Which are the best conditions for the following preparation?COHSelect one:a.O b.CH3O C.SOC1₂NaOHNH3(CH3)2NH(CH3)2NHCH3CH₂BrO d. (CH3)2NHroom tempCH3CH3CH3

Answered: Image /qna-images/answer/c172e583-9317-42b8-b126-fa48897c946d.jpg

Answered: Which are the best conditions for the…

Which are the best conditions for the following preparation? COH CH3 Select one: a. SOCI (CH3)2NH O b. NaOH (CH3)2NH O C. NH3 O d. (CH3)2NH room temp CH3CH₂Br CH3 CH3 CH3

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Related questions

Q: The following equilibrium lies mainly to the right or left?

A: The particepated reactants bothe are weak acids. The equilibrium existing between is very slow in…

Q: What is the best reagent used for the following reaction? H3C H H3C оН Н ? H- ? H3C H H3C H. A O BH3…

Q: H Compound M step 1 O OH Compound N step 2 O OH Br Compound O step 3 ? Br Compound P C7H4BRCIO step…

A: R-CO-Cl known as alkanoylchloride or acid chloride...

Q: 1. What would be the best base for performing the elimination reaction shown? 2. What major…

A: Given : structure of reactants Tip : strong base prefer E2 reaction.

Q: What does a value of K eq greater than 1 mean?A. More reactants than products exist at…

A: The equilibrium constant for a reaction is expressed in terms of the ratio of the concentration of…

Q: In the neutralization reaction below, water and what other product will be produced? H2SO4 + NaOH +…

Q: What is the reagent in this reaction? a. mCPBA, water, H+ b. H2, Pd c. NaBH4, water d. KMNO4

A: Given What is the reagent in this reaction? a. mCPBA, water, H+ b. H2, Pd c. NaBH4, water d.…

Q: What is the major organic product obtained from the following reaction? A. Ph B. Ph N=Ph -NH₂ OH…

A: When phenyl cyanide (benzonitrile) heated with water the in presence of an acid, an acid-catalyzed…

Q: se the correct reagent(s) for the following THE WH HARG Br Br

A: All the reactions are H-Br addition to alkene . All the given reagent have also different role .

Q: A: H₂ H- H H Draw the products of Reaction A. H₂N H H H

A: We have been given an organic reaction in which an amide ion react with methyl iodide and we have…

Q: What is the major product of the following reaction? ملال له من H excess C. OH Ph HO ethanol OH Ph…

A: Aldol reaction organic reaction in which enolate ion reacts with a carbonyl compound to form…

Q: Provide the ame reaction associated with each reaction below: R-CO-CH3 + N2H/HO" -> Ph-CH2.CH3 Ans…

A: Note: According to our guidelines we are supposed to answer only first three subpart.

Q: What is the comrect product for the following reaction? H2N. .CI H2N. H2N. II H2N. IV Select one:…

Q: Determine which is the correct product of this reaction Br NaOH Select one: а. Na b. OH c. Br но d.…

A: The given substrate is alkyl halide and the reagent is a base (nucleophile). In general, alkyl…

Q: Draw the products of each reaction and determine the direction of equilibrium.

Q: Choose the best reagents to complete the reaction shown below

A: Lithium aluminum hydride reduces the carbonyl compounds into alcohols. In this reagent, a hydrogen…

Q: What is the missing reactant? LDA -78°C [enolate salt] ? CH-OH THE I. II. III. IV. CH3-Br H-C-oc,H5…

A: Given reaction is : What is the missing reactant ? Options are :

Q: Identify the product(s) in the reaction below. 2H20 → 2H2 + 02 O A. H,0 and 02 B. H20 C. H20 and H2…

A: Ans

Q: What is the reagent needed for the following reaction? Ob ) b e O a 0 c Od N a. HCI b. LiAlHa c.…

A: Step 1: Step 2:Mechanism Step 3: Step 4:

Q: How would you prepare benzylamine (CeHsCH,NH) from each compound? In some cases, more than one step…

A: aC6H5CH2Br + HNH2à C6H5CH2NH2 + HBr bC6H5CN + 4H (Na + C2H5OH) à C6H5CH2NH2 c.Hoffmann’s…

Q: Give the structure of the starting reactant for the reaction sequence shown below

A: BH3 in the presence of THF solvent follows AMKA addition. AMKA addition is a type of addition in…

Q: Choose the best reagents to complete the following reaction. Į NaH 2. H3O+ OH H xx [a] A B D E 1.…

A: The best reagent to complete the given reaction is: A. 1. NaBH4 ; 2. H3O+Explanation:

Q: HO HBr 1. Н В 2. H30* Mg H. А C Et,0

Q: HCCEC-CH, HyC Ob H;Lindar Od. 1 BH/THE, 2) H,O,/NaCH/H,0

Q: O Macmillan Learning In each reaction box, place the best reagent and conditions from the given…

Q: None

A: Step 1:Aldehyde react with excess of methanol in the presence of acidic medium to form acetal via…

Q: What is the reagent needed for the following reaction? . Ос Od O b O a a. HCI b. LiAlHa c. DIBAL d.…

Q: What are the best reagents to carry out the following reaction? 1. H₂O 2. H+ (A) A U B None of these…

A: The reaction occurring here is an oxymercuration demercuration reaction. This leads to the…

Q: Provide the product of the following reaction sequence: A. B. NH₂ 1. NaNO2, HCI 2. KI CI C. D. COOH…

A: Here, NaNO,2,, NaNO2, HCl is a diazotizing agent which converts an aromatic primary amine group to…

Q: None

A: Thank You.

