Indicate the correct answer. The abundance of silica and silicates in nature is justified bya) the high stability of the monomers that form it.b) the sp3 hybridization of silicon.c) None of the answers is correct.

Indicate the correct answer. The abundance of silica and silicates in nature is justified bya) the high stability of the monomers that form it.b) the sp3 hybridization of silicon.c) None of the answers is correct.

Chemistry: Principles and Practice

3rd Edition

ISBN:9780534420123

Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Publisher:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Chapter20: Chemistry Of Hydrogen, Elements In Group 3a Through 6a, And The Noble Gases

Section: Chapter Questions

Problem 20.70QE

See similar textbooks

Related questions

Q: What are the frequencies and their corresponding functional groups that would indicate the reaction…

A: Absence of alkene peak that is around 1640-1680 for isolated alkene. Presence of alkyne peak that is…

Q: 4.1 An unknown compound has the formula C6H12O. Elucidate the structure of the molecule by…

Q: Can you please show how to calculate bond order for both carbonyls. I know carbonyl A has a bond…

Q: Please correct answer and don't use hand rating

A: To determine the stability of each molecule at pH = 11, we need to consider if each functional…

Q: Draw the Lewis structure, including all lone pairs and non-zero formal charges, for the molecule…

A: Step 1: Calculate the total valence electronsAtomValence Electrons# of AtomsCl71F75Total7(1) + 7(5)…

Q: Need help analyzing this CNMR. I know the molecular formula is C11H14O2. The far left line is the…

A: Approach to solving the question:Let's analyze the 13 C NMR spectrum of the compound based on the…

Q: Please correct answer and don't use hand raiting

Q: D Question 2 atio... IEP Direct Read180 Student A... Read180 Teacher A... K Kahoot! copy 0.4 pts For…

Q: Draw the major product of the Claisen condensation reaction between two molecules of this ester.…

A: Two expected mechanism are given:ask if you need further clarification.

Q: Curved arrows are used to illustrate the flow of electrons. Use the reaction conditions provided and…

Q: 4. Drawing Substituted Chairs and Chair Flips (a) For the molecule below (cyclohexanol), on each…

Q: Can you provide steps and explanations? When to use each reagents? Can you provide examples?…

A: Step 1: Propyne on reaction excess Bromine, undergoes addition reaction forming…

Q: Please correct answer and don't use hand raiting

A: Problem: Consider the combustion of acetylene gas.a) Predict the signs of ΔH and ΔS.b) Calculate…

Q: 1) Anisole is an aromatic ether that is a liquid at room temperature. a) Draw a different molecule…

A: For part a) I've replaced the -OCH₃ group with a -COOH group to create benzoic acid. Explanation:…

Q: 4x zoom 24 Help reading a burette 25 25 26 Sample site B Final reading (cm³) Initial reading (cm³)…

A: Reading a burette tells you the amount of reagent that has been dispensed. In reading one, look at…

Q: Given the information below, calculate the voltage the cell.Cu(s) | Cu2+ (0.50 M) || I- (0.30 M) |…

A: To calculate the cell voltage (Ecell), we need to use the Nernst equation to account for the…

Q: 5% Sn1 reaction rates 5) List the following alkyl halides in order of their increasing reactivity as…

A: Approach to solving the question: As we know, the reactivity order of alkyl halide in SN1…

Q: Physical Properties of Alkyl Halides (polarity, polarizability, high density) Explain…

A: Step 1: Physical Properties of Alkyl HalidesPolarity: Alkyl halides are polar molecules due to the…

Q: What is B and C? Can you show mechanism steps

A: The side chain or the alkyl group has been considered as "R" while drawing the mechanism for better…

Q: If the split vent flow is 110 mL/min for this column, what is the split ratio? when average linear…

A: I hope this is helpful.

