Use the data listed in the supporting materials to calculate the equilibrium constant, Kp, for the synthesis of HCI at 298.15 K.H2(g) + Cl2(g) =2 HCI(g)4.02.47e33What is the value of Kp if the equilibrium is expressed as below?1/2 H2(g) + 1/2 Cl2(g) = HCI(g)4.0 CS2(1)C12H22011(s)C2H2(g)C2HĄ(g)C,H16(1)C,H3(1)C3H18(1)Ca(NO3)2(s)Ca(ОН),(s)89.0151.343.9-224.2328.6-322.2-2221.7360.2-1544.312.4220.1-53.2226.6200.8209.2-250.1361.2-357.852.3219.568.12-938.2193.2-995.8C2H40(g)C,H;OH(g)-52.6242.5-124.9-986.683.4-896.8Ca(g)Ca(s)CaBr2(s)CACO3(s)CaCl2(s)CaF2(s)-234.8281.6-318.8177.8154.9131.6C2H;OH(1)C2H6(g)C3H;OH(1)C3Hg(8)C,H10(8)C4H10(1)-277.0161.0-174.241.6-84.7229.5-32.9-682.8130.0-721.6-302.6193.6-360.3-1206.992.9-1128.8-103.8269.9-23.5-795.8104.6-748.1-125.6310.0-218.0-1228.068.5-1248.4-214.9Cal2(s)Са0(s)-147.3226.8-533.5142.0-575.8-252.139.8C5H12(1)C5H;N(1)C,H12(1)C,H1206(s)C,H14(1)C,H;Br(1)-173.5263.5-635.6-604.2CASO«(s)CI(g)100.2177.947.2-1434.5106.5-1466.3-156.4121.4165.2105.3-1274.5210.3-910.6CINO(g)51.7261.7-26.3-198.7296.1-287.0CINO2(g)12.6272.2-68.660.9219.2-4.5Cl2(g)223.0C,H;CH(CH3)2(1)C,H;CHO(1)C,H;CH3(1)-41.1277.6-123.9Cr(g)396.6174.5344.6-87.0221.2-153.0Cr(s)23.7712.4220.1-53.2CrCl2(s)-395.4115.3-429.8Standard State Thermodynamic DataAH º (kJ/mol)s° J/mol·K)AG ° (kJ/mol)formulaAHº (kJ/mol)s° J/mol·K)AG? (kJ/mol)formula123.0CrCl3(s)Cr,03(s)Cs(g)Cs(s)HC,H3O2(1)HCI(g)HF(g)HI(g)HNO3(g)-556.5-593.2-484.2159.8-389.9-1139.781.2-1058.1-92.3186.5-95.376.5175.624.1-273.3173.5-275.485.2-25.426.48206.31.7CsBr(s)-405.8113.1-439.5-133.9266.9-213.5CSCI(s)CsF(s)HNO3(1)H2(g)-443.0101.2-473.2-174.1155.6-80.7-553.392.8-581.0130.6Cel(s)346 6123 1383 3H.Olg)241 8188 7228 6

Answered: Image /qna-images/answer/d191414e-8535-4f50-ae82-d4d29d6a533a.jpg

Use the data listed in the supporting materials to calculate the equilibrium constant, Kp, for the synthesis of HCl at 298.15 K. H2(g) + Cl2(g) =2 HCI(g) 4.0 2.47e33 What is the value of Kp if the equilibrium is expressed as below? 1/2 H2(g) + 1/2 Cl2(g) = HCI(g) 4.0

Use the data listed in the supporting materials to calculate the equilibrium constant, Kp, for the synthesis of HCl at 298.15 K. H2(g) + Cl2(g) =2 HCI(g) 4.0 2.47e33 What is the value of Kp if the equilibrium is expressed as below? 1/2 H2(g) + 1/2 Cl2(g) = HCI(g) 4.0

