ThermodynamicsSelf Assessment 18.12 - Enhanced - with FeedbackPart AMISSED THIS? Read Section 18.10. You can click onthe Review link to access the section in your e Text.Find AGm for the reaction at this temperature.A reaction has an equilibrium constant of Kp50°C.0.246 atO -3.77 kJO -583 JO -1.64 kJO3.77 kJ

To find the ∆G°rxn for the reaction for given conditions.,

Part A 18.10. You can click on the Review link to access the section in your e Text. A reaction has an equilibrium constant of Kp 50 °C. 0.246 at Find AGm for the reaction at this temperature. O -3.77 kJ O 583 J O -1.64 kJ O 3.77 kJ

Part A 18.10. You can click on the Review link to access the section in your e Text. A reaction has an equilibrium constant of Kp 50 °C. 0.246 at Find AGm for the reaction at this temperature. O -3.77 kJ O 583 J O -1.64 kJ O 3.77 kJ

Principles of Modern Chemistry

8th Edition

ISBN:9781305079113

Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Chapter14: Chemical Equilibrium

Section: Chapter Questions

Problem 45P

See similar textbooks

Similar questions

Indicate whether each statement below is true or false. If a statement is false, rewrite it to produce a closely related statement that is true. For a given reaction, the magnitude of the equilibrium constant is independent of temperature. If there is an increase in entropy and a decrease in enthalpy when reactants in their standard states are converted to products in their standard states, the equilibrium constant for the reaction must be negative. The equilibrium constant for the reverse of a reaction is the reciprocal of the equilibrium constant for the reaction itself. For the reaction H2O2(ℓ) ⇌ H2O(ℓ) + O2(g) the equilibrium constant is one half the magnitude of the equilibrium constant for the reaction 2H2O2(ℓ) ⇌ 2H2O(ℓ) + O2(g)
1. A process is spontaneous in the direction that moves it away from equilibrium toward equilibrium
For each reaction, an equilibrium constant at 298 K is given. Calculate G for each reaction. (a) Br2()+ H2(g)2HBr(g) KP = 4.4 1018 (b) H2O()H2O(g) KP = 3.17 102 (c) N2(g) +3H2(g)2NH3(g) Kc = 3.5 108
The equilibrium constant for a certain reaction decreases from 8.84 to 3.25 102 when the temperature increases from 25C to 75C. Estimate the temperature where K = 1.00 for this reaction. Estimate the value of S for this reaction. (Hint: Manipulate the equation in Exercise 79.)
For the reaction 2Cu(s)+S(s)Cu2S(s) H and G are negative and S is positive. a At equilibrium, will reactants or products predominate? Why? b Why must the reaction system be heated in order to produce copper(I) sulfide?
5.11. Determine the numerical value of Q for the reaction conditions indicated.
Adenosine triphosphate, ATP, is used as a free-energy source by biological cells. (See the essay on page 624.) ATP hydrolyzes in the presence of enzymes to give ADP: ATP(aq)+H2O(l)ADP(aq)+H2PO4(aq);G=30.5kJ/molat25C Consider a hypothetical biochemical reaction of molecule A to give molecule B: A(aq)B(aq);G=+15.0kJ/molat25C Calculate the ratio [B]/[A] at 25C at equilibrium. Now consider this reaction coupled to the reaction for the hydrolysis of ATP: A(aq)+ATP(aq)+H2O(l)B(aq)+ADP(aq)+H2PO4(aq) If a cell maintains a high ratio of ATP to ADP and H2PO4 by continuously making ATP, the conversion of A to B can be made highly spontaneous. A characteristic value of this ratio is [ATP][ADP][H2PO4]=500 Calculate the ratio [B][A] in this case and compare it with the uncoupled reaction. Compared with the uncoupled reaction, how much larger is this ratio when coupled to the hydrolysis of ATP?
5.22. True or false: If for a gas-phase reaction, then all equilibrium partial pressures of reactants and products must equal . Explain your choice.
Define the terms product-favored System and reactant-favored System. Give one example of each.
12.108 A nuclear engineer is considering the effect of discharging waste heat from a power plant into a lake and estimates that this may warm the water locally to 25 °C. One question to be considered is the effect of this temperature change on the uptake of CO2 by the water. The equilibrium constant for the reaction CO2+H2OH2CO3 ; is K=1.7103 at 25 °C. Because bonds form, the reaction is exothermic. (a) Will this reaction progress further toward products at higher temperatures near the water discharge with its warmer water than it would in the cooler lake water? Explain your reasoning. (b) Carbonic acid has a Kaof 2.5104 at 25 °C. What is the equilibrium constant for the CO2+2H2OHCO3+H3O+? (c) What additional factor should the engineer be considering about CO2 gas, probably before considering this reaction chemistry?
Predict the temperature at which the reaction in Exercise 17.67 comes to equilibrium. Consider the equation G = H TS. At some value of T, G equals zero and the reaction is at equilibrium. Set G = 0, substitute for H and S (assuming that they do not vary much with temperature) and solve for T. CH3CHO(l)+52O2(g)2CO2(g)+2H2O(l)
For the given chemical equilibrium, these data are determined experimentally: T K 350K 3.76102 450K 1.86101 Determine H for this reaction.