Drow mechanism and full details PracticeClCl₂, heatH₂O?conc.??H₂SO4?cold OH-KMnO4

Step 1: Cl2 + heat does chlorination. Step 2: H2O acts as a nucleophile and substitutes chlorine.…

Answered: Practice Cl Cl₂, heat H₂O ? conc. ? ?…

Science

Chemistry

Practice Cl Cl₂, heat H₂O ? conc. ? ? H₂SO4 ? cold OH- KMnO4

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter6: Thermochemistry

Section: Chapter Questions

Problem 91E: Consider the reaction 2ClF3(g)+2NH3(g)N2(g)+6HF(g)+Cl2(g)H=1196KJ Calculate H for CIF3(g).

See similar textbooks

Related questions

Q: OWLv2 | Online teaching and x + CakeAssignment/takeCovalentActivity.do?locator-assignment-take Use…

Q: Given me the please current answer.

A: Step 1:Lewis structure are given below:- Electron pair geometry refers to the arrangement of…

Q: . How many litres of hydrogen gas will be produced by the decomposition of 90 L of water? (Assume…

A: The objective of the question is to calculate the volume of hydrogen gas produced by the…

Q: H₂N. но35 1.1 CN 매 2.1 I-Z 2.2 OCH3 NH он No₂

A: 1. When compound 1.1 combined with compound 1.2, the following amine compound (Product A) will be…

Q: Please correct answer and don't use hend raiting

A: Step 1: Step 2: Step 3: Step 4:

Q: 2. Draw crystal-field splitting diagrams for PtCl 4 and [PtC14]² and calculate the CFSE. Be sure to…

Q: Question 32 Predict the FINAL (?) product for each of the following reaction or synthetic chain:…

A: Step 1: Step 2: Step 3: Step 4:

Q: None

A: Step 1:Step 2: Step 3: Step 4:

Q: A Water Quality Standard will be developed for radioactive isotope “Iron-55” which has physical…

A: The objective of the question is to determine the following Calculate the maximum concentration…

Q: Uncatalyzed Reactio Time (s) Energy (kJ/mol) 0 40 1 40 2 40 3 40.1 4 40.2 5 40.3 60 6 40.4 7 40.5 68…

Q: 1. Can 100 mL of 0.1 M phosphate buffer at pH 7.2 act as an effective buffer against the addition of…

A: The objective of this question is to determine whether a phosphate buffer can effectively buffer…

Q: 6. Provide the major product and propose a reasonable mechanism for its formation by using curved…

Q: Draw the product of the substitution reaction shown below. Ignore the inorganic byproducts. CHзOK…

Q: 1. Propose reagents to achieve the following transformation. Hint: If you want to use an enolate,…

A: Step 1: Step 2: Step 3: Step 4:

Q: Ita Srxn Substance HCOOH(aq) S (J-mol K-1) . 92.0 HCOOH(1) 128.95 H2C2O4(s) 115.6 H2C2O4(aq) 45.61…

A: The objective of the question is to calculate the entropy change for the given reaction and discuss…

Q: Super hero expert Hand written solution is not allowed

Q: Please answer in tipping format

A: Step 1: a. Li, C, N Lowest to highest electronegativity: Li < C < N Lithium (Li) has the…

Q: Provide the structures of the major organic products of the following reaction. CH3 NaOH, A CH3 Draw…

A: Approach to solving the question: Detailed explanation: Examples: Key references:

Q: 1) Draw the products of the following reactions. Draw stereoisomers and identify them as…

Q: Consider the reaction of the peroxydisulfate ion ( S₂Os) with the iodide ion (I) in an aqueous…

A: Step 1: suppose order of reaction with respect to [S2O8−2] = m and [I−] = n so rate of…

Q: شهره 3. Give the final product 1)PPh3 2) Buli b) ر3 له ده

A: Approach to solving the question: Detailed explanation: Examples: Key references:

Q: You are supplied with the following: NaCl (Mr = 58.443 g/mol) 2.5 M Tris-Cl, pH 8 oplossing /…

