the above reaction, Cu is being oxidised to Cu2+ and Cr6+ in Cr2O72- is being reduced to Cr3+…

Q: The oxidation of ethanol by the permanganate ion, MnO4–, in aqueous acidic solution produces…

A:

Q: half-reaction

A:

Q: Balance the following redox reaction in acidic solution: Fe(s) + 03(g) → Fe203(s) + 02(g)?

A: Balancing a chemical equation means the no. Of elements in reactant side  must be equal to the no.…

Q: Balance the following redox reaction in an acidic solution: a. Cr2O72-(aq) + C2H5OH(l) →Cr3+(aq) +…

A: Oxidation means loss of electrons and reduction means gain of electrons.

Q: [5] Balance the following redox reaction in acidic solution. CIO3 (aq) + C[(aq) → Cls (aq)

A:

Q: Consider the following reaction: Sn4+ (aq) + Cu (s) → Sn2+ (aq) + Cu²+ (aq) Which of the following…

A: in a redox reaction , a species that loose electron, getting oxidised where other species that gain…

Q: Use standard reduction potentials to calculate the standard free energy change in kJ for the…

A:

Electrolysis

Electrolysis is defined as the process of breaking down ionic compounds into their constituent elements by passing a direct electric current through the compound in a fluid state. The cathode reduces cations, while the anode oxidizes anions. An electrolyte, electrodes, and some form of external power source are the main components required for conducting electrolysis. A partition, such as an ion-exchange membrane or a salt bridge, may also be used, but this is optional. These are primarily used to prevent the products from diffusing near the opposing electrode.