One of the oldest units for atmospheric pressure is Ib in.2 (pounds per square inch, or psi). Calculate the numerical value of the standard atmosphere in these units to three significant figures. Calculate the mass in pounds of a uniform column of water 69.4 ft high having an area of 1.00 in² at its base. (Use the following data: density of mercury = 13.6 g mL-1; density of water = 1.00 g mL-1: 1 mL = 1 cm3; I lb = 454 g; 1 in. = 2.54 cm.) mass of the water column = i Ib/in?

One of the oldest units for atmospheric pressure is Ib in.2 (pounds per square inch, or psi). Calculate the numerical value of the standard atmosphere in these units to three significant figures. Calculate the mass in pounds of a uniform column of water 69.4 ft high having an area of 1.00 in² at its base. (Use the following data: density of mercury = 13.6 g mL-1; density of water = 1.00 g mL-1: 1 mL = 1 cm3; I lb = 454 g; 1 in. = 2.54 cm.) mass of the water column = i Ib/in?

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter8: Properties Of Gases

Section: Chapter Questions

Problem 103QRT

See similar textbooks

Similar questions

How does hydraulic fracturing differ from previously used techniques for the recovery of natural gas from the earth?
Given that a sample of air is made up of nitrogen, oxygen, and argon in the mole fractions 0.78 N2, 0.21 O2, and 0.010 Ar, what is the density of air at standard temperature and pressure?
Pyruvic acid, HC3H3O3, is involved in cell metabolism. It can be assayed for (that is, the amount of it determined) by using a yeast enzyme. The enzyme makes the following reaction go to completion: HC3H3O3(aq)C2H4O(aq)+CO2(g) If a sample containing pyruvic acid gives 21.2 mL of carbon dioxide gas, CO2, at 349 mmHg and 30C, how many grams of pyruvic acid are there in the sample?
You have a gas, one of the three known phosphorus-fluorine compounds (PF3, PF3, and P2F4). To find out which, you have decided to measure its molar mass. (a) First, yon determine that the density of the gas is 5.60 g/L at a pressure of 0.971 atm and a temperature of 18.2 C. Calculate the molar mass and identify the compound. (b) To check the results from part (a), you decide to measure the molar mass based on the relative rales of effusion of the unknown gas and CO2. You find that CO2 effuses at a rate of 0.050 mol/min, whereas the unknown phosphorus fluoride effuses at a rate of 0.028 mol/min. Calculate the molar mass of the unknown gas based on these results.
A balloon filled with helium gas is found to take 6 hours to deflate to 50% of its original volume. How long will it take for an identical balloon filled with the same volume of hydrogen gas (instead of helium) to decrease its volume by 50%?
A sample of a smoke stack emission was collected into a 1.25-L tank at 752 mm Hg and analyzed. The analysis showed 92% CO2, 3.6% NO, 1.2% SO2, and 4.1% H2O by mass. What is the partial pressure exerted by each gas?
A mixture contained calcium carbonate, CaCO3, and magnesium carbonate, MgCO3. A sample of this mixture weighing 7.85 g was reacted with excess hydrochloric acid. The reactions are CaCO3(g)+2HCL(aq)CaCl2(aq)+H2O(I)+CO2(g)MgCO3(s)+2HCL(aq)MgCl2(aq)+H2O(I)+CO2(g) If the sample reacted completely and produced 1.94 L of carbon dioxide, CO2, at 25C and 785 mmHg, what were the percentages of CaCO3 and MgCO3 in the mixture?
If the rms speed of He atoms in the exosphere (highest region of the atmosphere) is 3.53 103 m/s, what is the temperature (in kelvins)?
A student prepares phosphorous acid, H3PO3, by reacting solid phosphorus triiodide with water. PI3(s)+3H2O(l)H3PO3(s)+3HI(g) The student needs to obtain 0.250 L of H3PO3(d=1.651g/cm3). The procedure calls for a 45.0% excess of water and a yield of 75.0%. How much phosphorus triiodide should be weighed out? What volume of water (d=1.651g/cm3) should be used?
109 An ore sample with a mass of 670 kg contains 27.7% magnesium carbonate, MgCO3. If all of the magnesium carbonate in this ore sample is decomposed to form carbon dioxide, describe how to determine what volume of CO2 is evolved during the process. What would have to be measured to predict the needed volume in advance?
At elevated temperatures, sodium chlorate decomposes to produce sodium chloride and oxygen gas. A 0.8765-g sample of impure sodium chlorate was heated until the production of oxygen gas ceased. The oxygen gas collected over water occupied 57.2 mL at a temperature of 22C and a pressure of 734 torr. Calculate the mass percent of NaClO3 in the original sample. (At 22C the vapor pressure of water is 19.8 torr.)
Plot the data given in Table 5.3 for oxygen at 0C to obtain an accurate molar mass for O2. To do this, calculate a value of the molar mass at each of the given pressures from the ideal gas law (we will call this the apparent molar mass at this pressure). On a graph show the apparent molar mass versus the pressure and extrapolate to find the molar mass at zero pressure. Because the ideal gas law is most accurate at low pressures, this extrapolation will give an accurate value for the molar mass. What is the accurate molar mass?