A: We are given the following data and we need to calculate how to prepare 500 ml of the digestion…

Q: None

A: Bronze is a solid solution of Cu(s) and Sn(s).Sea water is a solution because the salt is dissolved…

Q: when 26 liters of hydrogen gas and 13 liters of oxygen gas react to form water at constant…

A: The objective of the question is to find out the volume of water vapor formed when hydrogen and…

Q: Consider the reaction, 2A + B → C. If the rate law for this reaction is rate = k{A}²{B}, what is…

A: The given reaction is 2A + B → C and the rate law for this reaction is rate = k[A]²[B]. The rate law…

Q: III O Kinetics and Equilibrium Using Le Chatelier's Principle to predict the result of changing...…

A: The conditions stated in problem can be explained by Le Chatelier Principle which states that if a…

Q: i dontt want hand writting image

A: Step 1: Predict arrow movement Explanation: An arrow always depicts a region of high electron…

Q: Iron nanoparticles were produced by the evaporation method and their average sizes are estimated 25,…

A: The peak width (β) can be calculated using the Scherrer equation which can be represented as…

Q: Using thermodynamic data to calculate K Using any data you can find in the ALEKS Data resource,…

Q: 6. Provide the structure of 2-linoleoyl-3-arachidonoyl phosphatidylserine, where "linoleoyl" refers…

A: The objective of the question is to provide the structure of a specific phospholipid,…

Q: None

A: The reaction you provided is likely a substitution reaction involving a thiol (H-SCH2CH3) and an…

Q: Please answer the follwing chem question

Q: Show the mechanism for the transformation in the image, include the starting material needed to…

Q: Give the products of the reaction given below and state which reaction willproceed faster?

Q: None

A: Step 1: Balance the molecular equation with the correct number of coefficients per chemical species.…

Q: Predict the reactants of this chemical reaction. That is, fill in the left side of the chemical…

A: Step 1:Step 2:Step 3:

Q: Determine ∆G° for a reaction when ∆G = -88.9 kJ/mol and Q = 0.043 at 298 K. (R = 8.314 J/mol ･ K)

A: The objective of this question is to calculate the standard Gibbs free energy change (∆G°) for a…

Q: A 0.075 M solution of a base has a pH of 11.40. What are the hydronium and hydroxide ion…

A: The objective of this question is to find the hydronium ion concentration [H3O+] and the hydroxide…

Q: Determine the equilibrium constant for a reaction at 260.0 K if ∆G° =80.50 kJ/mol. (R = 8.314 J/mol…

A: Step 1: Here we have givenΔGo = 80.50 kJ/mol = 80500 J/molTemperature = 260 KR = 8.314 J/mol.K Here…

Q: None

A: Step 1: Step 2: Step 3: Step 4:

Q: For the Diels-Alder reaction, the product's skeletal structure and configuration at the bridgehead…

A: The objective of this question is to complete the structure of the major product of a Diels-Alder…

Q: Calculate the pH of a solution that has an ammonium chloride concentration of 0.058 M and an ammonia…

Q: What is the approximate pH at the equivalence point of the titration curve shown below? A B A. O…

A: 1) Approximate pH at equivalence is at about 7.0.As equivalence point is a point where amount of…

Q: 10. Provide a Fischer projection for the sugar shown below. At which position(s) is the…

Q: Draw the product of this reaction. Ignore inorganic byproducts. HO H HO- ・H HO ・H HO ・H CH2OH H2 Pt…

Q: balance the following

A: Approach to solving the question: Detailed explanation: Examples: Key references:

Q: Determine the equilibrium constant for a reaction at 200.0 K if ∆G° =-13.10 kJ/mol. (R = 8.314 J/mol…

A: The objective of the question is to calculate the equilibrium constant (K) for a reaction at a given…

Q: Mechanism Explorer: Sketch and Submission (Intermediate) Reactant Tip: Add curved arrows in this…

