QUESTION 18 Which of the following alkenes is the most stable? CH;CH, CH; CH,CH3 Ola. Ob. H;C Oc. H;C d. CH;CH,CH,CH,CH=CH, Oe. CH;CH2 CH,CH3 H CH,CH; H3C CH; H;C H. H.

Q: Which alkene on ozonolysis produce Pentan-3-one and 2-Methylpropanal?

A: Ozonolysis:   Alkenes by addition of ozone to give carbonyl Compounds , it is called ozonolysis…

Q: 1- Pentyne fionL brome propan. Prefare The Pollowing Cimolle Iso propyl Alchel from Propelene…

A: The question is based on the concept of organic reactions.   We have to convert the reactant into…

Q: Rank these alkenes as to stability: CH3 CH3 CH2 H3C. CH2 H,C. CH H;C. CH3 ČH3 CH3 CH3 C O B most, C…

A:

Q: Name the three alkenes using systematic names. A. H₂C B. H3C CIC The name of compound A is: H3C CH3…

A: IUPAC rule-The ene suffix (ending) indicates an alkene use it by replacing e from alkane  2. The…

Q: H. O2N" b. CI C. d. „CH3 CH3 H3C е.

A: IUPAC Nomenclature

Q: Which one of the following compounds is an alker Select one: O a. H-CEC-CH H. O b. H;C-C C-CH, O C.…

A: The question is based  on the concept of organic compounds. we have to correctly identify the alkene…

Q: CIH CIH CIH 27. What is the monomer used to prepare .c.c.c.ċ-c-C- -C-C-C-C-C-Ċ- H CHH CHH CH; O a.…

A: The alkene can be polymerized into polyalkene. During polymerization, the double bond of the monomer…

Q: a. b. From two structural isomers ОН HCI, H₂O heat HCI, H₂O heat 1. p-TsCl, pyridine 2. NaOH, H₂O…

A: Wite structures of the reactants and products in the given incomplete reactions.

Q: CH3 d. H;C-CH-CH•CH3 e. CH3I 150 °C H3C CH;

A: Tertiary amine reacts with methyl iodide to produce quaternary amine which upon heating undergoes…

Q: A. GIVE THE IUPAC NAME OF 1. CH,CH-CH = CH-CH, F: CH, 2. CH2 =C-CH = CH2 CH, 3. CH,CH,C-C=C-CH, CH,…

A: Since you posted question with multiple subparts , as per guidelines we can answer 3 per session .…

Q: What reagent (reactant) could be used to produce the product above from 1-butene? A. HBr B. Br2…

A: Given: 1-butene : CH2=CH-CH3-CH3

Q: 1. /TSOH Cyclohevanone B 2. H;C=CHCH;CI

A: This reaction is an example of stark enamine reaction. The enamines are regioselective with…

Q: Give an acceptable name for each compound

A: Since you have posted questions with multiple subparts, we will solve the first three sub parts for…

Q: 2 mehgiheene ..syclohexene. HO H. P-benzoicacid.

A: The constituent attached with the given molecule is methoxy and the key functionality is the ketonic…

Q: ОН H .N. .CH3 CH3 H,N

A: Here we have to predict the types of streoisomerism shown by the following compound. The streoisomer…

Q: 4. Carbonation of grignard reagent i. CO, CH;MgBr ii. H,O*

A: When grignard reagent is treated with CO2 and H3O+ formation of carboxylic acid take place.

Q: 51. What is the product of the reaction below? 1. BD,/THF 2. H;O-/OH" OH Он OH В

A: As per our guidelines we are supposed to answer only one question. Kindly repost other questions as…

Q: The reaction of CH;CH=CH-CH=CH, with excess bromine gives chiefly 1,2-dibromo-3-pentene b. 22. a.…

A:

Q: What is the organic product? NaOC,H; H* CH;O- OC,HS CH-CH-C-oC,Hs + HOC,H5 I. C,H;Q III OH CHOCH O…

A: In this question we have to tell the major organic product of the reaction.

