Structures with the molecular formula C7H12O2 that contain two units of unsaturation. Create a single structural formula for each isomer that fits the description given in the boxes:A) C7H12O2 isomer containing a carbon-carbon ringB) C7H12O2 isomer that is a KetoneC) C7H12O2 isomer that is a Carboxylic AcidD) C7H12O2 isomer containing sp3 hybridized carbons bound to each otherE) C7H12O2 ester which contains a carbon-carbon ring

Q: Compounds X and Y both have the formula C7H₁4. Both X and Y react with one molar equivalent of…

A: The question is based on the concept of organic reactions.We need to identify X and Y.

Q: Which of the following compounds contain an acetal functional group? LOCH3 CH3 thoma -0 c A O A and…

A: Carbonyl compounds (aldehyde and ketone) react with an alcohol to form hemiacetal in the presence of…

Q: (a) Draw the three staggered conformations of 2-methyl-3-methylpentane looking down the C2-C3 bond…

A: The structure of 2 methyl-3-methylpentane is   CH3-CH(CH3)-CH(CH3)-CH2-CH3  All the three possible…

Q: Derive an IUPAC name for the following (cyclo)alkenes. (Do not use cis/trans in your names. Use only…

A: Basic rules for IUPAC nomenclature:1) Select longest chain or block of carbon atoms as parent. 2)…

Q: which functional groups are in C6H12O2 with it having 1 degree of saturation, and is the molecule…

A:

Q: Draw and name two different constitutional isomers of C8H16 that have geometric isomers and are…

A: Given: i) Molecular formula = C8H16 ii) The isomers should have the name "...pentene". That is, the…

Q: Write the systematic (IUPAC) name for each of the following organic molecules: structure…

A: Rules=>>(1) longest carbon chain in the molecule is identified(2) the longest chain of carbon…

Q: For a compound with the molecular formula C6H8O, which of the following must be false? The compound…

A:

Q: 2. Which of the following statements about 2-methyl-2-pentene and 3-methyl- 2-pentene is true? a)…

A: The isomers which have a restricted rotation around the double bond is known as geometrical isomers.…

Q: a) A carboxylic acid with a 2nd functional group containing O, molecular formula C7H12O3 b) A…

A: A carboxylic acid is an organic acid. It contains a carboxyl group (C(=O)OH) attached to an R-group.…

Q: 3a) Provide complete IUPAC names for each of the following structures.

A: A question based on nomenclature. Structures of 6 organic compounds are given whose respective IUPAC…

Alkynes

Alkynes are organic compounds that contain at least one triple bond between carbon-carbon atoms. They are a series of unsaturated compounds with a general molecular formula, CnH2n-2.