A: Here we have to write seven steps involved in the following reaction of ketone in acidic medium .…

Question

Drow mechanism and full details

Practice
Cl
Cl₂, heat
H₂O
?
conc.
?
?
H₂SO4
?
cold OH-
KMnO4

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Similar questions

9.56 Using heats of formation tabulated in Appendix E, calculate the heats of reaction for the following. (a) C2H2(g)+52O2(g)2CO2(g)+H2O(l) (b) PCl3(g)+Cl2(g)PCl5(g) (c) C2H4(g)+H2O(g)C2H5OH(g) (d) Fe2O3(s)+2Al(s)Al2O3(s)+2Fe(l)
9.52 Write the formation reaction for each of the following substances. (a) CH4(g) , (b) C3H(l) , (c) HCI(g), (d) C6H12O6(s) , (e) NaF(s)
Joseph Priestly prepared oxygen in 1774 by heating red mercury(II) oxide with sunlight focused through a lens. How much heat is required to decompose exactly 1 mole of red HgO(s) to Hg(l) and O2(g) under standard conditions?
A reaction used to produce the silicon for semiconductors from sand (SiO2), can be broken up into three steps: SiO2(s)+2C(s)Si(s)+2CO(g)H=689.9kJ Si(s)+2Cl2(s)SiCl4(g)H=657.0kJ SiCl4(g)+2Mg(s)2MgCl2(g)+Si(s)H=625.6kJ (a) Write a thermochemical equation for the overall reaction where silicon is obtained from silicon dioxide and CO and MgCl2 are by-products. (b) What is H for the formation of one mole of silicon? (c) Is the overall reaction exothermic?
The heat of neutralization, Hneut, can be defined as the amount of heat released (or absorbed), q, per mole of acid (or base) neutralized. Hneut for nitric acid is -52 kJ/mol HNO3. At 27.3C, 50.00 mL of 0.743M HNO3 is neutralized by 1.00 M Sr(OH)2 in a coffee-cup calorimeter. (a) How many mL of Sr(OH)2 were used in the neutralization? (b) What is the final temperature of the resulting solution? (Use the assumptions in Question 11.)
Given the following data Fe2O3(s)+3CO(g)2Fe(s)+3CO2(g)H=23KJ3Fe2O3(s)+CO(g)2Fe3O4(s)+CO2(g)H=39KJFe3O4(s)+CO(g)3FeO(s)+CO2(g)H=18KJ Calculate H for this reaction FeO(s)+CO(g)Fe(s)+CO2(g)
13. a) Molar mass of (NHa)2 HPO b) Calculate the # of moles in 72.5g 0f (NHq)a HPO4. c) Calculate the Ħ of molecules in 0.251 moles of (NHa)2 HPO4.
__P4(s) + __Cl2(g) ® __PCl5(g) ΔH°rxn = –1500 kJ The reaction is _____thermic, heat flows _____, bonds between atoms become ___________er In a reaction mixture of 0.22 g(P4) and 1.45 g(Cl2): The 0.22 grams of P4 are enough to form _______ mol(PCl5) _______ LSTP (PCl5) The 1.45 grams of Cl2 are enough to form _______ mol(PCl5) _______ LSTP (PCl5) The limiting reagent (LR) in the mixture is _______ The theoretical yield of PCl5 is _______ mol and _______ LSTP (liters at STP)
Given the reaction: ½ H2 (g) + ½ Cl2 (g) --> HCl (g) ΔH = -92 kJ/mol What is the missing bond energy in kJ/mol? H - H BE = 435 kJ/mol H - Cl BE = 431 kJ/mol Cl - Cl BE = ? kJ/mol? A) 96 B) 335 C) 188 D) 88 E) 243
(b) If we add CO, t gases be when equil H2- CO:
12. Consider the following reaction. CH3CH2Br + H20 - CH;CH2OH + HBr (c) Calculate the enthalpy of the reaction (use data from your slides) (d) Is the reaction endothermic or exothermic.
question 29 please