Q: C-C-C-C-C Structiral formula for CuHi2 AIkene DAh douke bond at Carbon 2 that Shows as-somensm.…

A: IUPAC Name: Hex-2-ene The double bond is on C2. It is a cis alkene. Both the least priority groups…

Q: B- Give name of the structure (4 only): 1- CH3 CH = CH – CH3 2- CH3CI 3- СоН6 4- CHz CHz 5-СH3…

A: By using rules of IUPAC of given compound in question B  1) Characterize first Alkane or alkene or…

Q: 36. Which of the following is a tertiary alkyl halide? A. (CH) CHBr B. (CH) CHCH.C C. (CHICCI D.…

A: Alkyl halides are a compound in which one or more hydrogen atoms in an alkane have been replaced by…

Q: Compare These TWO reaction a and G Which both produces alkene Expluin what are the major differenLes…

A:

Q: OH H3C-CH- -CH-CH2- -CH2-CH3 H2C-CH3 g. IUPAC || h. H3C-CH2-C-CH3 IUPAC || H;C-CH2-C--CH3 Derived

A:

Q: 1. Which is the hydrolytic reaction for the basic compound ethylamine (CH:CH:NH:)? CH;CH,NH-(ae) +…

A: A hydrolytic (or hydrolysis) reaction is the cleavage of a chemical bond by the addition of H2O(l)…

Q: CIH CIH CIH 27. What is the monomer used to prepare -ċ-ċ-Ċ-Ċ-Ċ-Ċ- H CHH CHH CH; Oa. CH2=CHCI Ob.…

A: Cut the repeating unit and put the double bond to get monomer.

Q: I. Use the IUPAC system to hame the following compounds CH) а. CH.CH,CH: CH) Br

A:

Q: CH; Q 29. CH; C-CH,-Č-H CH, CH, The correct IUPAC name for the compound above is Oa.…

A: IUPAC is the worldwide accepted nomenclature system for chemical compounds. From the IUPAC name ist…

Q: Write IUPAC name of the following and write the functional group present and highlight it. H,C „CH,…

A: Since you have posted a question with multiple sub-parts, we will solve first three sub-parts for…

Q: Give the systematic name of the following.

A: The systematic name of the given compound can be written as

Q: 1. NANH2; 2. CH;CH,CHO; 3. H*(quenching); 4. H/Pd/BaSO,/pyridine; 5. OsO,/H,O2 H =-H он OH он он Но…

A:

Q: Five isomerie lkenes are isolated during the dehydration of 4methyl-2 pentanol What is the miost…

A: Since you have asked multiple question, we will solve the first question for you. If you want any…

Q: 11. Consider this list of compounds: CH3ČCH;CH CH;CCH, CHSCCH3 CaHsCOH CH;COH CH,OH CH;C=N CH;C=N…

A:

Q: Which of the following structural formulas does not have the molecular formula CaH?

A: The chemical formula of any chemical compound is a way of representing information about the…

Q: Molecular halogen (X2) adds to alkenes to make vicinal dihalides. In the boxes, draw the curved…

A: To solve this problem we have to draw the curve arrow mechanism of the given reaction.

Q: g. H3C NH3 H h. .N. i. H* H3C -C O-CH2CH3 H,0 エZ +

A:

Q: NANH2 CH,-I H20 CH3-C=CH B Hg", H*

A:

Q: 3. What is the configuration of the alkene PAUL? PERO. cis PEOR. trans HO POER. E REPO. Z PAUL

A:

Q: Nam the alcohol below OH H;CH:C CH O a. (S)-butanal O b. (S)-propan-2-ol O c. (S)-butan-2-ol O d.…

A:

Q: Na, NH3 5. What is the product of the following reaction? H,CC=CCH,CH,CH(CH,), H,CC=CCH,CH,CH(CH,),…

A: Alkyne in the presnece of Na and NH3 undergo reduction leading to gives trans product by electron…

Q: g e. CH3CH2CH(OCH3)CH2CH2CH2OH f. केभ

A: Since you have posted a question with multiple sub-parts, we will solve first three sub-parts for…

Q: What is the configuration of the alkene in the following molecule? A. R  B. Z  C. E D. S

A: E and Z nomenclature is assigned for alkene. When higher priority groups are on same side then it is…

Q: Write the MAJOR product(s) of the following reactions: H2C: ECH- EN + а. OH c=0 H3C-CH=CH FCH= CH…

A: The reaction mentioned here is a diel Alders reaction. The reaction is a pericyclic reaction between…

Q: What are the products of the following reactions?

A: Since you have posted question with multiple sub-parts, we are entitled to answer the first 3 only.

Q: Which one of the following alkenes is the most stable? H3C CH3 H3C CH3 H3C CH2-CH3 ÇH3 C= H3C. CH2…

A: More substituted alkenes are more stbale.More substituted  alkenes can attain more hyperconjugation…

Alkanes and Cycloalkanes

Alkanes are saturated organic compounds which are made up of C and H atoms. Alkanes have the general formula of CnH2n+2. Alkane contains sp3 hybridized carbon atoms with four sigmas (σ) bonds & every hydrogen atom is connected with one of the carbon atoms. The size of the alkane could be determined by the number of carbon atoms located in it.