26. which of the following statement is TRUE about the octahedral complexes of Ni+2 (3d8)a) both strong-and weak field complexes are diamagneticb) the strong-field complex is diamagnetic and the weak-filed complex is paramagneticc) both strong and weak complexes are paramagnetic

Answered: which of the following statement is…

which of the following statement is TRUE about th poth strong-and weak field complexes are diamagr he strong-field complex is diamagnetic and the we poth strong and weak complexes are paramagneti

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter20: Chemistry Of Selected Transition Elements And Coordination Compounds

Section: Chapter Questions

Problem 117QRT

See similar textbooks

Related questions

Q: In octahedral complexes, for which d electron counts is it possible to have high-spin and low-spin…

A: The coordination complexes can be defined as the complex compounds which have coordinate linkage…

Q: Draw the molecular orbital diagram of the -complex ion [Fe(H2O)6]2+, also arrange the electronic…

A: [Fe(H2O)6]2+ consists of 6 H2O ligands and an oxidation state of +2 which means Fe consists of 6…

Q: Explain the differences between weak-field and strong-field metal complexes?

A: Differences between weak-field and strong-field metal complexes:

Q: What is the coordination number of a complex ion that consists of 2 tridentate ligands? 6…

Q: How do the relative magnitudes of Epairingand Δ affect theparamagnetism of a complex?

Q: 13. A complex ion has been observed which starts with a violet color with six aqua ligands attached.…

Q: >Which complex ion geometry has the potential to exhibit cis–trans isomerism: linear,…

A: The complex having linear geometry (MAB) or tetrahedral geometry (MA2B2) cannot show cis-trans…

Q: The value of Δ for the [CrF6]3- complex is 182 kJ/mol.Calculate the expected wavelength of the…

A: The given complex [CrF6]3- is an octahedral complex. In, octahedral field the all 5 d-orbitals split…

Q: <p>Draw a crystal field splitting diagram for a trigonal planar complex ion. Assume the plane…

A: The d orbital electrons of a transition metal split into high and low energy levels in ligand field.…

Q: Calculate the CFSE of the complex. Determine the hybridization of the metal central in the complex.…

Q: A four-coordinate complex MA2B2 is prepared and found tohave two different isomers. Is it possible…

Q: What is the relationship between observed colour of the complex and the wavelength of light absorbed…

A: When light falls on a complex, certain part will get absorbed. If the crystal field splitting energy…

Q: The maximum absorption for a complex ion occurs at 620 nm. Calculate the crystal field splitting in…

A: Applying formula E= NAhc/lemda

Q: In octahedral complexes, for which d electron counts is it possible to have highspinand low-spin…

A: Octahedral complexes are the complexes having Coordination no.6. this coordination no.6 implies no.…

Q: CFSE and total spin moment

Q: <p>Draw a crystal field splitting diagram for a trigonal bipyramidal complex ion. Assume the…

A: In the trigonal bipyramidal geometry, the triangle remains in the xy plane while the two pyramids…

Q: Explain the effect on the d-orbital energies when an octahedral complex is stretched along the z…

A: Solution - There is stretching of octahedral complex along the z axis and the results will be…

Q: How many degenerate o, bonding orbitals (between the ligands and the metal p-orbitals) are there in…

A: Complexes are formed when ligands and metals form a coordinate bond between them. Ligands are the…

Q: In what order are the metal ion and ligands given in thename of a complex ion?

A: In naming the complex ion: Name the ligands first, in alphabetical order, then the metal atom or…

Q: Both H2O and ethylenediamine (en) have two nonbonding pairs of electrons. Whycan en act as a…

A: The number of donor atoms present in the ligand which can donate electrons to the central metal atom…

Q: 10) What is a representative orbital-filling diagram for the cobalt ion in the low spin complex of…

Q: Isn't An electron-rich transition metal has a low oxidation state, meaning that the metal centre has…

A: We have to explain the given statement "An electron-rich transition metal has a low oxidation state,…

Q: Q4/ geometrical isomerism is found in square planar and octahedral complexes but not found in…

A: Bidentate ligands are those in which two domor atoms are present. Ligands are those which attached…

Q: When a certain strong-field ligand forms an octahedral complex with Mn* cation, the energies of the…

A: Electronic configuration of Mn = [Ar] 3d5 4s2 Electronic configuration of Mn3+ = [Ar] 3d4 Under…

Q: ose the false statement about isomerism in metal complexes. a) Enantiomers are non-superimposable…

A: Write the question properly and completely. The question pertains to isomerism in metal complexes, a…

Q: Describe the makeup of a complex ion, including the natureof the ligands and their interaction with…

A: Complex molecules are a section of inorganic chemistry . A complex is formed when a metal center is…

Q: Fluoride ion ranks low in the spectrochemical series and produces a weak crystal field in complex…

A: Given, Coordination complex = CoF64- F- = Weak field ligand Number of unpaired electrons in…

Q: Describe the conditions that favor the formation of complexes with a low number of coordinates

A: Coordination complex is formed when ligand donate electron pair to central metal atom.

Q: An octahedral complex, MA4B2 (A and B are monodentate ligands), has two stereoisomers (trans and…

A: The correct option is as follows:

Concept explainers

Coordination Chemistry

It is a part of chemistry, in which the study of compounds that have central atoms surrounded by molecules or ions, known as ligand, is known as coordination chemistry.

Question

26. which of the following statement is TRUE about the octahedral complexes of Ni+2 (3d8)
a) both strong-and weak field complexes are diamagnetic
b) the strong-field complex is diamagnetic and the weak-filed complex is paramagnetic
c) both strong and weak complexes are paramagnetic

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Give the number of unpaired electrons in octahedral complexes with strong-field ligands for (a) Rh3+ (b) Mn3+ (c) Ag+ (d) Pt4+ (e) Au3+
Is it possible to have a paramagnetic d4-tetrahedral complex ion? Explain.
Which of the following statement(s) is( are) true? a. The coordination number of a metal ion in an octahedral complex ion is 8. b. All tetrahedral complex ions are low-spin. c. The formula for triaquatrianuninechromiwn(III) sulfate is [Cr(H2O)3(NH3)](SO4)3. d. The electron configuration of Hf2+ is [Xe]4f126s2. e. Hemoglobin contains Fe3+.
Four different octahedral chromium coordination compounds exist that all have the same oxidation state for chromium and have H2O and Cl as the ligands and counterions. When 1 mole of each of the four compounds is dissolved in water, how many moles of silver chloride will precipitate upon addition of excess AgNO3?
Experiments show that K4[Cr(CN)6] is paramagnetic and has two unpaired electrons. The related complex K4[Cr(SCN)6] is paramagnetic and has four unpaired electrons. Account for the magnetism of each compound using the ligand field model. Predict where the SCN ion occurs in the spectro-chemical series relative to CN.
a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
Trimethylphosphine, P(CH3)3, can act as a ligand by donating the lone pair of electrons on the phosphorus atom. If trimethylphosphine is added to a solution of nickel(Il) chloride in acetone, a blue compound that has a molecular mass of approximately 270 g and contains 21.5% Ni, 26.0% Cl, and 52.5% P(CH3)3 can be isolated. This blue compound does not have any isomeric forms. What are the geometry and molecular formula of the blue compound?