Phineas was running a voltaic cell constructed with a Ni(s)|Ni2*(aq) half-cell and a K(s)|K*(aq) cell. The observed potential of Ecell is 2.71 V. Using the Nernst equation calculate the concentration of Ni2+ if 0.559M of K* is present. K+(aq) + e¯ → K(s) E°= -2.93 Ni²++2e- → Ni E° = -0.23 O 1.01 O 0.563 O 0.681 O 0.715

Phineas was running a voltaic cell constructed with a Ni(s)|Ni2(aq) half-cell and a K(s)|K(aq) cell. The observed potential of Ecell is 2.71 V. Using the Nernst equation calculate the concentration of Ni2+ if 0.559M of K* is present. K+(aq) + e¯ → K(s) E°= -2.93 Ni²++2e- → Ni E° = -0.23 O 1.01 O 0.563 O 0.681 O 0.715

Chemistry & Chemical Reactivity

9th Edition

ISBN:9781133949640

Author:John C. Kotz, Paul M. Treichel, John Townsend, David Treichel

Publisher:John C. Kotz, Paul M. Treichel, John Townsend, David Treichel

Chapter19: Principles Of Chemical Reactivity: Electron Transfer Reactions

Section19.4: Standard Electrochemical Potentials

Problem 1RC

See similar textbooks

Similar questions

What is the standard cell potential you would obtain from a cell at 25C using an electrode in which Hg22+(aq) is in contact with mercury metal and an electrode in which an aluminum strip dips into a solution of Al3+(aq)?
It took 150. s for a current of 1.25 A to plate out 0.109 g of a metal from a solution containing its cations. Show that it is not possible for the cations to have a charge of 1+.
At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.
An electrolysis experiment is performed to determine the value of the Faraday constant (number of coulombs per mole of electrons). In this experiment, 28.8 g of gold is plated out from a AuCN solution by running an electrolytic cell for two hours with a current of 2.00 A. What is the experimental value obtained for the Faraday Constant?
A voltaic cell is constructed in which one half-cell consists of a silver wire in an aqueous solution of AgNO3.The other half cell consists of an inert platinum wire in an aqueous solution containing Fe2+(aq) and Fe3+(aq). (a) Calculate the cell potential, assuming standard conditions. (b) Write the net ionic equation for the reaction occurring in the cell. (c) Which electrode is the anode and which is the cathode? (d) If [Ag+] is 0.10 M, and [Fe2+] and [Fe3+] are both 1.0 M, what is the cell potential? Is the net cell reaction still that used in part (a)? If not, what is the net reaction under the new conditions?
Calculate the standard cell potential of the following cell at 25C. Sn(s)Sn2+(aq)I2(aq)I(aq)
Given this reaction, its standard potential, and the standard half-cell potential of 0.34 V for the Cu2+ |Cu half-cell, calculate E° for the Fe(s)|Fe2+(aq) half-cell.
Consider a galvanic cell based on the following half-reactions: a. What is the standard potential for this cell? b. A nonstandard cell is set up at 25C with [Mg2+] = 1.00 105 M. The cell potential is observed to be 4.01 V. Calculate [Au3+] in this cell.
Calculate the standard cell potential of the cell corresponding to the oxidation of oxalic acid, H2C2O4, by permanganate ion. MnO4. 5H2C2O4(aq)+2MnO4(aq)+6H+(aq)10CO2(g)+2Mn2+(aq)+8H2O(l) See Appendix C for free energies of formation: Gf for H2C2O4(aq) is 698 kJ.
An electrochemical cell consists of a silver metal electrode immersed in a solution with [Ag+] = 1.0 M separated by a porous disk from a copper metal electrode. If the copper electrode is placed in a solution of 5.0 M NH3 that is also 0.010 M in Cu(NH3)42+, what is the cell potential at 25C? Cu2+(aq)+4NH3(aq)Cu(NH3)42+(aq)K=1.01013
Consider a galvanic cell based on the following half-reactions: a. What is the expected cell potential with all components in their standard states? b. What is the oxidizing agent in the overall cell reaction? c. What substances make up the anode compartment? d. In the standard cell, in which direction do the electrons flow? e. How many electrons are transferred per unit of cell reaction? f. If this cell is set up at 25C with [Fe2+] = 2.00 104 M and [La3+] = 3.00 103 M, what is the expected cell potential?
Consider the cell described below: Zn|Zn2+(1.00M)||Cu2+(l.00M)|Cu Calculate the cell potential after the reaction has operated long enough for the [Zn2+] to have changed by 0.20 mol/L. (Assume T=25C.)