Which of the following reactions isspontaneous in the forward direction at298K?I.MnO2(«) → Mn(0) +O2(@)II.Cua) + S(o)CuS()III.2LIOH(0)+CO2(9) → LiżCO3(,) + H20(9)CompoundAH°¡ (kJ / mol) s°298 (J K`'mol")MnO2(s)-520.0353.050.0032.00Mn(s)02(9)0.00205.20Cu(s)0.0033.15278.81167.82S(g)Li(OH)(s)-487.5042.80Li2CO3(s)-1216.0490.17CO2(g)-393.51213.80-53.1066.50CuS(s)-241.82188.80H20(g)

Answered: Image /qna-images/answer/890cf9cc-00a7-4d32-bf26-283f83325898.jpg

Which of the following reactions is spontaneous in the forward direction at 298K? I. MnO%») → Mn() +O2@) II. Cua) + S(o) CuS(o) 2LIOH(0) +CO2(9) → LizCO3(0) + H2O(g) III. AH°¡ (kJ / mol) s°298 (J K'mol") Compound -520.03 53.05 Mn02(s) Mn(s) 0.00 32.00 02(9) 0.00 205.20 Cu(s) 0.00 33.15 278.81 167.82 S(g) Li(OH)(s) -487.50 42.80 Li2CO3(s) -1216.04 90.17 CO2(g) -393.51 213.80 CuS(s) -53.10 66.50 -241.82 188.80 H20(g)

Which of the following reactions is spontaneous in the forward direction at 298K? I. MnO%») → Mn() +O2@) II. Cua) + S(o) CuS(o) 2LIOH(0) +CO2(9) → LizCO3(0) + H2O(g) III. AH°¡ (kJ / mol) s°298 (J K'mol") Compound -520.03 53.05 Mn02(s) Mn(s) 0.00 32.00 02(9) 0.00 205.20 Cu(s) 0.00 33.15 278.81 167.82 S(g) Li(OH)(s) -487.50 42.80 Li2CO3(s) -1216.04 90.17 CO2(g) -393.51 213.80 CuS(s) -53.10 66.50 -241.82 188.80 H20(g)

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Similar questions

Indicate if AS is negative, near zero or positive for the following processes. a reaction that is spontaneous at low temperature only 2 N20(g) SO2(g) S(s) > 2 N2(g) 1. - AS + 2 AS near zero 2 CH3Clg) + H2(9) → 2 CH4(g) Cl2(g) + AS + 3. CaCO3(s) → Ca2 co,2-
Ip acellus_engine.html?ClassID=D1653724337# Calculate the entropy of the phase change of uranium hexafluoride from gas to solid. UF6(g) → UF6(s) Substance S° (J/mol-K) UF (s) UF (g) ASiep = [ ? ] J/mol - K 228 380 Enter either a + or - sign AND the magnitude in your answer. Enter
What is the temperature at which the reaction below becomes spontaneous, if the standard entropies of reactants and products at 25oC are So (C(gr)) = 5.74 J/mol*K, So(H2(g)) = 130.68 J/mol*K, and So (C8H8(g)) = 345.2600J/mol*K and the heat of formation of C8H8(g)) is 147.8500 kJ/mol?C8H8(g) ↔ 8C(gr) + 4H2(g)a)661.88 Kb)707.958 Kc)the reaction is never spontaneousd)the reaction is always spontaneous
A reaction has a positive ΔH and a postiive ΔS. When is the reaction spontaneous (if ever)? ΔG = ΔH - TΔS High temperature Low temperature Always Never
Spontaneous or non-spontaneous
6. For each reaction below, determine the sign of AH and AS. Also state under what conditions the reaction is spontaneous (in the forward direction): (a) never spontaneous, (b) always spontaneous, (c) spontaneous at low temperatures, or (d) spontaneous at high temperatures. 1) C2 (g) → 2 Cl (g) (ii) 2 C2H6 (g) + 7 O2 (g) → 4 CO2 (g) + 6 H2O (g)
For a nonspontaneous reaction , AS° = 189 J/K, and AH° = 76.3 KJ. At what temperature this reaction becomes spontaneous ? 520 K 302 K 298 K 404 K
For the reaction delta H° = 98.8 kJ/mol and delta S° =141.5 J/(mol*K). 3H2 (g) +Fe2O2(s) →2Fe(s) +3H2O(g) (19) Over what temperature range (if any) is the reaction spontaneous?
For each reaction, calculate ΔH°rxn, ΔS°rxn, and ΔG°rxn at 25 °C and state whether or not the reaction is spontaneous. If the reaction is not spontaneous, would a change in temperature make it spontaneous? If so, should the temperature be raised or lowered from 25 °C?a. 2 CH4( g)------->C2H6( g) + H2( g)b. 2 NH3( g)------> N2H4( g) + H2( g)c. N2( g) + O2( g)-------->2 NO( g)d. 2 KClO3(s)-------->2 KCl(s) + 3 O2( g)
Which one of the following processes would you expect to be spontaneous only at high temperatures? options: H2O (1) - --> H2O (g) 3 02 (g )-- --> 2 03 (g) Mg (s) + Cl2 (g) - --> MgCl2 (s) CO2 (g) ) 2 H2 (g) + O2 (g) --> 2 H2O (g) - CO2 (s