the ionic compound L2O3(s) is the ionic compound formed from oxygen and a metal with the form L(s) at 1.00 bar and 298 K. (a) Draw the Lewis structure for L2O3. Assume that all the valence electrons from L are required. (b) Use the following information to determine the enthalpy of formation for L2O3(s). Express your answer in kJZ(mol L2O3(s)). Lattice energy for L2O3(s) = -14836 kJ mol1 AHsub for L(s) = 358 kJ mol 1 First ionization energy for L(g) = 577 kJ mol 1 Second ionization energy for L(g) = 1794 kJ mol 1 Third ionization energy for L(g) = 3820 kJ mol 1 Bond dissociation energy for O2(g) = 498 kJ mol 1 %3D First electron affinity for O = -141 kJ mol 1 Second electron affinity for O = 744 kJ mol 1

the ionic compound L2O3(s) is the ionic compound formed from oxygen and a metal with the form L(s) at 1.00 bar and 298 K. (a) Draw the Lewis structure for L2O3. Assume that all the valence electrons from L are required. (b) Use the following information to determine the enthalpy of formation for L2O3(s). Express your answer in kJZ(mol L2O3(s)). Lattice energy for L2O3(s) = -14836 kJ mol1 AHsub for L(s) = 358 kJ mol 1 First ionization energy for L(g) = 577 kJ mol 1 Second ionization energy for L(g) = 1794 kJ mol 1 Third ionization energy for L(g) = 3820 kJ mol 1 Bond dissociation energy for O2(g) = 498 kJ mol 1 %3D First electron affinity for O = -141 kJ mol 1 Second electron affinity for O = 744 kJ mol 1

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Similar questions

2 SO2(g) + O2(g) 2 SO3(g) Calculate the standard change in enthalpy of the reaction, H\deg rxn using standard enthalpies of formation.
Johnson and Steele determined the standard enthalpy of combustion of UO₂(s) in gaseous fluorine. The products of combustion are UF(s) and O2(g). The measured value of the enthalpy of combustion is -1112.6 kJ mol-¹ (per mole of UO₂), and the standard enthalpy of formation of UF(s) is -2197.7 kJ mol-¹. Calculate the standard enthalpy of formation of UO2(s) in kJ mol-¹.
Measurements show that the energy of a mixture of gaseous reactants increases by 388. kJ during a certain chemical reaction, which is carried out at a constant pressure. Furthermore, by carefully monitoring the volume change it is determined that-88. kl of work is done on the mixture during the reaction. th Calculate the change in enthalpy of the gas macture during the reaction. Round your anawer to 3 significant digits. O exothermic Is the reaction exothermic or endothermic O endothermic
Suppose that 13.93 grams of X (MW = 52.41) undergo combustion. The heat from this reaction is then transferred to 266 mL of water, and the water temperature changes from 26.37°C to 79.01°C. Assume the specific heat of water is 4.2 J/(g.°C) and the density of water is 1.0 g/mL. %3D Calculate the enthalpy of combustion of X in kJ/mol. Report your answer to three decimal places.
12.00 g of Compound with molecular formula C4h8 are burned in a constant-pressure calorimeter containing 15.00 kg of water at 25 °C. The temperature of the water is observed to rise by 8.603 °C. (You may assume all the heat released by the reaction is absorbed by the water, and none by the Calculate the standard heat of formation of Compound X at 25 °C. Be sure your answer has a unit symbol, if necessary, and round it to the correct number of significant digits. calorimeter itself.)
Use the molar bond enthalpy data in the table to estimate the Average molar bond enthalpies. (Hpond) value of AHxn for the equation Bond kJ • mol-1 Bond kJ • mol-1 CCL, (g) + 2 F,(g) → CF,(g) + 2 Cl, (g) O-H 464 C=N 890 0-0 142 N-H 390 The bonding in the molecules is shown. С-0 351 N-N 159 CI F O=0 502 N=N 418 F-F -CI + C=0 730 N=N 945 -F CI-CI С-С 347 F-F 155 C=C 615 Cl-Cl 243 C=C 811 Br-Br 192 С-Н 414 Н-Н 435 С-F 439 Н-F 565 C-CI 331 Н-СІ 431 С-Br 276 Н-Br 368 С-N 293 Н-S 364 C=N 615 S-S 225 kJ rxn * TOOLS x10 +
Determine the enthalpy for the production of 5.0 g of H2 in the following target equation, making use of the known equations given below. CH4 (g) + NH3 (g) → HCN(g) + 3H2 (g) Using the following given equations: N2 (g)+3H2 (g) → 2NH3 (g) ΔH=− 91.8kJ C(s)+2H2 (g) → CH4 (g) ΔH=− 74.9kJ H2(g) + 2C(s) + N2 (g) → 2HCN(g) ΔH= + 270.3 kJ
Cl2 (g) + H2 (g) → 2 HCl (g) ΔH0rxn = ‒184.6 kJ 8. What is ΔH0rxn when 4.50 mol HCl (g) forms? (Slides 17 – 18: Stoichiometry of Thermochem. Eq.) Group of answer choices A.‒831 kJ B.‒415 kJ C.‒207 kJ D.831 kJ E.415 kJ
Determine the theoretical final water temperature if 44.3 g of water at T=63.1C is mixed with 29.2 g of water at T = 21.6C. Assume no heat is lost to the calorimeter. A calorimeter is defined as an apparatus used to measure the heat of chemical reactions or physical changes as well as heat capacity.
Use the standard of enthalpies table to determine the change in enthalpy for: N2(g) + 3 H 2(g) --------> 2 NH 3(g)
The internal pressure of a gas, π = au dv)T' is a measure of intermolecular forces, because it indicates a change in internal energy as the molecules get closer or further apart, without temperature changing. = a Calculate the change in internal 1 Vm T energy, AU, when 1.5 mols of acetone (a = 16 l² atm/mo1²), expands from 2 liters to 5 liters at a constant temperature. ii) Would this change in internal energy be greater or smaller for an ideal gas? Why? i) Using the van der Waals equation of state, T = au
In the following reaction : NaO2(s)+H2O(l)⟶NaOH(s)+O2(g)NaO2(s)+H2O(l)⟶NaOH(s)+O2(g) (YES, this reaction is written correctly). In an experiment at 23.0∘∘C and 755 torr in which water vapor reacts with a quantity of NaO2 , it was found that 3.22 kJ of heat was absorbed. The oxygen gas produced was then collected at 21.0∘∘C and 795 mmHg. What volume (in liters) of oxygen was collected? Standard ΔH0fΔHf0 NaO2(s) - 260,2 kJ H2O (l) - 285.8 kJ NaOH (s) -425.93 kJ O2 (g) 0