**Exercise: Naming Coordination Compounds****Question 1:**"Name the coordination compound K[Ni(CN)3(COH)3]"**Explanation:**In this exercise, students are required to name the given coordination compound. Coordination compounds consist of a central metal atom or ion, typically surrounded by molecules or anions, known as ligands. Proper naming of such compounds requires adherence to IUPAC nomenclature rules, accounting for the types and quantities of ligands, as well as the oxidation state of the central metal ion.**Materials:**- A piece of paper with the chemical formula written on it- A pencil labeled "DIXON TICONDEROGA"**Context:**This question serves as a practice problem in understanding the principles of coordination chemistry and nomenclature. Students should identify the ligands (cyanide - CN and formyl - COH) and the central metal ion (Nickel - Ni), then apply the rules to determine the systematic name of the compound.

Answered: Image /qna-images/answer/76a29af7-1c78-42c4-b9d9-a49e8beffad7.jpg

Answered: Name the coordination compound KING…

Science

Chemistry

Name the coordination compound KING (CN) 3 (OH)3]

Chemistry & Chemical Reactivity

10th Edition

ISBN:9781337399074

Author:John C. Kotz, Paul M. Treichel, John Townsend, David Treichel

Publisher:John C. Kotz, Paul M. Treichel, John Townsend, David Treichel

Chapter22: The Chemistry Of The Transistion Elements

Section: Chapter Questions

Problem 65GQ

See similar textbooks

Related questions

Q: The coordination compound [Pt(NH₃)₂(SCN)₂] displays two types of isomerism. Name the types and give…

A: This compound exhibits geometric (cis-trans) and linkage isomerism. The SCN-ligand can bond to the…

Q: What is the name of the coordination compound Na3[Co(CN)6] ?

A: Following rules are applied for naming: 1)Positive part of complex compound will be name…

Q: Heating 3.0 mol of a coordination compound gives 1.5 mol of ammonia, 3.0 mol of water 1.5 mol of HCl…

A: The compounds in which the metal atom is surrounded by the ligands is known as coordination…

Q: The octahedral complex [Ti(H2O)6]3+ has a single d electron. To excite this electron from the ground…

A: First find frequency as follows,

Q: Does Fe(OH2)4 (CN)2 have any optically active isomers?

Q: [CuCl4]2− is green. [Cu(H2O)6]2+is blue. Which absorbs higher-energy photons? Which is predicted to…

A: Crystal field stabilization energy: It is the difference between the energy of two sets of d…

Q: Consider the following coordination compound: [CoCl(NH3)4(H2O)]SO4- What is its formula and…

A: A question based on coordination complex, which is to be accomplished.

Q: Is the coordination compound [Co(NH3)6]Cl2 diamagneticor paramagnetic?

A: Here Co(NH3)6Cl2Oxidation State of Co is +x+0-2 = 0x=+2CO = 1s2 2s2 2p6 3s2 3p6 4s2 3d7CO+2 = 1s2…

Q: d. [Cr(H2O);Br]2* • e. [Cu(NH,CH,CH,NH2)CI,J?- •f. [Fe(OH),] е.

Q: How many unpaired electrons do you predict for the tetrahedral[MnCl4]2 - ion?(a) 1, (b) 2, (c) 3,…

A: [MnCl4]2 - ion Electronic configuration - [Ar] 3d5

Q: Consider the coordination compound [Ni(OH₂)6] Br4. If you find, experimentally, that the compound is…

A: Strong field ligands are that produce large splittings between the d orbitals and form low spin…

Q: A coordination compound of ruthenium, [Ru(NH3)4Cl2]Cl, has shown some activity against leukemia in…

A: Consider a coordination compound, [A]B where [A] forms the complex ion and B is the counter ion. The…

Q: CoCl3(H2N-CH2-CH2-NH2)2(H2O) corresponds to the empirical formula of two coordination compounds…

A: Coordination compounds are those in which there is a metal ion that forms coordinate bonds with…

Q: The average human body contains 5.50 L of blood with a Fe²+ concentration of 3.20x10-5 M. If a…

A: We will use the balanced chemical equation of Fe2+ and CN- to solve this question. Fe2+ + 6CN-…

Q: MoCO3(H2O)2][Zn(CN)3OH(en)2]. what is the coordination number of the central metal atom of the…

A: The coordination compound is MoCO3(H2O)2]+2 [Zn(CN)3OH(en)2]-2 So, anion complex is…

Q: A coordination compound of ruthenium, [Ru(NH3)4Cl2]Cl, has shown some activity against leukemia in…

A: Generally in a coordination complex, a central metal atom (usually transition metal) is bonded to…

Q: Pyridine (CsHgN), abbreviated py, is the molecule N: (a) Would you expect pyridine to act as a…

A: Ligands Ligands in the coordinated complex is the ion or neutral molecule that act as the lewis base…

Q: Heating 3.0 mol of a coordination compound gives 1.5 mol of ammonia, 3.0 mol of water 1.5 mol of HCl…

A: Given that: Heating of 3 mol of coordination compounds gives-NH3 = 1.5 molH2O = 3 molHCl = 1.5…

Q: What is the name of the compound?

