A coordination compound has been determined to be composed of 18.4% Co, 26.6% NH3, 30.0% SO2²,and 25.0% Br , by mass. The compound was also determined to have two different isomers, A and B,such that the solution of isomer-A was found to react with AgNO3(aq) to produce AgBr precipitate, butthe reaction with Ba(NO:)2(ag) did not produce any precipitate. While the solution of isomer-B did notproduce any precipitate when reacted with AgNO3(aq), but it produced BaSO4 precipitated when thesolution is reacted with Ba(NO;)2(ag).(a) Determine the empirical formula of the compound written in the form of Co(NH3)x(SO4),Brz.(b) Assuming that all of NH; molecules in the formula are ligands, deduce the Werner's formula forisomers A and B, respectively, and give the systemic name for each isomer.(c) Write molecular equations for the reaction of each isomer with AgNO3(ag) and Ba(NO3)2(aq).6.

When ions present in side the coordination sphere, then it can't react as it remains as coordinated…

A coordination compound has been determined to be composed of 18.4% Co, 26.6% NH3, 30.0% SO4², and 25.0% Br, by mass. The compound was also determined to have two different isomers, A and B, such that the solution of isomer-A was found to react with AgNO3(ag) to produce AgBr precipitate, but the reaction with Ba(NO;)2(ag) did not produce any precipitate. While the solution of isomer-B did not produce any precipitate when reacted with AgNO:(aq), but it produced BaSO4 precipitated when the solution is reacted with Ba(NO3)2(aq). (a) Determine the empirical formula of the compound written in the form of Co(NH3)x(SO4),Brz. (b) Assuming that all of NH3 molecules in the formula are ligands, deduce the Werner's formula for isomers A and B, respectively, and give the systemic name for each isomer. (c) Write molecular equations for the reaction of each isomer with AgNO3(aq) and Ba(NO3)2(aq). 6.

A coordination compound has been determined to be composed of 18.4% Co, 26.6% NH3, 30.0% SO4², and 25.0% Br, by mass. The compound was also determined to have two different isomers, A and B, such that the solution of isomer-A was found to react with AgNO3(ag) to produce AgBr precipitate, but the reaction with Ba(NO;)2(ag) did not produce any precipitate. While the solution of isomer-B did not produce any precipitate when reacted with AgNO:(aq), but it produced BaSO4 precipitated when the solution is reacted with Ba(NO3)2(aq). (a) Determine the empirical formula of the compound written in the form of Co(NH3)x(SO4),Brz. (b) Assuming that all of NH3 molecules in the formula are ligands, deduce the Werner's formula for isomers A and B, respectively, and give the systemic name for each isomer. (c) Write molecular equations for the reaction of each isomer with AgNO3(aq) and Ba(NO3)2(aq). 6.

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter21: Transition Metals And Coordination Chemistry

Section: Chapter Questions

Problem 75AE

See similar textbooks

Similar questions

Four different octahedral chromium coordination compounds exist that all have the same oxidation state for chromium and have H2O and Cl as the ligands and counterions. When 1 mole of each of the four compounds is dissolved in water, how many moles of silver chloride will precipitate upon addition of excess AgNO3?
(a) Name this coordination compound: [Ag(NH3)2]NO3. (b) Write the formula of pentaaquaisothiocyanatoiron(III) chloride.
An aqueous solution of [Rh(C2O4)3]3− is yellow. Predict the approximate wavelength and predominant color of light absorbed by the complex.
Platinum(II) forms many complexes, among them those with the following ligands. Give the formula and charge of each complex. (a) two ammonia molecules and one oxalate ion (C2O42-) (b) two ammonia molecules, one thiocyanate ion (SCN-), and one bromide ion (c) one ethylenediamine molecule and two nitrite ions
has a crystal field splitting energy, o, of 2.60102 kJ/mol. What is the wavelength responsible for this energy?
Trimethylphosphine, P(CH3)3, can act as a ligand by donating the lone pair of electrons on the phosphorus atom. If trimethylphosphine is added to a solution of nickel(Il) chloride in acetone, a blue compound that has a molecular mass of approximately 270 g and contains 21.5% Ni, 26.0% Cl, and 52.5% P(CH3)3 can be isolated. This blue compound does not have any isomeric forms. What are the geometry and molecular formula of the blue compound?
A certain coordination compound has the simplest formula PtN2H6Cl2. It has a molar mass of about 600 g/mol and contains both a complex cation and a complex anion. What is its structure?
Give the number of unpaired electrons in octahedral complexes with strong-field ligands for (a) Rh3+ (b) Mn3+ (c) Ag+ (d) Pt4+ (e) Au3+
a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
Which of the following statement(s) is( are) true? a. The coordination number of a metal ion in an octahedral complex ion is 8. b. All tetrahedral complex ions are low-spin. c. The formula for triaquatrianuninechromiwn(III) sulfate is [Cr(H2O)3(NH3)](SO4)3. d. The electron configuration of Hf2+ is [Xe]4f126s2. e. Hemoglobin contains Fe3+.
The glycinate ion, H2NCH2CO2, formed by deprotonation of the amino acid glycine, can function as a bidentate ligand, coordinating to a metal through the nitrogen of the amino group and one of the oxygen atoms. Glycinate ion, a bidentate ligand A copper complex of this ligand has the formula Cu(H2NCH2CO2)2(H2O)2. For this complex, determine the following: (a) the oxidation state of copper (b) the coordination number of copper (c) the number of unpaired electrons (d) whether the complex is diamagnetic or paramagnetic