What is the change in enthalpy (in kJ/mol) for the reaction below, if 6.695 g of Zn reacting with excess concentrated HCI caused the solution's temperature to increase from 20.1 °C to 31.4 °C? The volume of the solution is 150.0 mL. Use the specific heat and density of water, 4.184 J g-¹ °C-1 and 1.00 g/mL, respectively.

What is the change in enthalpy (in kJ/mol) for the reaction below, if 6.695 g of Zn reacting with excess concentrated HCI caused the solution's temperature to increase from 20.1 °C to 31.4 °C? The volume of the solution is 150.0 mL. Use the specific heat and density of water, 4.184 J g-¹ °C-1 and 1.00 g/mL, respectively.

Principles of Modern Chemistry

8th Edition

ISBN:9781305079113

Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Chapter12: Thermodynamic Processes And Thermochemistry

Section: Chapter Questions

Problem 85AP

See similar textbooks

Similar questions

When 7.11 g NH4NO3 is added to 100 mL water, the temperature of the calorimeter contents decreases from 22.1 C to 17.1 C. Assuming that the mixture has the same specific heat as water and a mass of 107 g, calculate the heat q. Is the dissolution of ammonium nitrate exothermic or endothermic?
Dissolving 6.00 g CaCl2 in 300 mL of water causes the temperature of the solution to increase by 3.43 C. Assume that the specific heat of the solution is 4.18 J/g K and its mass is 306 g. (a) Calculate the enthalpy change when the CaCl2 dissolves. Is the process exothermic or endothermic? (b) Determine H on a molar basis for CaCl2(s)H2OCa2+(aq)+2Cl(aq)
9.96 Most first aid "cold packs" are based on the endothermic dissolution of ammonium nitrate in water: NH4NO3(s)NH4+(aq)+NO3(aq) H= 25.69 kJ A particular cold pack contains 50.0 g of NH4NO3 and 125.0 g of water. When the pack is squeezed, the NH4NO3dissolves in the water. If the pack and its contents are initially at 24.0°C, what is the lowest temperature that this bag could reach? (Assume that the ammonium nitrate solution has a specific heat of 4.25J g-l K-l, and that the heat capacity of the bag itself is small enough to be neglected.)
In a coffee-cup calorimeter, 150.0 mL of 0.50 M HCI is added to 50.0 mL of 1.00 M NaOH to make 200.0 g solution at an initial temperature of 48.2C. If the enthalpy of neutralization for the reaction between a strong acid and a strong base is 56 kJ/mol, calculate the final temperature of the calorimeter contents. Assume the specific heat capacity of the solution is 4.184 J/g C and assume no heat Joss to the surroundings.
Consider the reaction 2HCl(aq)+Ba(OH)2(aq)BaCl2(aq)+2H2O(l)H=118KJ Calculate the heat when 100.0 rnL of 0.500 M HCl is mixed with 300.0 mL of 0.100 M Ba(OH)2 Assuming that the temperature of both solutions was initially 25.0C and that the final mixture has a mass of 400.0 g and a specific heat capacity of 4.18 J/C g, calculate the final temperature of the mixture.
Would the amount of heat absorbed by the dissolution in Example 5.6 appear greater, lesser, or remain the same if the heat capacity of the calorimeter were taken into account? Explain your answer.
Consider the Haber process: N2(g)+3H2(g)2NH3(g);H=91.8kJ The density of ammonia at 25C and 1.00 atm is 0.696 g/L. The density of nitrogen, N2, is 1.145 g/L, and the molar heat capacity is 29.12 J/(mol C). (a) How much heat is evolved in the production of 1.00 L of ammonia at 25C and 1.00 atm? (b) What percentage of this heat is required to heat the nitrogen required for this reaction (0.500 L) from 25C to 400C, the temperature at which the Haber process is run?
Use the values of Hf in Appendix 4 to calculate H for the following reactions. (See Exercise 77 .) a. b. SiCl4(l)+2H2O(l)SiO2(s)+4HCl(aq) c. MgO(s)+H2O(l)Mg(OH)2(s)
A 50-mL solution of a dilute AgNO3 solution is added to 100 mL of a base solution in a coffee-cup calorimeter. As Ag2O(s) precipitates, the temperature of the solution increases from 23.78 C to 25.19 C. Assuming that the mixture has the same specific heat as water and a mass of 150 g, calculate the heat q. Is the precipitation reaction exothermic or endothermic?
How much will the temperature of a cup (180 g) of coffee at 95 C be reduced when a 45 g silver spoon (specific heat 0.24 J/g C) at 25 C is placed in the coffee and the two are allowed to reach the same temperature? Assume that the coffee has the same density and specific heat as water.
How much heat is produced when loo mL of 0.250 M HCl (density, 1.00 g/mL) and 200 mL of 0.150 M NaOH (density, 1.00 g/mL) are mixed? HCl(aq)+NaO(aq)NaCl(aq)+H2O(l)H298=58kJ If both solutions are at the same temperature and the heat capacity of the products is 4.19 J/g C, how much will the temperature increase? What assumption did you make in your calculation?
When one mol of KOH is neutralized by sulfuric acid, q=56 kJ. (This is called the heat of neutralization.) At 23.7C, 25.0 mL of 0.475 M H2SO4 is neutralized by 0.613 M KOH in a coffee-cup calorimeter. Assume that the specific heat of all solutions is 4.18J/gC, that the density of all solutions is 1.00 g/mL, and that volumes are additive. (a) How many mL of KOH is required to neutralize H2SO4? (b) What is the final temperature of the solution?