Answered: What mass of water is produced from the…

Science

Chemistry

What mass of water is produced from the reaction of 10.0 g hydrogen and 75.0 g oxygen?

World of Chemistry, 3rd edition

3rd Edition

ISBN:9781133109655

Author:Steven S. Zumdahl, Susan L. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan L. Zumdahl, Donald J. DeCoste

Chapter9: Chemical Quantities

Section9.2: Using Chemical Equations To Calculate Mass

Problem 6RQ

See similar textbooks

Related questions

Q: If 6.750 grams of lithium carbonate was used in the reaction, how many grams of carbon dioxide would…

A: The equation for the decomposition of lithium carbonate is as follows. Li2CO3 → Li2O + CO2 This is a…

Q: Mercury can be obtained by reacting mercury(II) sulfide, HgS, with calcium oxide, CaO. How many…

A: Given: The reaction is as follows: 4CaO+4HgS→4Hg+3CaS+CaSO4 The mass of Hg produced=84.7 g. The…

Q: If 6.1 × 10²⁵ molecules of CO₂ are produced in a combustion reaction, what is the mass in kg of CO₂…

A: Given: 6.1 × 10²⁵ molecules of CO₂ are produced in a combustion reaction. To determine : The mass…

Q: What is the theoretical yield of MgO from the combustion of 5.25 x 10^23 atoms of Mg and 4.69 x…

Q: Consider the equation: 2 Na + 2 H2O → 2 NaOH + H2. If 92.0 g of sodium is reacted with 76.0 g of…

A: Two mole of sodium react with two mole of water and produced two mole sodium hydroxide and one mole…

Q: How many grams of magnesium oxide can be produced by reacting 0.248 g magnesium that is 97.5% pure…

A: Given mass of Magnesium = 0.248g% purity of Magnesium = 97.5%No.of molecules of oxygen = 5.36 x…

Q: and

A: The balanced chemical reaction between CaCO3 and HCl as well as MgCO3 and HCl: Reaction 01: CaCO3 +…

Q: A 2.500g sample of an unknown hydrocarbon (CxHyOz) is put in a combustion chamber. From the…

A: We have to calculate the mass of O .

Q: Write a balanced chemical equation based on the following description: the reaction of gaseous C₅H₄…

A: The reactants given are 1) gaseous C5H4 i.e C5H4 (g) 2) Oxygen gas i.e O2 (g) And the products…

Q: How many grams of oxygen are present in 69.1 g of CO2?

A: We have to determine how many grams of oxygen are present in 69.1 g of CO2.

Q: Consider the reaction of solid P₄ and chlorine gas to form gaseous phosphorus trichloride. The…

A: The reaction given is P₄(s) + 6 Cl₂ (g) → 4 PCl₃ (g)

Q: How many moles of Al are necessary to form 29.2 g of AlBr₃ from this reaction: 2 Al(s) + 3 Br₂(l) →…

Q: what mass of sodium is also produced?

A: Given :- 2Na3N → N2 + 6Na Mass of N2 produced = 29.7 g To calculate :- Mass of sodium (in g)

Q: Combustion of a hydrocarbon in a limited supply of air produces CO in addition to CO2 and H2O. When…

A: Given data :

Q: If the decomposition of a sample of KClO3 produces 3.29 g of O2, what was the mass (g) of the…

A: Write balanced equation

Q: White phosphorus (P4) is used to produce phosphorus oxides, such as P4O10. How many kilograms of…

Q: Ammonia is produced from the reaction of nitrogen and hydrogen according to the following balanced…

A: Given information, 1.40 × 103 g N24.60 × 102 g H2

Q: Decomposition of NI3 produces nitrogen gas and iodine. How many grams of the reactant would be…

A: The balanced equation for the decomposition of NI3 forming nitrogen gas and iodine is given as…

Q: How many moles of N2O4 can be formed from 4.25 g NO2?

Q: How many moles of calcium nitrate are needed to produce 0.850 gram of sodium nitrate?

