**Gas Phase Isomerization Activation Energy Calculation**The activation energy for the gas phase isomerization of dimethyl citraconate is 105 kJ.**Chemical Reaction:**\[ \text{cis-(CH}_3\text{OOC)(CH}_3\text{)C=CHCOOCH}_3 \rightarrow \text{trans-(CH}_3\text{OOC)(CH}_3\text{)C=CHCOOCH}_3 \]**Rate Constants:**- At 658 K: \( k = 5.94 \times 10^{-4} \, \text{s}^{-1} \)- Determine the rate constant at 715 K.**Instructions:**- Utilize the given rate constant data and the activation energy to calculate the rate constant at a different temperature using the Arrhenius equation.**User Actions:**- Input the calculated rate constant in the provided field.- Utilize references for necessary constants and equations if needed.**Interface Buttons:**- Submit Answer- Retry Entire GroupNote: The user has two more group attempts remaining to solve this problem. The activation energy for the gas phase isomerization of dimethyl citraconate is 105 kJ:\[ \text{cis} - (\text{CH}_3\text{OOC(CH}_3\text{)}_2\text{C=CHCOOCH}_3) \rightarrow \text{trans} - (\text{CH}_3\text{OOC(CH}_3\text{)}_2\text{C=CHCOOCH}_3) \]The rate constant at 644 K is \(3.01 \times 10^{-4}\) s\(^{-1}\). The rate constant will be \(1.76 \times 10^{-3}\) s\(^{-1}\) at _____ K.Buttons:- Submit Answer- Retry Entire GroupNote: 2 more group attempts remaining.

Answered: Image /qna-images/answer/48a89943-7057-4d22-9d99-3c9deb445eae.jpg

The activation energy for the gas phase isomerization of dimethyl citraconate is 105 kJ. cis-(CH3OOC)(CH3)C=CHCOOCH3- →trans-(CH300C)(CH3)C=CHC0OCH3 The rate constant at 667 K is 5.94×10+ /s. The rate constant will be /s at 715 K.

The activation energy for the gas phase isomerization of dimethyl citraconate is 105 kJ. cis-(CH3OOC)(CH3)C=CHCOOCH3- →trans-(CH300C)(CH3)C=CHC0OCH3 The rate constant at 667 K is 5.94×10+ /s. The rate constant will be /s at 715 K.

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Similar questions

The conversion of methyl isonitrile to acetonitrile in the gas phase at 250 °C CH3NC(g)CH;CN(g) is first order in CH3NC with a rate constant of 3.00×10³s!. If the initial concentration of CH3NC is 2.75×10-² M, the concentration of CH3NC will be M after 627s have passed.
The rate constant of a certain reaction is known to obey the Arrhenius equation, and to have an activation energy E, = 55.0 kJ/mol. If the rate constant of thisreaction is 3.7 x10? M-'.5 ' at 256.0 °C, what will the rate constant be at 311.0 °C?Round your answer to 2 significant digits.
The activation energy for the gas phase decomposition of dichloroethane is 207 kJ. CH;CHCI,CH2=CHC1+ HCI The rate constant at 697 K is 3.96×10-4 /s. The rate constant will be 4.71×103 /s at K.
[03mol/L Initial Rate mol/L.s S02 m 7/1ou 0.118 0.25 0.40 0.25 0.20 0.118 0.75 0.20 1.062 Q1 Consider the following reactions SO2+03 → SO3 +O2. A rate study of this reaction was conducted at 298 K. The data that were obtained are shown in the table (a) What is the order of reactions for S02 (b) What is the order of reactions for 03 (c) Write the rate law (d) Determine the value and units of the rate constant, k
4. What is the value of x, the order of the reaction with respect to [OH']? k'/k" = (1/0.5)* 5. What is the value for the rate constant, k? k= k'/1* = %3D k =k"/0.5*= SaD 6.
Concentration-Time Relationships (See Section 15.4 and Examples 15.5-15.7.) 15. The rate equation for the hydrolysis of sucrose to fruc- tose and glucose CRH2O1(aq) + H¿O(€) → 2 C,H12O6(aq) is -A[sucrose]/At = k[C¡2H2O1]. After 27 minutes %3D at 27 °C, the sucrose concentration decreased from 0.0146 M to 0.0132 M. Find the rate constant, k.
7. DETAILS The first-order rate constant for the conversion of cyclobutane to ethylene at 1000.°C is 101 s ¹. C4H8 → 2 C₂H4 A. What is the half-life of the reaction at 1000."C? [ B. If you started with 3.350 g of cyclobutane, how long would it take to consume 0.4020 g of it? C. How much of a 2.50 g sample of cyclobutane would remain after 0.03430 s? Useful Information: 1.013 bar = 760 torr = 1 atm = 760 mm Hg h = 6.62607x10-34 3.s c = 2.99792 x 108 m/s R = 8.314472 3/mol.K NA = 6.02214 x 1023 1/mol R = 0.08205746 L.atm/mol.K F = 9.648534 x 104 c/mol Equations: K= K (RT)An AG=AHⓇ - TASⓇ MY NOTES pH = pk +log. E = E [A] [HA] 7=45 0.05916 n ASK YOUR TEACHER PRACTICE ANOTHER log Qrxn AG=-RTINK AG=-nFE 1 [A]t In(2) k [A] = [A]okt 1 =kt + [A] 9 [A] t= k[A] [A] 2k -kt -Ea k Ae RT
Methyl salicylate has the odor of oil of wintergreen. This ester is prepared by the Fisher esterification of salicylic acid with methanol, shown here: HSO, OH * CH,OH OCH, • H,0 +] OH OH Use the dropdowns below to indicate the order of the steps that occur in this reaction mechanism to transform salicylic acid into methyl salicylate. Step 1 [ Choose (Choose Step 2 Protonation of the C-O oxygen atom Step 3 Proton transfer to neutralize the product Reforming of the CHOand loss of the leaving group Step 4 Proton transferts the OH group on the tetrahedral intermediate Attack of the methanol on the carbon of the C-O Step 6 Breaking of the pi bond to push eléctrons onto exygeri nd form the tetrahedial intermedian
we now have: Step 1: Fast, reversible HA = H+ + A- Step 2: Fast, reversible X + H+ = HX+ Step 3: Slow HX+ = productsrate= k3 k2/k-2 [X][HX+] Does the current rate law contain an intermediate?
Q2) Consider the following third order reaction: A➜ product The following is the integrated rate law for the third order reaction: 2[A];² 11/2 = kt + 1.5 K[A]0² 2[A]o² If the concentration of the reactant after 26.5 second of the experiment was found to 0.348 M and the rate constant for this reaction was found to be 1.5x10¹² M².S¹. a) Determine the initial concentration of the reactant. b) What is the half-life of this reaction? c) What is the concentration of the reactants after 1.00 min of the experiment?