Use the given standard enthalpies of formation to calculate the AH° (in kJ) for the hypothetical reaction: 2X2D (g) + 3M2 (g) → 2X2M (1) + 2DM2 (g) AH°F for X2D (g) -22.7 kJ/mol AH°F for DM2 (g) = -292.8 kJ/mol AH°F for X2M (1) = -289.3 kJ/mol AH°f for M2 (g) = 0 kJ/mol

Use the given standard enthalpies of formation to calculate the AH° (in kJ) for the hypothetical reaction: 2X2D (g) + 3M2 (g) → 2X2M (1) + 2DM2 (g) AH°F for X2D (g) -22.7 kJ/mol AH°F for DM2 (g) = -292.8 kJ/mol AH°F for X2M (1) = -289.3 kJ/mol AH°f for M2 (g) = 0 kJ/mol

Chemistry: Principles and Practice

3rd Edition

ISBN:9780534420123

Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Publisher:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Chapter5: Thermochemistry

Section: Chapter Questions

Problem 5.81QE

See similar textbooks

Related questions

Q: Use the following information to determine the enthalpy for the reaction shown below CS2(1) + 302(g)…

A: Since, there are multiple questions, we are authorized to answer only the first one. If you require…

Q: Calcium hydroxide, which reacts with carbon dioxide to form calcium carbonate, was used by the…

A: Given, moles of CaCO3 formed = 3.8 mol

Q: 5. Using data below and other data in your text if necessary, calculate the enthalpy change for the…

Q: The enthalpy change for the reaction of hydrogen gas with fluorine gas to produce hydrogen fluoride…

A: The formation of hydrogen fluoride from hydrogen gas and fluorine gas is expressed as, H2g+F2g→2HFg…

Q: Given the following reactions N2 (g) + O2 (g) → 2NO (g) 2NO(g) + O2(g) → 2N (g) the enthalpy of…

Q: The standard enthalpy of formation of CO(g) is –111 kJ/mol [refer to this equation C(s) + 1/202g) →…

A: Interpretation - To determine the enthalpy (∆Ho) for the reaction which is given as - 2C(s) + O2…

Q: The enthalpy change for the formation of 1 mole of CH, from its elements in their standard states is…

Q: Determine the enthalpy of reaction for 2CH2(g) → C₂H4(g) + 2H₂(g) using the equations: 2C₂H6(g) +…

A: When any reaction is reversed, then the value of the enthalpy of the reaction remains the same but…

Q: N2 (g) + O2 (g) 2 NO (g) AH°rxn = +197 kJ %3D NO2 (g) → NO (g) + 1/2 O2 (g) AH°rxn = +89.2 kJ What…

Q: Using the information provided, determine the enthalpy (in kJ/mol) for the reaction C₃H₈ (g) + 5 O₂…

A: Given, ∆Hf°C3H8(g) = -108.4 KJ/mole. ∆Hf°O2(g) = 0 KJ/mole.…

Q: The standard enthalpy change for the following reaction is -851 kJ at 298 K. 2 Na(s) + O2(g) +…

Q: Calculate ΔH (in kJ/mol) for the reaction shown below: ClF(g)+F2(g)→ClF3(g) Use the following…

Q: The enthalpy change for the reaction: 2H2(g)+ O2(g) → 2H2O(g) is -483.6 kJ. Determine the enthalpy…

A: The enthalpy change for the reaction: 2H2(g)+ O2(g) → 2H2O(g) now, for the following reaction 4H2(g)…

Q: Consider this combination reaction: 2Mg(s)+O2(g)→2MgO(s); ΔH= −1204 kJ What is the enthalpy for the…

Q: Consider the following hypothetical reaction: A(g) + B(g) → D(g) AH° = 47.2 kJ Given that the…

Q: The standard enthalpy change for the following reaction is -479 kJ at 298 K.

