Which one is the electron configuration of Ni atom? Which one is the electron configuration of Fe3+ ion? What is the coordination number of Zn in Zn(CN)4 2– ?

Q: Zinc is used but not copper for the recovery of metallic silver from the complex [Ag(CN)2 ]-,…

A: The reason why  Zinc is used but not copper for the recovery of metallic silver from the complex…

Q: Na‎me the follow‎ing com‎pound, and deter‎mine  coo‎rdination numb‎er of met‎al io‎n,…

A:

Q: 3 4 You are studying coordination compounds of Cu(II with carbonate and other ligands. You add…

A: It is to deduce the molecular formula of the complex formed during the reaction of excess Na2CO3 and…

Q: 5. For the following coordination complexes, identify the oxidation number of the metal, the…

A: Step 1: Step 2:

Q: What charge and how many ‘d’ electrons does copper have in [Cu(OAc)2(H2O)]2 ?

A:

Q: What are the frontier orbitals for [Pt(CN)4]2- What are the donor and acceptor orbitals? Identify…

A: Introduction- Coordination compounds- These are the compounds which contain a complex part formed…

Q: Q:Which of the following complications shows the deformity of Jan Teller? O [cr(OH2)6]3+ O…

A: A multiple choice question based on Jahn-Teller distortion, which is to be accomplished.

Q: What is the formula of the cation for coordination anion [Fe(OH)G]3 ? O a. NH3 O b. K* O c. Ni O d.…

A: Coordination compound is formed by a complex ion and a simple oppositely charged ion. In complex ion…

Q: Indicate the coordination number and the oxidation number of the metal for [Co(en)2(C2O4)]+

A:

Q: The red color of ruby is due to the presence of Cr(III) ions at octahedral sites in the close-packed…

A: The atomic number of Cr is 24 The electronic configuration of Cr is [Ar]3d54s1

Q: If the following redox reaction Cr + 3 V3+ → 3 V2+ + Cr3+ is found to occur spontaneously, identify…

A:

Q: using CFT, draw the d-electron configuration of [PtCl4]2¯. Is the ion paramagnetic or diamagnetic

A:

Q: What is the oxidation number of Fe in K3Fe(CN)6 ?

A:

Q: For the low spin coordination compound [Fe(en)2Cl]Cl, identify the Oxidation number of iron

A: Note : I think the complex should [Fe(en)2Cl2]Cl. So I'm giving answer for both the complex.

Q: Which antioxidant complex formed by Cu(I)-Nc chelate makes it possible to determine its lower…

A: Antioxidants are compounds produced in body and found in foods. They help defend our cells from…

Q: What is the coordination number (CN) and the geometry of the following metal complex? [Zn(bpy)3]Cl2

A: Coordination number of any complex is the number of points of attachment between the ligands and the…

Q: 3. Consider the blue-colored compound, [Cr(H₂O)]3³ and the yellow-colored compound, [Cr(CN)6]³.…

A: The given questions can be explained as:

Q: How do you find the coordination number for [Al(OH)4(H2O)2]-?

A: Coordination number is the number of atoms, ions, or molecules that a central atom or ion holds as…

Q: What are the correct coordination number of diacetyacetonato zinc(II) and…

A: By making structure of these complex compounds we can determine its coordination number.

Q: Determine the coordination number for the metal cation as well as the charge (oxidation state) of…

A: The objective of the question is to determine the coordination number and the oxidation state of the…

Q: What is the coordination number of [Co(NH3)6]Cl3?

A: Given :-  coordination complex =  [Co(NH3)6]Cl3  To determine :-  coordination number

Q: What is the coordination number and geometry of lutetium(III) complex, Lu(THF)2(PhCH2)3

A:

Q: Determine the oxidation state of the metal ion in [Co(NH3)5Br]2+ Determine the coordination number…

A: To determine the oxidation state and coordination number of the given complexes. Answering the first…

Q: Name the coordination compound KING (CN) 3 (OH)3]

A:

Q: The concentration of a K3[Fe(CN)6] solution is 0.15 M. Calculate the concentration of a solution of…

A: Given that, the concentration of a K3[Fe(CN)6] solution is 0.15 M.  We have to calculate the…

Q: A manganese complex formed from a solution containing potassium bromide and oxalate ion is purified…

A:

Q: What is the charge of the cation in the compound Ru2(Fe(CN)6)3?