A: Since, For write a coordination compound name according to IUPAC rules are: 1)Identify the central…

Q: In the coordination compound [Co(en) 2Cl 2]Cl, the coordination number and oxidation number of the…

A: en (ethylene diamine) is a bidentate neutral ligand. Cl is a ligand with charge -1

Q: The complex ion [Co(H₂O)]³+has a maximum absorbance wavelength of 600. nm. Calculate the…

A: For the given complex CFSE = -2.4∆o as it is d6 Low spin octahedral complex We know , 1 KJ/mol =…

Q: Heating 2.0 mol of a coordination compound gives 1.0mol NH3, 2.0 mol H2O, 1.0 mol HCl, and 1.0…

A: The chemical equation must be:

Q: A coordination compound has been determined to be composed of 18.4% Co, 26.6% NH3, 30.0% SO4 , and…

A: A co-ordination compound is a compound containing a central metal atom bound to ligands. The central…

Q: • d. Tris(ethylenediamine)copper(II) sulfate pe. Hexacarbonylmanganese(1) perchlorate \f. Ammonium…

A: For the complex compounds , there is a certain rule to provide a specific name for that complex…

Q: Explain how experimental determination of the number of geometric isomers of [Co(NH3)4Cl]2+ would…

A: Coordination chemistry is the study of compounds having a central atom attached to certain number of…

Q: Use your knowledge of electronic transitions in coordination compounds to justify why the compound…

A: If a sample absorbs all wavelengths of visible light, none reaches our eyes from that sample, and…

Q: When oxalate (chemical formula: C₂04²; ligand abbreviation: ox) is added to an aqueous solution of…

A: Oxalate C2O42- is a bidentate ligand whereas H2O is a monodentate ligand. Therefore during reaction…

Q: ii) the oxidation state of the central atoms. iii) type of ligands present in the compounds. iv)…

A: The given coordination compound is = Potassium tetrachloroaurate(III), KAuCl4

Q: Given the coordination compound: [MoCO3(H2O)2][Zn(CN)3OH(en)2]. what is the charge of the central…

Q: Some metal complexes have a coordination number of 5. One such complex is Fe(CO)5, which adopts a…

A: Coordination compounds are named using IUPAC rules that are similar to naming ionic compounds.…

Concept explainers

Atomic Structure

The basic structure of an atom is defined as the component-level of atomic structure of an atom. Precisely speaking an atom consists of three major subatomic particles which are protons, neutrons, and electrons. Many theories have been stated for explaining the structure of an atom.

Shape of the D Orbital

Shapes of orbitals are an approximate representation of boundaries in space for finding electrons occupied in that respective orbital. D orbitals are known to have a clover leaf shape or dumbbell inside where electrons can be found.

Question

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

(a) Name this coordination compound: [Ag(NH3)2]NO3. (b) Write the formula of pentaaquaisothiocyanatoiron(III) chloride.
Consider the pseudo-octahedral complex ion of Cr3+, where A and B represent ligands. Ligand A produces a stronger crystal field than ligand B. Draw an appropriate crystal field diagram for this complex ion (assume the A ligands are on the z-axis).
Consider aqueous solutions of the following coordination compounds: [Cr(NH3)3Cl3], [Cr(NH3)6] Cl3, Na3[CrCl6]. If silver nitrate is added to each solution, in which will a precipitate form? Explain.
Sketch and explain the most likely crystal field diagram for the following complex ion: Note: The CN ligand produces a much stronger crystal field than NH3. Assume the NH3 ligands lie on the z axis.
Vitamin B12 is a coordination compound with cobalt as its central atom. It contains 4.4% cobalt by mass and has a molar mass of 1.3103 g/mol. How many cobalt atoms are in a molecule of vitamin B12?
Experiments show that K4[Cr(CN)6] is paramagnetic and has two unpaired electrons. The related complex K4[Cr(SCN)6] is paramagnetic and has four unpaired electrons. Account for the magnetism of each compound using the ligand field model. Predict where the SCN ion occurs in the spectro-chemical series relative to CN.
Consider the coordination compound [Ni(NH3)6]Cl2 and select all of the statements that are TRUE below. 1. The chloride ion is the ligand. 2. [Ni(NH3)6]2+ is the complex ion. 3. The oxidation state of nickel is +4. 4. Nickel and ammonia are covalently bonded. 5. Ammonia is a molecule, not an ion.
1. Which statement below about ligands that form coordination complexes with transition metals is false? * a) A ligand that attaches itself to a metal ion is acting as a Lewis acid b) Anions can function as ligands and can form coordination complexes with transition metal ions. c) The ligand in a coordination complex contains a particular atom which functions as the donor atom d) Neutral molecules can function as ligands and can form coordination complexes with transition metal ions. e) The bond between the ligand and the transition metal ion in a coordination complex is a coordinate covalent bond
Consider the coordination compound [Ni(NH3)2(H2O)2]Br2. 1.What is the oxidation state of the metal in the compound? 2.What is the coordination number of the metal in the compound? 3. Type a name for the compound. Hint: Spelling matters!
Please answer question in picture
The coordination compound [Co(NH3)5Cl]Cl2 is analogous to which simple salt? a) NaOH b) AlCl3 c) MgCl2 d) NH4Cl e) None of these
. A coordination complex has the molecular formula[Ru2(NH3)6Br3](ClO4)2. Determine the oxidation state ofruthenium in this complex.