Please help me quickly In the wurtzite structure of ZnS, the compound is said to be:ed45Select one:O (4,4) coordinationO (8,8) coordinationO (4,8) coordinationO (6,6) coordination

Answered: Image /qna-images/answer/8b3b1cb1-7b0c-4159-989c-2099f90315eb.jpg

Answered: In the wurtzite structure of ZnS, the…

In the wurtzite structure of ZnS, the compound is said to be : Select one: O (4,4) coordination O (8,8) coordination O (4,8) coordination O (6,6) coordination

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter21: Transition Metals And Coordination Chemistry

Section: Chapter Questions

Problem 87AE: Carbon monoxide is toxic because it binds more strongly to iron in hemoglobin (Hb) than does O2....

See similar textbooks

Similar questions

A coordination compound of cobalt(III) contains four ammonia molecules, one sulfate ion, and one chloride ion. Addition of aqueous BaCl2 solution to an aqueous solution of the compound gives no precipitate. Addition of aqueous AgNO3 to an aqueous solution of the compound produces a white precipitate. Propose a structure for this coordination compound.
Trimethylphosphine, P(CH3)3, can act as a ligand by donating the lone pair of electrons on the phosphorus atom. If trimethylphosphine is added to a solution of nickel(Il) chloride in acetone, a blue compound that has a molecular mass of approximately 270 g and contains 21.5% Ni, 26.0% Cl, and 52.5% P(CH3)3 can be isolated. This blue compound does not have any isomeric forms. What are the geometry and molecular formula of the blue compound?
Indicate the coordination number for the central metal atom in each of the following coordination compounds: (a) [Pt(H2O)2Br2]. (b) [Pt(NH3)(py)(Cl)(Br)] (py = pyridine, C5H5N). (c) [Zn(NH3)2Cl]. (d) [Zn(NH3)(py)(Cl)(Br)]. (e) [Ni(H2O)4Cl2]. (f) [Fe(en)2(CN)2]+ (en = ethylenediamine, C2H8N2)
a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
Consider the octahedral complex [FeBr6] 4−. In water solution it has an absorption peak at 864 nm with a molar absorptivity (ε) of 3.6 L mol-1 cm-1 . (a) What is the energy (in wavenumbers, cm-1 ) of the absorption peak? Show all work
What is the crystal field electron configuration of the [Mn(NCS)6]4- complex with a magnetic moment of 6.06 B.M.? (25Mn)
Consider the coordination compound [FeCl₂(NH3)4][FeBr4]. Which of the following is a coordination isomer of the given compound? O [FeBr₂(NH3)4][FeCl4] O [FeBr2(NH3)4][FeBr₂Cl₂] O [FeBrCl(NH3)4][FeBrCl3] O [FeCl₂(NH3)4][FeBr₂Cl₂]
Kk59.
Two coordination sphere isomers for MnCl3(CN)3
Determine the d electron configurationof [OsCl6]3-complex. A) (t2g)4(eg)2 B) (t2g)5(eg)0 C) (t2g)3(eg)2 D) (t2g)3(eg)0 E) (t2g)3(eg)1
Which of the following pairs are coordination isomers? a. [Pt Br2Cl2(H20)2]CO3 and [PtBr2Cl2]CO3 2H20 b. [Cr(H,0)a][PtCla] and [PtCl,(H,0)2][C•CI,(H,0)2] C. None of the choices |d. [PtCl4(H2O)2]Cl2 and [PtCl3(H20)2]Cl3
Consider the octahedral complex [FeBr6] 4−. In water solution it has an absorption peak at 864 nm with a molar absorptivity (ε) of 3.6 L mol-1 cm-1 . (I have a, b, and c, I need help with d, e, and f.) (a) What is the energy (in wavenumbers, cm-1 ) of the absorption peak? Show all work. (b) How many valence d electrons does the metal center have? Justify your answer. (c) How many unpaired electrons per molecule would a magnetic susceptibility experiment predict? What would the S number be for this transition metal center? Justify your answers. (d) What electronic transition results from absorption of 864-nm light? (e) Calculate the ligand stabilization energy (in units of ∆o) and units of coulombic (Πc) energy. (f) How would the ligand field strengths (∆o) of [Fe(NH3)6] 2+ and [Fe(bipy)3] 2+ differ from that of [FeBr6] 4−? Why?