Methylated spirit is a useful product made from a mixture of substances. The table below shows the mass of the substances in a sample of methylated spirit. Substance Ethanol Methanol Pyridine Methyl violet Mass in grams 265.5 23.3 3.0 1.5

Methylated spirit is a useful product made from a mixture of substances. The table below shows the mass of the substances in a sample of methylated spirit. Substance Ethanol Methanol Pyridine Methyl violet Mass in grams 265.5 23.3 3.0 1.5

World of Chemistry, 3rd edition

3rd Edition

ISBN:9781133109655

Author:Steven S. Zumdahl, Susan L. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan L. Zumdahl, Donald J. DeCoste

Chapter15: Solutions

Section: Chapter Questions

Problem 2A

See similar textbooks

Similar questions

The meat from one hazelnut has a mass of 0.985 g. (a) What is the mass of a millionth of a mole (106) of hazelnut meats? (A millionth of a mole is also called a micromole.) (b) How many moles are in a pound of hazelnut meats?
If baking soda (sodium hydrogen carbonate) is heated strongly, the following reaction occurs: :math>2NaHCO3(s)Na2CO3(s)+H2O(g)+CO2(g) lculate the mass of sodium carbonate that will remain if a 1.52-g sample of sodium hydrogen carbonate is heated.
itamin B12 , cyancobalamin, is essential for human nutrition. Its molecular formula is C63H88CoN14O14P . A lack of this vita min in the diet can lead to anemia. Cyanocohalamin is the form of the vitamin found in vitamin supplements. l type='a'> What is the molar mass of cyanocobalamin to two decimal places? How many moles of cyanocohalamin molecules are present in 250 mg of cyanocobalamin? What is the mass of 0.60 mole of cyanocobalamin? How many atoms of hydrogen are in 1 .0 mole of cyanocobalamin? What is the mass of 1.0107 molecules of cyanocobalamin? What is the mass (in grams) of one molecule of cyanocobalamin?
An experiment is conducted in which varying amounts of solid iron are added to a fixed volume of liquid bromine. The product of the reaction is a single compound, which can be separated from the product mixture and weighed. The graph shows the relationship between the mass of iron in each trail versus the mass of the product compound. Explain why the group has a positive slope for low masses of iron and a zero slope when the mass of iron added becomes larger.
Write the balanced chemical equation for the complete combustion of adipic acid, an organic acid containing 49.31% C, 6.90% H, and the remainder O, by mass.
The active ingredient in aspirin is acetylsalicylic acid, which has the chemical formula C9H8O4. An aspirin pill contains 300.0 mg of acetylsalicylic acid. How many moles of acetylsalicylic acid does it contain?
Sulfur dioxide gas reacts with sodium hydroxide to form sodium sulfite and water. The unbalanced chemical equation for this reaction is given below: SO2(g)+NaOH(s)Na2SO3(s)+H2O(l) Assuming you react 38.3 g sulfur dioxide with 32.8 g sodium hydroxide and assuming that the reaction goes to completion, calculate the mass of each product formed.
The reaction of an element X() with element Y() is represented in the following diagram. Which of the elements bestdescribes this reaction? mg src=Images/HTML_99425-6-16ALQ_image001.jpg alt="" align="top"/> msp;3X+6YX3Y8 msp;3X+6YX3Y6 msp;X+2YXY2 msp;3X+8Y3XY2+2Y
What is true about the chemical properties of the product? a. The properties are more like chemical A. b. The properties are more like chemical B. c. The properties are an average of those of chemical A and chemical B. d. The properties are not necessarily like either chemical A or chemical B. e. The properties arc more like chemical A or more like chemical B, but more information is needed. Justify your choice, and for choices you did not pick, explain what is wrong with them.
or each of the following reactions, give the balanced chemical equation for the reaction and state the meaning of the equation in terms of individual molecules and in terms of moles of molecules. msp;MnO2(s)+Al(s)Mn(s)+Al2O3(s) msp;B2O3(s)+CaF2(s)BF3(g)+CaO(s) msp;NO2(g)+H2O(l)HNO3(aq)+NO(g) msp;C6H2(g)+H2C6(g)H12(g)
Alkali metal hydroxides are sometimes used to “scrub” excess carbon dioxide from the air in closed spaces (such as submarines and spacecraft). For example, lithium hydroxide reacts with carbon dioxide according to the unbalanced chemical equation :math>LiOH(s)+CO2(g)Li2CO3(s)+H2O(g) ppose a lithium hydroxide canister contains 155 g of LiOH(s). What mass of CO2(g)will the canister be able to absorb? If it is found that after 24 hours of use the canister has absorbed 102 g of carbon dioxide, what percentage of its capacity has been reached?
A possible practical way to eliminate oxides of nitrogen(such as NO2 ) from automobile exhaust gases uses cyanuricacid, C3N3(OH)3 . When heated to the relatively lowtemperature of 625°F, cyanuric acid converts to gaseousisocyanic acid (HNCO). Isocyanic acid reacts with NO2 inthe exhaust to form nitrogen, carbon dioxide, and water,all of which are normal constituents of the air. (a) Write balanced equations for these two reactions. (b) If the process described earlier became practical, howmuch cyanuric acid (in kilograms) would be requiredto absorb the 1.71010kgNO2 generated annuallyin auto exhaust in the United States?