4. Calculate the mass of 4-chlorophenylmagnesium bromide (in grams) given the values listed in the reactionscheme.Keep your answer to two (2) decimal places.CIMgBr4-chlorophenylmagnesium bromideMW: 215.76 g/mol0.58 mmol1.bis(4-methoxyphenyl)methanoneMW: 242.27 g/mol0.13 gDiethyl etherMW: 74.12 g/mold: 0.706 g/mL2.00 mL2. HCI/H₂OOHofoCI(4-chlorophenyl)bis (4-methoxyphenyl)methanolMW: 354.83 g/mol

Answered: Image /qna-images/answer/31d78c03-d8a0-4f87-ab15-07fad6de07b6.jpg

scheme. Keep your answer to two (2) decimal places. MgBr 4-chlorophenyimagnesium bromide MW: 215.76 g/mol 0.58 mmol 1. bis(4-methoxyphenyl)methanone MW: 242.27 g/mol 0.13 g Diethyl ether MW: 74.12 g/mol d: 0.706 g/mL 2.00 mL 2. HCI/H₂O OH ofa (4-chlorophenyl)bis(4-methoxyphenyl)methanol MW: 354.83 g/mol

scheme. Keep your answer to two (2) decimal places. MgBr 4-chlorophenyimagnesium bromide MW: 215.76 g/mol 0.58 mmol 1. bis(4-methoxyphenyl)methanone MW: 242.27 g/mol 0.13 g Diethyl ether MW: 74.12 g/mol d: 0.706 g/mL 2.00 mL 2. HCI/H₂O OH ofa (4-chlorophenyl)bis(4-methoxyphenyl)methanol MW: 354.83 g/mol

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Similar questions

20. After the successful lip tint sales of Sakura's self-produced cosmetic brand Cran by Molak, she decided to start on her eye glimmer palettes. Bismuth oxychloride is used in makeup to give a lustrous pearly effect and can be obtained through the reaction of bismuth chloride with water in the following hydrolysis reaction. a) Determine the grams of reagent in excess if 3.19 moles BiCl3 reacted with 0.980 moles water. b) What is the nercent yield BIOCI if 198 g bismuth oxychloride were obtained from the reaction? BİCI3 + H20 BIOCI + HCI
The mineral galena is composed of lead(II) sulfide and hasan average density of 7.46 g/cm³. (a) How many moles oflead(II) sulfide are in 1.00 ft³of galena? (b) How many leadatoms are in 1.00 dm³of galena?
EX- An ore is analyzed for the manganese content by convening the manganese to Mn304 and weighing it. If a 1.52g sample yields Mn304 weighing 0.126 g, what would be the percent Mn₂O3 in the sample? The percent Mn?
Narceine is a narcotic in opium that crystallizes from solu-tion as a hydrate that contains 10.8 mass % water and has a mo-lar mass of 499.52 g/mol. Determine x in narceine xH₂O
(2) 8. Write the balanced equation for the neutralization reaction between HI and Ba(OH)2 in aqueous solution. Include phases (physical states) in your equation. Use the arrow, not "=".
The great French chemist Antoine Lavoisier discovered the law of conservation of mass in part by doing a famous experiment in 1775. In this experiment they found that mercury(II) oxide, when heated, decompose into liquid mercury and an invisible and previously unknown substance: oxygen gas. A. Write a balanced chemical equation, including physical state symbols, for the decomposition of solid mercury (II) oxide (HgO) into liquid mercury and gaseous dioxygen. B. Suppose 72 mL of dioxygen gas are produced by this reaction, at a temperature of 120°C and pressure of exactly 1 atm. Calculate the mass of mercury (II) oxide that must have reacted in grams. Round your answer to three significant digits.
(3). Write a balanced chemical equation for each of the following reactions: a. Iron + oxygen gas ------- iron (III) oxide b. Sulfuric acid + aluminum hydroxide ---------- aluminum sulfate + water c. Silver nitrate + barium chloride -------- silver chloride + barium nitrate d. Copper (I) sulfide + oxygen gas ------- copper + sulfur dioxide
2)The coefficients needed to balance the following equation is: ……Be2C +...…H2O → ……Be(OH)2 + …...CH4 Select one: A. 3, 9, 3, 1 B. 2, 8, 2, 2 C. 1, 4, 2, 1 D. 2, 4, 2, 2
Answer question 2
2. Complete: ~ SH
6:24 Question 4 of 16 LO 00 Psoralen, a compound found in giant hogweed, contains only C, H, and O. Combustion of 1.000 g of psoralen produces 2.600 g of CO₂ and 0.2903 g of H₂O. Determine the molar mass of the compound if it is between 175.0 and 250.0 g/mol. Provide an answer to four significant figures. 1 2 3 4 6 7 8 9 5 g/mol +/- Tap here or pull up for additional resources O 974 Submit XU x 100
O ion of krypton; O ion of potassium. 15. The number of moles of ions produced by the dissociation of one mole 1 poi of (NH4)3PO4 is 20; 7; 3;