What product is formed from the addition of NaOH to p-tertbutylphenol? Group of answer choices a compound with addition of an OH group to p-tertbutyl phenol the sodium salt of p-tertbutylphenol, sodium p-tertbutylphenoxide a protonated version of p-tertbutylphenol there is no reaction

What product is formed from the addition of NaOH to p-tertbutylphenol? Group of answer choices a compound with addition of an OH group to p-tertbutyl phenol the sodium salt of p-tertbutylphenol, sodium p-tertbutylphenoxide a protonated version of p-tertbutylphenol there is no reaction

Organic Chemistry

9th Edition

ISBN:9781305080485

Author:John E. McMurry

Publisher:John E. McMurry

Chapter19: Aldehydes And Ketones: Nucleophilic Addition Reactions

Section19.10: Nucleophilic Addition Of Alcohols: Acetal Formation

Problem 15P

See similar textbooks

Related questions

Q: A student is given a mixture of benzoic acid, 3-nitroaniline and naphthalene to separate. The…

A: We have to predict the components remaining in organic solvent.

Q: What are the products obtained from saponification of isopropyl benzoate with sodium hydroxide…

A: Soapnification-The reaction of an ester with water and base NaOH to break ester linkage and produce…

Q: What two reactants would be used to form propan-2-yl hexanoate? propan-2-ol and hexanoic acid…

A: Alcohol and carboxylic acid on reaction in the presence of catalytic amount of acid form ester.…

Q: CHO COOH O 3-oxo-2-n-propylpropanoic acid O 2-oxopentanoic acid O 2-formylpentanoic acid O…

Q: pentyl propanoate

Q: What is the IUPAC name for the following compound? & Br 3-benzenebutanoyl bromide 3-methylbenzanoyl…

Q: Select an appropriate name for each compound. OH 5-chloro-3-ethylhexanoic acid…

A: IUPAC nomenclature of carboxylic acid: • Identify the longest continuous carbon chain. • Identify…

Q: Draw the products formed when each alcohol is dehydrated with H 2SO 4.

A: Given alcohol,

Q: Provide the proper IUPAC name for PhCH₂CH(CH3)CH₂CH₂CHO. 4-methyl-5-phenylpentanol…

A: The given compound, PhCH2CH(CH3)CH2CH2CHO, can be systematically named using IUPAC nomenclature.

Q: There are two possible Grignard reactions that lead to the given alcohol. Select the reactant needed…

A: The given reaction is bassed on nucleophilic addition reaction.

Q: Safrole is a naturally occurring acetal isolated from sassafras plants. Once used as a common food…

A: Conversion of aldehydes or ketones to acetals is a reversible reaction. The given acetal is…

Q: What is the IUPAC name for the following compound? CH₂CH₂CH H₂CH₂CH₂CH₂CH₂CH₂CH₂ -N-CH₂CH₂CH₂CH₂…

A: According to IUPAC nomenclature : Select the longest continuous chain of carbon atoms called as…

Q: CH3 H3C- CH3 CH₂ OH -CH3 O 3-t-butyl-2-pentanol 3-t-butyl-4-pentanol O…

A: Answer: In this question we have to write down the IUPAC name of the given compound that is made of…

Q: Isopropanol was treated with sodium metal, followed by 1-chloroheptane. What product formed? Group…

A: Alcohols contain acidic hydrogen and alcohols react with a base to form salt and hydrogen gas.

Q: What is the IUPAC name of the compound shown below?

Q: The acetal shown below composed О TOlloWin original compounds O 2-methylpropanone, pentanol and…

A: Given : To identify the acetal shown below is composed of which of the following original…

Q: The following molecule belongs to a class of compounds called enediols; each carbon of the double…

A: In the formation of the chemical bond with the same or different elements, all elements tend to…

Q: Give acceptable names for two ketones ?

A: Solution- 2-Methylpentan-3-one IUPAC naming of the given compound is correct because as we know…

Q: What is the correct IUPAC name for the compound shown here? A 3-bromo-3-hydroxy-3-methylbutane OH B…

A: Thank you.

Q: What is the IUPAC Ph

A: In the given compound -COOH (carboxylic acid) is present as a main functional group. So select the…

Concept explainers

Diol

In chemistry there are so many chemical compounds that have a hydroxyl group but a chemical compound having two hydroxyl groups (-OH) is termed as a diol. It also implies the presence of two alcohols whereas polyols contain two or more than two hydroxyl groups (-OH). Glycol or 1,2-diol is an aliphatic diol that has two alcohol groups on adjacent carbon atoms. In industries, the most commonly used diol is ethylene glycol.

Question

100%

What product is formed from the addition of NaOH to p-tertbutylphenol?

Group of answer choices

a compound with addition of an OH group to p-tertbutyl phenol

the sodium salt of p-tertbutylphenol, sodium p-tertbutylphenoxide

a protonated version of p-tertbutylphenol

there is no reaction

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

what product is formed after recrystallizing a mixture of 4-phenylcyclohexanone and 4-phenylcyclohexanol?
What is the reduction product of the following compound with H2/Pd? A 2-propyl-1-cyclohexanol B 2-propenyl-1-cyclohexanol C2-propylcyclohexanone D 1-propyl-2-cyclohexanol What is the oxidation product of this compound? H' A ethanoic acid acetic acid propanoic acid D propanone What is the oxidation product of this compound? A 3,4-dimethylpentanoic acid B 2,3-dimethylpentanoic acid C2,3-dimethylpentanone 3,4-dimethylpentanone
What two functional groups react to form the following? a. A hemiacetal b. An acetal c. A ketal d. A hemiketal
Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) a) Given 7.70 g of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100% yield? b) A chemist ran the reaction and obtained 5.25 g of ethyl butyrate. What was the percent yield? c) The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 7.70 g of butanoic acid and excess ethanol?
Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l). The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 8.50 gof butanoic acid and excess ethanol? Express your answer in grams to three significant figures.
Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Given 8.50 g of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%yield? Express your answer in grams to three significant figures.
What are the products obtained from saponification of isopropyl benzoate with sodium hydroxide? O Sodium propanoate + phenol O benzoic acid + 2-propanol O 2-Propanoic acid + benzyl acohol O Sodium benzoate + 1-propanol O Sodium benzoate + 2-propanol
Draw the product formed when phenylacetic acid (C6H5CH2COOH) istreated with following reagent. With some reagents, no reaction occurs. NH3 , Δ
Choose the correct product for the following reaction 4-methylcyclohexanone + Br2/H3O+ --> product? A 2,6-dibromo-4-methylcyclohexanol B 1-bromo-4-methylcyclohexanol C 2,6-dibromo-4-methylcyclohexanone D 2-bromo-4-methylcyclohexanol E 2-bromo-4-methylcyclohexanone
Which of the following is an acetal? H3C H;C но CH3 CH3 H3C- H3C H3C H3C OH А C A and C B and D A O A, B, and D D B.
Select the best method for carrying out the following synthesis: .COOH Br CH, 1. H,C-c-a/AICI, CH3 1. Br /FeBry 1. CH;CI/AICI, 1. KMNO, H, A 1. CH,CI/ AICI, 2. CH,CI/AICI, 2. Bry /FeBr 2. CH,CI/AICI, 2. KMNO H*, A 2. KMNO, H*, A 3. KMNO H", A 3 KMNO, H".A 3. Br, /FeBr, 3. Br/FeBr3 3. Br/FeBr, II III IV O IlI only O V only O Vonly O Il only O l only
Draw the products formed when phenol (C6H5OH) is treated with following set of reagents. [1] CH3CH2Cl, AlCl3; [2] Br2, hν