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Similar questions

Methanol liquid burns readily in air. One way to represent this equilibrium is: CH₂OH(1) + 3/2 0₂(g) CO₂(g) + 2 H₂O(g) We could also write this reaction three other ways, listed below. The equilibrium constants for all of the reactions are related. Write the equilibrium constant for each new reaction in terms of K, the equilibrium constant for the reaction above. 1) 2 CH₂OH(1) + 3 O₂(g) 2) 2 CO₂(g) + 4H₂O(g) 2 CO₂(g) + 4H₂O(g) 2 CH₂OH(1) + 3 O₂(g) CH₂OH(1) + 3/2 0₂(g) K3 K₁ = K₂ = 3) CO₂(g) + 2 H₂O(g) Drag and drop your selection from the following list to complete the answer: K² (1/K)² 1/K
An equilibrium is established for the reaction 2 CO(g) + MoO2(s) = 2 CO2(g) + Mo(s). Use the expression for Kp from part a. If at equilibrium the partial pressure of carbon monoxide is 5.21 atm and the partial pressure of the carbon dioxide is 0.717 atm, then what is the value of Kp?
Consider the reaction: P(s) + 3/2Cl₂ (g) → PC13 (9) Write the equilibrium constant for this reaction in terms of the equilibrium constants, K₁ and K₂, for the reactions below: P(s) + 5/2Cl₂ (g) ⇒ PCl5(9) K₁ PC13 (g) + Cl2 (g) PC15 (9) K₂ For answers with both a subscript and a superscript, enter the subscript first. For example, enter K² if the first equilibrium constant should be squared. K =
Cyclohexane, C6H12, a hydrocarbon, can isomerize or change into methylcyclopentane, a compound of the same formula (C5 H9 CH3) but with a different molecular structure. Cyclohexane Methylcyclopentane The equilibrium constant has been estimated to be 0.12 at 25 °C. If you had originally placed 0.053 mol of cyclohexane in a 2.8 L flask, what would be the concentrations of cyclohexane and methylcyclopentane when equilibrium is established? [cyclohexane] = M [methylcyclopentane] = M
Enter your answer in the provided box. Pure phosgene gas (COCI₂), 0.0220 mol, was placed in a 1.50-L container. It was heated to 720.0 K, and at equilibrium, the pressure of CO was found to be 0.503 atm. Calculate the equilibrium constant Kp for the reaction. Kp CO(g) + Cl₂(g) = COCI₂(g)
Cl3] ² [Hz] ² [A] [AC] Consider the chemical equation and equilibrium constant for the synthesis of ammonia at 25 °C: N₂ (g) + 3 H₂ (g) = 2 NH3 (g) K = 5.6 x 105 Calculate the equilibrium constant for the following reaction at 25 °C: NH3 (g) 1/2 N₂ (g) + 3/2 H₂ (g) K' = ? Kc = [NH3 ]² [₂] [H₂]] Kc- [~₂] ¹/2 [H NH3
SO₂ reacts with Cl₂ to form SO₂Cl₂. The equilibrium constant, Kp, for this reaction is 0.417 at 373 K. 4 SO₂(g) + Cl₂(g) =SO₂Cl₂(g) The standard enthalpy change for this reaction (AH°) is -67.2 kJ/mol. (a) Predict the effect on the production of SO₂Cl₂ when the temperature of the equilibrium system is increased. (b) Use the van't Hoff equation to estimate the equilibrium constant for this reaction at 449 K. Kat 449 K =
The equilibrium constant, Ke, for the following reaction is 10.5 at 350. K. 2CH₂Cl₂ (9) CH₂(g) + CCL4 (9) Calculate the equilibrium concentrations of reactant and products when 0.359 moles of CH₂Cl₂ (g) are introduced into a 1.00 L vessel at 350. K [CH₂Cl₂]-[ [CH]-[ [CCL]-[ M M M 3
The equilibrium constant Kp = (9.180x10^-1) for the following reaction in the gas phase at a given temperature T: H2O(g) + Cl2O(g) = 2 HOCI(g) Calculate the equilibrium pressure (in bar) of HOCI(g) in the reaction vessel at temperature T if the initial pressures of H2O(g) and Cl₂O(g) are both equal to (3.06x10^-1) bar.
Consider the equilibrium system described by the chemical reaction below. If the partial pressures at equilibrium of NO, Cl2, and NOCI are 0.095 atm, 0.171 atm, and 0.28 atm, respectively, in a reaction vessel of 7.00 L at 500 K, what is the value of Kp for this reaction? 2 NO(g) + Cl2(g) = 2 NOCI(g)
Consider the endothermic decomposition reaction of chlorine monofluoride at 1031.0 K. 2 CIF(g) - Ch(g) + F2(g) The equilibrium constant at 1031.0 Kis K= 2.52x106.
Consider the following reactions and their respective equilibrium constants: NO(g) + Br2 (9) =NOB|(9); K = 5.3 2NO(g) = N2(9)+O2 (g); K = 2.1 x 1030 Use these reactions and their equilibrium constants to predict the equilibrium constant for the following reaction: N2(9) + O2 (g) +Br2 (g) 2NOB1(g) Express your answer using two significant figures. | ? K =