A: 1) Heat energy change at constant temperature and pressure is called enthalpy change (or) Heat of a…

Q: metal X =48.1g; specific heat capacity =0.228 J/C If metal X is heated to 95.1C and put into a…

Q: A 1.200 g sample of ZnCO3 (s) dissolved in 40.0 mL of a dilute HCl solution (density = 1.10 g/mL) in…

A: The reactants are zinc carbonate and dilute hydrochloric acid.The balanced equation will be:

Q: Methanol can be synthesized from graphite according to the following reaction, calculate the…

A: The thermochemical equations can be treated as algebraic equation which can be added, subtracted,…

Q: Determine the standard enthalpy of formation for N2O given the following information about the…

A: Hess's lawThe enthalpy change of a reaction is calculated by subtraction of sum of standard enthalpy…

Q: The standard enthalpy change for the following reaction is -467 kJ at 298 K. Na(s) + 1/2 N2(g) + 3/2…

Q: Determine the enthalpy of reaction for P4O10(s) + 6PCI5(g) → 10POCI:(g) P4(s) + 6CI2(g) → 4PCI3(g)…

A: P4 (s) + 6Cl2 (g) ------> 4PCl3(g) ΔH = -1225.6 KJP4 (s) + 5O2 (g) --------> P4O10 (s) ΔH = -…

Q: Calculate the standard enthalpy change (kJ/mol) for the following process given the enthalpies of…

Q: Using the equations 2 H: (g) + O2 (g) → 2 H2O (1) AH° = -572 kJ/mol Ca (s) + ½ O2 (g) → CaO (s) AH°…

A: The first chemical reaction is, 2H2g+O2g→2H2Ol ∆H°=-572 kJ/mol......(1) The second…

Q: During an experiment, 25 g of 0.32 M Ca(NO3)2 at 42°C is added to 103 g of 0.82 M HNO3 at 37°C in a…

A: 25 g of 0.32 M Ca(NO3)2 at 42◦ C are mixed with 103 g of 0.82 M HNO3 at 37◦ C . The increase in…

Q: For the chemical reaction H, (g) + F, (g) → 2 HF (g) AH° = -79.2 kJ/mol. What is the enthalpy (in…

Q: Determine the enthalpy of reaction for HCI(g) + NaNO2(s) → HNO2(1) + NaCl(s) 2NACI(s) + H2O(1) →…

Q: A 1.200 g sample of ZnCO3 (s) dissolved in 40.0 mL of a dilute HCl solution (density = 1.10 g/mL) in…

A: The required equation is given below.

Q: Calculate the enthalpy change for the reaction below: CH4 (g) + 6 F2 (g) → 2 CF4 (g) +4 HF (g)

Q: Use the following information to determine the enthalpy for the reaction shown be CHĄ(g) + H2O(g) →…

A: We have to find enthalpy of reaction.

Q: Determine the enthalpy of reaction for 2CH4(g) → C2H«(g) + 2H2(g) using the equations: 2C2H6(g) +…

Q: As an alternative to combustion, coal gas can undergo a process called methanation. 3 H2(g) +…

Q: A 1.200 g sample of ZnCO3 (s) dissolved in 40.0 mL of a dilute HCl solution (density = 1.10 g/mL) in…

A: The reactants are zinc carbonate and dilute hydrochloric acid.

Q: What is the enthalpy change for the first reaction? CH4(g) + 1/2O2(g) → CH3OH(g) ΔH =

Q: What is the enthalpy change of the following reaction: WO3 (s) + 3 H2 (g) → W (s) + 3 H2O (g) given…

Q: Consider the reaction: NH,NO3(s) → N20(g)+ H2O(1) AH° rxn = -127.49kJ Calculate the enthalpy of…

A: The chemical reaction : NH4NO3(s) ---> N2O(g) + H2O(l) ∆H°rxn = -127.49 KJ Enthalpy of…

Q: Calculate enthalpy of reaction given reaction enthalpies for proposed steps in a process. K+(g) +…

Q: Given the standard enthalpy changes for the following t (1) 2Ni(s) + O2(g) 2N¡O(s) AH° = -479.4 kJ…