Q: < 4. Copper(II) nitrate and sodium phosphate react to form a precipitate. a. Complete and balance…

A: When copper (II) nitrate (Cu(NO3)2) and sodium phosphate (Na3PO4) react with each other, a double…

Q: 6.16: In addition to solving the problem please give brief explanation for concepts and solution if…

Q: jrj

Q: Please correct answer and don't use hand raiting

A: Step 1: Guidelines for IUPAC nomenclature of organic compounds:Consider the carbon chain with the…

Q: Question 15: Drag the words into the correct boxes The element oxidized is The element reduced is…

A: Explanation:The given reaction involves the oxidation of iron (Fe) by nitric acid (HNO₃).Here's a…

Q: Classify each of the molecules below. OH OH OH HO 01° alcohol 2° alcohol ○ 1° alcohol 1° alcohol 2°…

A: Thank you.

Q: Please correct answer and don't use hand raiting

A: An uncompetitive inhibitor binds only to the enzyme-substrate complex, which leads to a decrease in…

Q: Choose from the following list of reagents and assign the correct to the correct letter: (1) x.s.…

Q: 4. (10 points) a) Place the following compounds in order of INCREASING acidity. A) OH B) NO2 LOH OH…

Q: Please correct answer and don't use hand raiting

A: Explanation for Question 1Labelling the Reaction Diagram:I (Reactants): This represents the starting…

Q: What are the products of theses reactions. Please draw the mechanism for the reactions.

A: Step 1: Step 2: Step 3: Step 4:

Q: 1. Consider the following statement: Electric current is the consequence of the movement of charged…

A: 1. NaCl crystals will not glow if sodium chloride is added. Inorder to have conductivity there…

Q: Consider the following chemical equation

A: Step 1: To answer these questions, first we have to balance the chemical reaction. a. The molecular…

Q: 1.45 Let z = x/y3. Evaluate the four second partial deriva- tives of z, check that a2z/(dx dy) =…

Q: Please correct answer and don't use hand raiting

A: To solve this problem, let's go through the steps one by one. 1. Calculate the Internal Energy…

Q: A 40-year-old man in the U.S. has a 0.24% risk of dying during the next year. An insurance company…

A: Step 1:The probability of the risk of dying is 0.24% or 0.0024.An insurance company charges $260…

Q: Write the systematic (IUPAC) name for each of the following organic molecules: structure…

A: Here are the IUPAC names for the compounds you provided: CH3-CH2-CH2-CH2-CH2-CH2-CH(SH)-CH3 IUPAC…

Q: 2 3 X = Cl or Br Compound 1 will react faster than Compound 2 in the AgNO3/ethanol test. Compound 2…

A: Approach to solving the question: Detailed explanation: Key references. Clayden

Q: For the following organic reaction identify the mystery reactant R, its stoichiometric coefficient…

A: Thank you.

Q: Please correct answer and don't use hand raiting

A: NoteNaBH4 is a mild reducing agent that selectively reduces aldehydes and ketones to alcohols. It…

Q: a. Fe(CN)6³ b. Fe(CN)64 Which compound would have the largest value of Ao? the ligand CN as here,…

A: The question is asking which compound has the largest value of (Δ0), which is the crystal field…

Q: A solution containing Cl- was analyzed as follows in a back titration. A solution containing…

A: Given: Concentration of AgNO3 = 0.01840 M = 0.01840 mol/L ( 4 significant…

Q: Show work with explanation needed . don't give Ai generated solution

A: Step 1:The organic compounds have same molecular formula and having different bonding connectivity…

Q: Write the systematic (IUPAC) name for each of the following organic molecules: structure CH3CH2CH,…

A: Identify the longest carbon chainNumbering the chain:Start numbering from the end that gives the…

Q: Pls help ASAP on all pls show all work and steps.

A: Solution 21:Part (a) Calculation:Step 1. Determine the moles of glucose:293 g of sugar, assumed to…

Q: Calculate the spin-only magnetic moment for the following ions: a. V³+ b. Fe3+ c. Mn2+ d. Co²+ e.…

A: Step 1:Step 2: Step 3: Step 4:

Q: Please correct answer and don't use hand raiting

A: In this scenario, let's analyze the guidelines given for preparing unknown samples with SCN⁻…

Q: 0+ 4000 A B RAVENEER NN 8.19 6.74 6.00 5.00 4.00 9.87 7.66 3.00 2.00 Peak A (3171 cm-1) = Peak B…

A: If you have any confusion related to any signal, you can ask!

