4. Calculate the mass of 4-chlorophenylmagnesium bromide (in grams) given the values listed in the reactionscheme.Keep your answer to two (2) decimal places.CIMgBr4-chlorophenylmagnesium bromideMW: 215.76 g/mol0.58 mmol1.bis(4-methoxyphenyl)methanoneMW: 242.27 g/mol0.13 gDiethyl etherMW: 74.12 g/mold: 0.706 g/mL2.00 mL2. HCI/H₂OOHofoCI(4-chlorophenyl)bis (4-methoxyphenyl)methanolMW: 354.83 g/mol

Answered: Image /qna-images/answer/31d78c03-d8a0-4f87-ab15-07fad6de07b6.jpg

scheme. Keep your answer to two (2) decimal places. MgBr 4-chlorophenyimagnesium bromide MW: 215.76 g/mol 0.58 mmol 1. bis(4-methoxyphenyl)methanone MW: 242.27 g/mol 0.13 g Diethyl ether MW: 74.12 g/mol d: 0.706 g/mL 2.00 mL 2. HCI/H₂O OH ofa (4-chlorophenyl)bis(4-methoxyphenyl)methanol MW: 354.83 g/mol

scheme. Keep your answer to two (2) decimal places. MgBr 4-chlorophenyimagnesium bromide MW: 215.76 g/mol 0.58 mmol 1. bis(4-methoxyphenyl)methanone MW: 242.27 g/mol 0.13 g Diethyl ether MW: 74.12 g/mol d: 0.706 g/mL 2.00 mL 2. HCI/H₂O OH ofa (4-chlorophenyl)bis(4-methoxyphenyl)methanol MW: 354.83 g/mol

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Similar questions

8. A. Balance the following equations: i. a. S (s) + O2……………….> SO2(g) b. H2O2 (aq) + H2S (aq)……………..> H2O(l) + S (s) c. NaBr(aq) + Cl(aq) + NaCl(aq) Br (aq) d. A(s) + O2(g) ………………..> Al2O3 e. CH4 (g) + O2 (g) …………..> CO2(g) + H20 (l) ii. Identify the Oxidizing and reducing agents in the following equation: a. 2Cu (s) + O2(g) …………> 2CuO b. Cl(aq) + 2KI(aq)
a person consumes 4lts of oxígen (O2) per minute when breathing.how Many moles would that be per hour?
A student heated a 2.43-g sample of a hydrate and recovered 1.35g of an anhydrous compound. (c) Calculate the number of moles of water loss from the hydrated compound.
Cu (II) sulfate exists as a hydrate. It has many practical uses including use as a fungicide and pesticide. When mixed with chromium and arsenic it forms the wood preservative called CCA. CCA was used in pressure treated wood to protect wood from rotting due to insects and microbial agents. Because CCA treated wood contains toxic heavy metals, its use has been discontinued for home use and children’s play sets. 1. A chemist is given a sample of the CuSO4 hydrate and asked to determine the empirical formula of it. The original sample weighed 42.75 g. After heating to remove the waters of hydration, the sample weighed 27.38 g. Determine the formula for this hydrate.