A: In classical thermodynamics, the difference between the enthalpy of reactants and products is known…

Question

Use the given standard enthalpies of formation to calculate the AH° (in kJ) for the hypothetical reaction:
2X2D (g) + 3M2 (g) → 2X2M (1) + 2DM2 (g)
AH°F for X2D (g) = -22.7 kJ/mol
AH°f for DM2 (g) = -292.8 kJ/mol
AH°F for X2M (1) = -289.3 kJ/mol
AH°f for M2 (g) = 0 kJ/mol

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

A 0.470-g sample of magnesium reacts with 200 g dilute HCl in a coffee-cup calorimeter to form MgCl2(aq) and H2(g). The temperature increases by 10.9 C as the magnesium reacts. Assume that the mixture has the same specific heat as water and a mass of 200 g. (a) Calculate the enthalpy change for the reaction. Is the process exothermic or endothermic? (b) Write the chemical equation and evaluate H.
Using the data in Appendix G, calculate the standard enthalpy change for each of the following reactions: (a) Si(s)+2F2(g)SiF4(g) (b) 2C(s)+2H2(g)+O2(g)CH3CO2H(l) (c) CH4(g)+N2(g)HCN(g)+NH3(g) ; (d) CS2(g)+3Cl2(g)CCl4(g)+S2Cl2(g)
What mass of acetylene, C2H2(g), must be burned to produce 3420 kJ of heat, given that its enthalpy of combustion is 1301 kJ/mol? Compare this with the answer to Exercise 5.91 and determine which substance produces more heat per gram.
9.41 Under what conditions does the enthalpy change equal the heat of a process?
Give the definition of the standard enthalpy of formation for a substance. Write separate reactions for the formation of NaCl, H2O , C6H12O6, and PbSO4 that have H values equal to Hf for each compound.
9.73 Without looking up any numerical data or doing calculations, predict whether the enthalpy change for each of the following reactions should he positive, negative, or zero. (a) H2O(l)H2O(s) (b) N2(g)2N(g) (c) CH4(g)+2O2(g)CO2(g)+2H2O(l) (d) CO2(s)CO2(g)
In a calorimetric experiment, 6.48 g of lithium hydroxide, LiOH, was dissolved in water. The temperature of the calorimeter rose from 25.00C to 36.66C. What is H for the solution process? LiOH(s)Li(aq)+OH(aq) The heat capacity of the calorimeter and its contents is 547 J/C.
Salicylic acid, C7H6O3, is one of the starting materials in the manufacture of aspirin. When 1.00 g of salicylic acid burns in a bomb calorimeter, the temperature of the bomb and water goes from 23.11C to 28.91C. The calorimeter and water absorb 21.9 kJ of heat. How much heat is given off when one mole of salicylic acid burns?
The process of dissolving ammonium nitrate, NH4NO3, in water is an endothermic process. What is the sign of q? If you were to add some ammonium nitrate to water in a flask, would you expect the flask to feel warm or cool?
The first step in the preparation of lead from its ore (galena, PbS) consists of roasting the ore. PbS(s)+32O2(g)SO2(g)+PbO(s) Calculate the standard enthalpy change for this reaction, using enthalpies of formation (see Appendix C).
A 50-mL solution of a dilute AgNO3 solution is added to 100 mL of a base solution in a coffee-cup calorimeter. As Ag2O(s) precipitates, the temperature of the solution increases from 23.78 C to 25.19 C. Assuming that the mixture has the same specific heat as water and a mass of 150 g, calculate the heat q. Is the precipitation reaction exothermic or endothermic?
The combustion of 1.00 mol liquid methyl alcohol (CH3OH) in excess oxygen is exothermic, giving 727 kJ of heat. (a) Write the thermochemical equation for this reaction. (b) Calculate the enthalpy change that accompanies the burning 10.0 g methanol. (c) Compare this with the amount of heat produced by 10.0 g octane, C8H18, a component of gasoline (see Exercise 5.41).