Q: Which of the following is not a factor when predicting Ao? a. Oxidation state of the metal b.…

Q: Figure 1 shows the pH curve for the titration of 25.0 mL of a 0.10 M solution of acetic acid,…

A: In the titration of a weak acid, the measurements needed include the initial concentration and…

Question

100%

Indicate the correct answer. The abundance of silica and silicates in nature is justified by
a) the high stability of the monomers that form it.
b) the sp³ hybridization of silicon.
c) None of the answers is correct.

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Similar questions

The abundance of silica and silicates in nature is justified bya) the sp3 hybridization of silicon.b) the high stability of the monomers that form it.c) None of the answers.
Indicate the correct answer. Silicon combines with oxygen to form the silicate anion thanks toa) its 2s and 2p3 atomic orbitals.b) four sp3 hybrid orbitals.c) the s atomic orbital and three p3 hybrid orbitals.d) four dsp2 hybrid orbitals.
Why is Br3SiH distorted from the expected 109.5o tetrahedral bond angle, while SiBr4 is not?
The following figures represent the binary hydrides of the elements of the second period of the p block. A) Identify the different hydrogen atom in each case and write the molecular formula of each hydride. Explain your answer. B) Perform step-by-step hybridization for each one.
Draw the structural formula of bis(dimethylglyoximato)nickel(1I) and describe the type of hybridization involved ?
it Inbox (1,600)-ftantill@udeledu x → C 88¹F Mostly sunny app.101edu.co 2 S Mail- Francesca A Tanbillo-Out # 3 E S C $ 4 Question 18.g of 23 Silane, SiH, is a colorless, pyrophoric, toxic gas that is used to deposit elemental silicon for semiconductor and photovoltaic applications. Based on its tetrahedral molecular geometry, is the molecule polar? R F Homepage - CHM150-251 Chen X V DII A) Yes, the molecule is polar. B) No, the molecule is not polar. C) Depending of how the atoms are connected, the molecule can be polar or nonpolar. % 5 T G 8 A 6 B Aktiv Chemistry Y H * F7 & 7 U N PrtScn J 8 + 1 N Home M ( K 9 End 0 L PgUp P PgDn12 □ O 90 + M O Update Submit X + 7:30 PM D 7/6/2022 BA Del Backspace 800
use VESPR theory to predict the molecular geometry of SiF4, SiF5- and (SiF6)2- (show lone pair electrons on the silicon atom). what is the hybridization, oxidation state and formal charge of the silicon in these molecules /ions?
Draw a Lewis structure for diimide, H-N=N-H, explain how the Lewis structure is drawn. Then, using valence bond theory, describe the bonding in this compound. What orbitals overlap to form the bond between nitrogen atoms in this compound? Explain and elaborate.
What is the molecular geometry of the PF4^+ (15P & 9F). Explain your answer briefly
1A2: Define electron pair domain (EPD), count EPDS on building blocks, and use EPD knowledge to determine 3D geometry and bond angles of a tetrahedral, trigonal planar, linear building block. For the indicated atoms (look for the arrows) in each of the given structures: (a) state how many EPDs are present; (b) Label tetrahedral atoms with "TET," trigonal planar atoms with "TP," and linear atoms with "LIN;" (c) Identify one (1) indicated atom in each structure for which resonance structures bring a change in the number of EPDs from 4++3/3+4 or 3+2/2+3. A resonance structure must be reported to justify your reported EPD changes. H₂C CH3 --С HO 1 Br -CH3 CH3 CI H₂C N CH3 CH3 он о
Sketch the three-dimensional structure of the Hydrogen carbonate ion. Clearly indicate the electronic geometry, the shape of the species, and expected bond angles around both central atoms.
. Give the hybridization and oxidation state for sulfur in SO2, in SO3, and in H2SO4. And draw the Lewis structures to determine the hybridization