Q: What is the by-product of the following reaction? NH₂ 8. + a. H₂O b. C.Hi C. H 10 i d. HO ii Select…

A: Identify the product and by-product of the following incomplete reaction.

Q: What is the major organic product obtained from the following reaction? H₂N A. B. hal C. Ph Ph NH₂…

A: An arrow always depicts from a region of high electron density to low electron density ; that is…

Q: What is the product of the following reaction? Br a. b. C. d. Br. Select one: a. b. C. d. ZI Br…

A: A nucleophilic substitution reaction is a type of organic reaction where one nucleophile (an…

Q: What is the product of the following reaction: Za(Hg) HC он B) C) i. C i. В ii. A iv. None 39

Q: By reacting the following compound with one equivalent of HBr in acetonitrile at 40 ° C, the main…

A: The products are given in the next step:

Q: What is the major product formed in the following reaction:

A: Option E is correct. As LiAlH4 is strong reducing agent and it donate hydride ion, so first hydride…

Q: What is the product of the following reaction? HN N|H Η HNO3 H₂SO4 ?

A: The objective of this question is to show the nitration mechanism. The concentrated nitric acid with…

Q: What product will be formed from the reaction below? O 1. excess CH3.Mg-Br H3CO 2. H*

A: Grignard reagent + ester: In a Grignard reagent, an alkyl group is attached to the electropositive…

Q: What is the needed reagent to perform the following reaction? Br ??? Select one: Oa. Br2 O b. NaBr…

A: Please find the anwer attached as handwritten note.

Q: Reaction A is Reaction A: Reaction B: regioselective than reaction B. Br Br₂, hv Cl₂ hv

A: he chlorination and bromination of methylcyclohexane are both regioselective reactions, meaning they…

Q: tx.ll= t·le 요 + A. less than -1 B. between -1 and 0 C. between 0 and 1 D. greater than 1

A: When conc of products are higher than the reactant than Keq is greater than 1. When conc of products…

Q: 32. What is the missing reagent in the reaction below? e a Ph₂P. Br. o A) I B) II C) III D) IV 11…

A: => wittig reaction used for converting keton to alkeen.=> C=O bond converting C=C bond.

Q: Step 7 OH a. ;H,O* Step 5 b. OH Br Step 6 MgBr HN NH2 HN C. 5 H. OH d. 7 Но

Q: fill in the reagents OH + En

Q: 5. klnat reagento are ne reaction ? to perfom thne following necessary Br Br C Brg (lequiv), NADH…

Q: What is the major product for the following reaction? A NH₂ 1. CH31 (XS) 2. Ag₂O, H₂O heat B с D

A: The given reaction is an example of Hoffmann elimination. In this reaction quaternary amine gets…

Q: Identify the major and minor product(s) of the following reaction: Br NaOEt EtOH ?

A: A question based on reaction mechanisms. For the given reactant the respective major and minor…

Q: Which set of reagents would best accomplish the following transformation? reagent Ph Ph Br 單選: O a.…

A: The given reaction is the alpha halogenation of ketone. The alpha halogenation of ketone takes place…

Question

Which are the best conditions for the following preparation?
COH
Select one:
a.
O b.
CH3
O C.
SOC1₂
NaOH
NH3
(CH3)2NH
(CH3)2NH
CH3CH₂Br
O d. (CH3)2NH
room temp
CH3
CH3
CH3

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1: Introduction to functional group conversion

VIEW

Step 2: Carboxyy Acid to amide conversion

VIEW

Step 3: Mechanism of the conversion

VIEW

Solution

VIEW

Step by step

Solved in 4 steps with 4 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

What is the major product of the following reaction? H, H,0 OH OH OH III IV II Select one: O a. I O b. II O c. II O d. IV
Which reagent(s) are best used to carry out the following reaction? ? a. H2CrO7 b. 1. propanol, NaOH; 2. HCI c. 1. CH3CH2MgBr, THF; 2. HCI d. H2SO4, H2O a b d
Determine the product(s) in the reaction below. А. D. A and C 0000 тоо ш E OH + HCI B. OH E. B and C с.
Which of the following is most prone to hydration (acid-catalyzed reaction with water)?
What reagents should be used to make the following change? -OH 8-5 H H₂O A. C. H₂O ROOR 1. BH3 m-CPBA B. D. 2. H₂O2, OH- OA OB OD
What is the product of the reaction shown below? + NaCN Br B. A. OA OB OC OD H NC C. Both A and B
What is the best choice of reagents to achieve the following reaction? A. SOCl2 (1/2 equivalent) B. KOH (pellets) C. K2SO4 D. PhCO2Na
8. For each of the acid/base reactions below, choose an appropriate acid or base to perform the stated chemical reaction. After selecting the appropriate reagent, provide a balanced chemical equation of the reaction and label each acid with its appropriate pKą. A. B. C. : 0 H H + LOH + H 5-H *111 +
Consider the three compounds A -C: CH,OH C b.p. 118°C b.p. 57 C b.p. 65°C Explain why the boiling point of A is higher than that of B. Explain why the boiling point of A is higher than that of C. (ii) Predict the products of the following reaction: NaOH D +E Predict the product of the following reaction: H cat.
What is the major product obtained from the following reaction? A. HO B. HO Ph Ph 1. PhMgBr (excess) 2. H3O+ -OH Ph C. HO-Ph Ph D. HO OH OH
ch1
What reagent or reagents are needed?