A: 1 mole = 6.022×1023 ( Avogadro's number ) Anything which is in the number of 6.022×1023 is called 1…

Q: How many moles of hydrogen carbonate need to decompose to produce 8.70 x 1023 molecules of carbon…

A: Hydrogen carbonate = HCO3- Decomposition reaction of hydrogen carbonate occurs with H+ - HCO3- + H+…

Q: The first step in the manufacture of nitric acid by the Ostwald process is the reaction of ammonia…

A: Limiting reagent is the reagent which is consumed in the chemical reaction completely. It decides…

Q: How many grams of ammonia, NH3, are produced from the reaction of 4.5 moles of Nitrogen and an…

A: Given, nitrogen = 4.5 mol and H2 is excess Reaction is ammonia synthesis. Chemical equation for this…

Q: If 6.8 g of a hydrocarbon that is 83.2% C by mass is burned with O2 to make CO2 and H2O, what mass…

Q: What is the percent by mass of KClO3 in the original mixture

Q: You heat 3.939 g of a mixture of Fe;O4 and FeO to form 4.197 g Fe203. The mass of oxygen reacted is…

Q: Part A Consider the following reaction. How many moles of oxygen are required to produce 2.33 moles…

A: Given is , Moles of water = 2.33 mol

Q: When 5.00 g of methane, CH4 reacts with an excess of oxygen in a combustion reaction, water and…

A: 11.25 g of H2O is produced.Explanation:

Q: 4.52 moles of C5H12 are burned during an experiment. How many grams of water are produced?

A: Pentane reacts with oxygen to form carbon dioxide and water. The equation for the balanced chemical…

Q: What mass of CdS is produced if 8.47 g cadmium reacts with 2.51 g of sulfur?

Q: If 6 moles of Si and 6 moles of N2 are combined in a reaction flask, what remains in the reaction…

Q: s. How much O2 could be produced

Q: The balanced chemical equation is P₄(s) + 6 Cl₂(g) → 4 PCl₃(g). What is the mass in grams of…

Q: If 101 g of CaO and 280. g of NH4Cl are mixed, what mass of NH3 can be produced?

A: Given,CaO is 101 gAmmonium chloride is 280 gMolar mass of CaO is 56.0774 g/molMalar mass of Ammonium…

Q: PCl3 can be produced from the reaction of P4 with Cl2. If 1.00 g P4 reacts with 1.00 g Cl2, which…

A: Given: Mass of P4 = 1.00 g Mass of Cl2 = 1.00 g Known: Molar mass of P4 = 123.89 g/mol Molar mass of…

Q: How many grams of carbon dioxide can be produced by burning 1.72 moles of propane? Assume that…

A: Propane reacts with oxygen to form carbon dioxide and water. The equation for the balanced chemical…

Q: During a laboratory experiment, a student initiated a reaction with 19.5 g of NaBH4 and excess BF3.…

A: Mass of NaBH4 = 19.5 g BF3 = excess Mass of B2H6 gas = 7.00 g The percent yield of B2H6 = ?…

Q: How many grams of carbon dioxide can form when a mixture of 5.00 grams ethylene and 5.70 grams of…

A: Combustion is the process of burning in aerobic condition . Products of combustion are water and…

Q: What is the theoretical yield of SO3SO3 produced by 2.02 gg of SS? Express your answer numerically…

Q: percentage by mass of calcium

A: Mass percentage of any component in a compound is calculated by formula : Mass % = Mass of…

Q: 3) Consider the balanced equation: 2Al + Fe;N2 2AIN +3Fe. If 5.23 g AIN were produced in this…

Q: What mass (in grams) of oxygen is required to make 27.5 g calcium carbonate

A: The formula of calcium carbonate is CaCO3. Atomic mass of Ca = 40 amu Atomic mass of C = 12 amu…

Concept explainers

Mole Concept

Mole concept is a method to determine the amount of any substance that consists of some elemental particles using a grouping unit called ‘mole’. The mole concept enables one to handle the large amount of small elementary particles. The mole concept can be used in many calculations related to mole calculation, molar amount, mole ratio, and so on, which are significant in chemistry.

