the ionic compound L2O3(s) is the ionic compound formed from oxygen and a metal with the form L(s) at 1.00 bar and 298 K. (a) Draw the Lewis structure for L2O3. Assume that all the valence electrons from L are required. (b) Use the following information to determine the enthalpy of formation for L2O3(s). Express your answer in kJZ(mol L2O3(s)). Lattice energy for L2O3(s) = -14836 kJ mol1 AHsub for L(s) = 358 kJ mol 1 First ionization energy for L(g) = 577 kJ mol 1 Second ionization energy for L(g) = 1794 kJ mol 1 Third ionization energy for L(g) = 3820 kJ mol 1 Bond dissociation energy for O2(g) = 498 kJ mol 1 %3D First electron affinity for O = -141 kJ mol 1 Second electron affinity for O = 744 kJ mol 1

the ionic compound L2O3(s) is the ionic compound formed from oxygen and a metal with the form L(s) at 1.00 bar and 298 K. (a) Draw the Lewis structure for L2O3. Assume that all the valence electrons from L are required. (b) Use the following information to determine the enthalpy of formation for L2O3(s). Express your answer in kJZ(mol L2O3(s)). Lattice energy for L2O3(s) = -14836 kJ mol1 AHsub for L(s) = 358 kJ mol 1 First ionization energy for L(g) = 577 kJ mol 1 Second ionization energy for L(g) = 1794 kJ mol 1 Third ionization energy for L(g) = 3820 kJ mol 1 Bond dissociation energy for O2(g) = 498 kJ mol 1 %3D First electron affinity for O = -141 kJ mol 1 Second electron affinity for O = 744 kJ mol 1

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Similar questions

(a) How much work is done on the steam when 2.20 mol of water at 100°C boils and becomes 2.20 mol of steam at 100°C at 1.00 atm pressure? (Assume the latent heat of vaporization of water is 2.26 x 106 J/kg.) kJ (b) Assume the steam to behave as an ideal gas. Determine the change in internal energy of the system of the water and steam as the water vaporizes. KJ
2 SO2(g) + O2(g) 2 SO3(g) Calculate the standard change in enthalpy of the reaction, H\deg rxn using standard enthalpies of formation.
Measurements show that the energy of a mixture of gaseous reactants increases by 388. kJ during a certain chemical reaction, which is carried out at a constant pressure. Furthermore, by carefully monitoring the volume change it is determined that-88. kl of work is done on the mixture during the reaction. th Calculate the change in enthalpy of the gas macture during the reaction. Round your anawer to 3 significant digits. O exothermic Is the reaction exothermic or endothermic O endothermic
Determine the enthalpy for the production of 5.0 g of H2 in the following target equation, making use of the known equations given below. CH4 (g) + NH3 (g) → HCN(g) + 3H2 (g) Using the following given equations: N2 (g)+3H2 (g) → 2NH3 (g) ΔH=− 91.8kJ C(s)+2H2 (g) → CH4 (g) ΔH=− 74.9kJ H2(g) + 2C(s) + N2 (g) → 2HCN(g) ΔH= + 270.3 kJ
Cl2 (g) + H2 (g) → 2 HCl (g) ΔH0rxn = ‒184.6 kJ 8. What is ΔH0rxn when 4.50 mol HCl (g) forms? (Slides 17 – 18: Stoichiometry of Thermochem. Eq.) Group of answer choices A.‒831 kJ B.‒415 kJ C.‒207 kJ D.831 kJ E.415 kJ
Determine the theoretical final water temperature if 44.3 g of water at T=63.1C is mixed with 29.2 g of water at T = 21.6C. Assume no heat is lost to the calorimeter. A calorimeter is defined as an apparatus used to measure the heat of chemical reactions or physical changes as well as heat capacity.
Use the standard of enthalpies table to determine the change in enthalpy for: N2(g) + 3 H 2(g) --------> 2 NH 3(g)
The internal pressure of a gas, π = au dv)T' is a measure of intermolecular forces, because it indicates a change in internal energy as the molecules get closer or further apart, without temperature changing. = a Calculate the change in internal 1 Vm T energy, AU, when 1.5 mols of acetone (a = 16 l² atm/mo1²), expands from 2 liters to 5 liters at a constant temperature. ii) Would this change in internal energy be greater or smaller for an ideal gas? Why? i) Using the van der Waals equation of state, T = au
(fHydrogen cyanide, a useful intermediate in the production of other pharmaceuticals and other chemicals, can be be prepared according to the following reaction: CH4(g) + NH3(g) ⟶⟶ HCN(g) + 3 H2(g). ΔΔHrxn= ???? Use the information provided to calculate the change in enthalpy for this reaction N2(g) + 3 H2(g) ⟶⟶ 2 NH3(g). ΔΔHrxn= -91.8 kJ/mol C(s) + 2 H2(g) ⟶⟶ CH4(g). ΔΔHrxn= -74.9 kJ/mol H2(g) + 2 C(s) + N2(g) ⟶⟶ 2 HCN(g) ΔΔHrxn= +270.3 kJ/mol
A sample of an ideal gas at 24.9 atm and 15.4 L is allowed to expand against a constant external pressure of 3.93 atm at a constant temperature. Calculate the work in units of kJ for the gas expansion. (Hint: Boyle’s law applies.)
In the following reaction : NaO2(s)+H2O(l)⟶NaOH(s)+O2(g)NaO2(s)+H2O(l)⟶NaOH(s)+O2(g) (YES, this reaction is written correctly). In an experiment at 23.0∘∘C and 755 torr in which water vapor reacts with a quantity of NaO2 , it was found that 3.22 kJ of heat was absorbed. The oxygen gas produced was then collected at 21.0∘∘C and 795 mmHg. What volume (in liters) of oxygen was collected? Standard ΔH0fΔHf0 NaO2(s) - 260,2 kJ H2O (l) - 285.8 kJ NaOH (s) -425.93 kJ O2 (g) 0
What is the change in enthalpy when 38.2 g of CH4(g) reacts completly with O2(g) to form CH3OH(g) at constant pressure?