A: The charges are cross multiplied while making a formula.

Q: MoCO3(H2O)2][Zn(CN)3OH(en)2]. what is the coordination number of the central metal atom of the…

A: The coordination compound is MoCO3(H2O)2]+2  [Zn(CN)3OH(en)2]-2 So, anion complex is…

Q: Consider the coordination compound K3Fe(CN)6.   What is the coordination number of the metal?…

A:

Q: Predict the magnetism, paramagnetic or diamagnetic, for each of the coordination compounds: K4 [Fe…

A: to determine if a given complex is paramagnetic or diamagnetic, we have to calculate the number of…

Q: Make the structure based on the Blomstrand-Jorgensen Theory and Werner Theory also calculate the…

A: Effective atomic number (EAN): According to this rule,the ligands donate t+ electrons to the central…

Q: The magnetic moment of a certain octahedral Co(II) complex is 4.0 μB. What is its d-electron…

A: Magnetic moment of Co(II) complex = 4.0 μB

Q: Name these coordination compounds. formula Na [AUCI, (H₂O)] [VC1,(CO),]C!, [PtBr₂ (NH₂). Cl₂ name 0…

A: 1) Na[AuCl4(H2O)2]The name of this coordination compound is Sodium tetrachloroaurate(III)…

Q: Questions 1. Draw the valence bond theory for [Ni(CN)4]2, and show the hybridization and magnetic…

A:

Q: 5. Copper(II) with Ammonia, NH3 Three equilibria are occurring. ⚫ [Cu(H2O)6]2+(aq) + 2 NH4OH…

A: 1. **Formation of Copper(II) Hydroxide:**  - Initially, the copper(II) ions are in a complex with…

Q: How does potassium ferrocyanide K4[Fe(CN)6] prevent any pre-oxidation of the copper(I) ions in…

A: Oxidation : increase in oxidation number.  Reduction : decrease in oxidation number.…

Q: A Jahn-Teller effect will most likely be observed with O [Zn(H2O)g]²+ O Co(pyridine)4(CN)2 O…

A: The complex which has unsymmetrical eg orbital shows Jhan Teller effect.

Q: How are the acetates bound to copper in [Cu(OAc)2(H2O)]2 ?

A: We have to tell about the bonding of acetate with copper in given complex

Q: K5[Mn(CN)6NO], Na3MnO4 and KMnO4 what are the oxidation numbers of manganese?

A: The oxidation state or oxidation number is the hypothetical charge that an atom would have if all…

Q: CoCl3(H2N-CH2-CH2-NH2)2(H2O) corresponds to the empirical formula of two coordination compounds…

A: In coordination compounds, metal shows different linkages, primary and secondary. The primary…

Q: QUESTION 5 What is the coordination number on the transition metal in the [A O 2 O 3 O 6 O 5 O 4

A: In this question, we want to determine the coordination number of center Transition metal ion Mn2+ .…

Q: Consider the reaction H₂S(g) + 2H₂O(1) 3H₂(g) + SO₂(g) Using standard absolute entropies at 298K,…

A: Write the given reaction. H2S (g) + 2H2O (l) →3H2 (g) + SO2 (g)  The given number of moles of H2S is…

Atomic Structure

The basic structure of an atom is defined as the component-level of atomic structure of an atom. Precisely speaking an atom consists of three major subatomic particles which are protons, neutrons, and electrons. Many theories have been stated for explaining the structure of an atom.

Shape of the D Orbital

Shapes of orbitals are an approximate representation of boundaries in space for finding electrons occupied in that respective orbital. D orbitals are known to have a clover leaf shape or dumbbell inside where electrons can be found.