Question

What mass of water is produced from the reaction of 10.0 g hydrogen and 75.0 g oxygen?

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1: Data are given from the question

VIEW

Step 2: Identify the limiting reagent

VIEW

Step 3: Calculation for the mass of water produced

VIEW

Solution

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 4 steps with 12 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Nitric acid is produced commercially by the Ostwald process, represented by the following equations: 4NH3(g)+5O24NO(g)+6H2O(g)2NO(g)+O2(g)2NO2(g)3NO2(g)+H2O(l)2HNO3(aq)+NO(g) What mass of NH3 must be used to produce 1.0 106 kg HNO3 by the Ostwald process? Assume 100% yield in each reaction, and assume that the NO produced in the third step is not recycled.
Many cereals are made with high moisture content so that the cereal can be formed into various shapes before it is dried. A cereal product containing 58% H2O by mass is produced at the rate of 1000. kg/h. What mass of water must be evaporated per hour if the final product contains only 20.% water?
Many cereals are made with high moisture content so that the cereal can be formed into various shapes before it is dried. A cereal product containing 58% H2O by mass is produced at the rate of 1000. kg/h. What mass of water must be evaporated per hour if the final product contains only 20.% water?
When calcium carbonate is heated strongly, it evolves carbon dioxide gas. CaCO3(s)CaO(s)+CO2(g) 25 g of CaCO3 is heated, what mass of CO2would be produced? What volume would this quantity of CO2 (CU at STP?
The reaction of 750. g each of NH3 and O2 was found to produce 562 g of NO (see pages 177-179). 4 NH3(g) + 5 O2(g) 4 NO(g) + 6 H2O(l) (a) What mass of water is produced by this reaction? (b) What mass of O2 is required to consume 750. g of NH3?
Phosphoric acid, H3PO4, can be prepared by the reaction of phosphorus(V) oxide, P4O10, with water. 14P4O10(s)+32H2O(l)H3PO4(aq);H=96.2kJ What is H for the reaction involving 1 mol of P4O10? P4O10(s)+6H2O(l)4H3PO4(aq)
Hydrogen cyanide is produced industrially from the reaction of gaseous ammonia, oxygen, and methane: 2NH3(g)+3O2(g)+2CH4(g)2HCN(g)+6H2O(g) If 5.00 103 kg each of NH3, O2, and CH4 are reacted, what mass of HCN and of H2O will be produced, assuming 100% yield?
How many moles of beryllium (Be) are needed to completely react with 10.0 moles of N2 in the synthesis of the compound Be3N2?
Tungsten (W) metal, which is used to make incandescent bulb filaments, is produced by the reaction WO3+3H23H2O+W How many grams of H2 are needed to produce 1.00 g of W?
4.20 Assuming a charcoal briquette is composed entirely of carbon, what mass of oxygen is needed to completely burn a 37.3-g briquette?
Write a balanced equation for (a) the combustion (reaction with oxygen gas) of glucose, C6H12O6, to give carbon dioxide and water. (b) the reaction between xenon tetrafluoride gas and water to give xenon, oxygen, and hydrogen fluoride gases. (c) the reaction between aluminum and iron(III) oxide to give aluminum oxide and iron. (d) the formation of ammonia gas from its elements. (e) the reaction between sodium chloride, sulfur dioxide gas, steam, and oxygen to give sodium sulfate and hydrogen chloride gas.
You take 1.00 g of an aspirin tablet (a compound consisting solely of carbon, hydrogen, and oxygen), burn it in air, and collect 2.20 g CO2 and 0.400 g H2O. You know that the molar mass of aspirin is between 170 and 190 g/mol. Reacting 1 mole of salicylic acid with I mole of acetic anhydride (C4H6O3) gives you 1 mole of aspirin and 1 mole of acetic acid (C2H4O2). Use this information to determine the molecular formula of salicylic acid.