In an investigation, 256g SO, react with 80g o, in a reaction vessel. The contact process is given by the equation below. SO O SO 1. Balance the chemical equation ii. Calculate the number of moles of each reactant present at the start of the reaction. i. Identify the limiting reagent in the reactant and justify your answer. iv. Calculate the mass of SO, produced in the reaction.

In an investigation, 256g SO, react with 80g o, in a reaction vessel. The contact process is given by the equation below. SO O SO 1. Balance the chemical equation ii. Calculate the number of moles of each reactant present at the start of the reaction. i. Identify the limiting reagent in the reactant and justify your answer. iv. Calculate the mass of SO, produced in the reaction.

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Similar questions

Consider the combustion of an alcohol:C3H8O(l) + O2(g) → CO2(g) + H2O(g)a. Balance the chemical equationb. How many moles of CO2 can be formed from 3.68moles of the alcohol?c. How many moles of O2 are required to react with 0.931moles of the alcohol?d. What is the maximum number of moles of CO2 that can be formed from a mixture of 1.81moles of the alcohol and 7.43moles of O2
1. A mixture of hydrazine (N2H4) and hydrogen peroxide (producing nitrogen and water) is used as a fuel for rocket engines. A. Write the valid chemical equation. B. What mass of N2H4, in grams, is needed to react completely with 35.0 g of H2O2? When, H= 1.01g. O=16.00g. N=14.01g.
Which of the following statements is NOT correct about the limiting reagent of a reaction? A. The limiting reagent is the reagent that leads to the least amount of product forming. B. The limiting reagent should be completely consumed in a reaction. C. To confirm which reagent is limiting, one must consider the balanced chemical equation for the reaction. D. The moles of the limiting reagent determines the moles of product that can form. E. The limiting reagent is always the reagent with the fewest moles measured out.
One important factor in any chemical synthesis is the actual quantity of desired product obtained compared to the theoretical amount predicted on the basis of the stoichiometry of the reaction. The ratio of the mass of product obtained to the theoretical quantity, expressed as a percentage, is referred to as the "percent yield" or more simply the "yield". For example: if we react HCl with excess NaOH one of the products will be NaCl. If we assume that all of the Cl in HCl ends up as NaCl we know that each mole of HCl consumed should produce a mole of NaCl product. Suppose that in a particular reaction 11.7 grams of HCl (36.5 g/mol) react with excess NaOH and 17.5 grams of NaCl (58.5 g/mol) are isolated from the reaction mixture by crystallization. What is the percent yield of NaCl in the experiement?
3. In a neutralization reaction, 50.00 mL of 0.750 M phosphoric acid reacts with 2.500 g of magnesium hydroxide producing magnesium phosphate and water. Write a balanced equation for the reaction. b. What is the limiting reactant? C. How much of the excess reactant remains after the limiting reactant is completely consumed? d. What is the theoretical yield of magnesium phosphate (in grams)? e. If 2.552 g of magnesium phosphate are produced in an experiment, then what is the percent yield? a. lected
A small fire breaks out at the accident scene. You notice that the source is a compound with the formula CgH6. You also know that the combustion reaction requires O2 and produced carbon dioxide and water. Choose the correctly balanced reaction for CgH6. C8H6+1908CO₂ + 3H₂O 2C8H6+ 1902 16CO2 + 6H₂O C8H6+19/2 02 → 8CO2 + 3H₂O C8H6+902 8CO₂ + 3H₂O
Magnesium oxide can be made by heating magnesium metal in the presence of the oxygen. The balanced equation for the reaction is 2Mg(s)+O2(g)→2MgO(s) When 10.0 g Mg is allowed to react with 10.5 g O2, 11.8 gMgO is collected. 1. Determine the theoretical yield for the reaction. 2. Determine the percent yield for the reaction.
Consider the generic chemical equation: 2 A + 4 B --------> 3 C 1. If 10.0 moles of each reactant were used to complete that reaction, which of the following is true. a. A is the limiting reactant and 15.0 moles of C will be produced. b. A is the limiting reactant and 20.0 moles of C will be produced. c. B is the limiting reactant and 7.50 moles of C will be produced. d. B is the limiting reactant and 22.5 moles of C will be produced. 2. What is the percent yield of this reaction if 6.40 moles of C were actually produced?
Iron oxide reacts with carbon to produce elemental iron and carbon monoxide according the the equation shown below. Consider the reaction of 51.4 grams of Fe2O3 with 24.98 grams of C to produce 19.20 grams of Fe. Fe2O3(s)+3c(s)-------2Fe(s)+3CO(g) a. actual yield b. theoretical yield c. percent yield
61. Consider the reaction between calcium oxide and carbon dioxide: CaO(s) + CO2(g) →→ CaCO3(s) A chemist allows 14.4 g of CaO and 13.8 g of CO₂ to react. When the reaction is finished, the chemist collects 19.4 g of CaCO3. Determine the limiting reactant, theoretical yield, and percent yield for the reaction.
given the chemical equation Zn+2HCl->ZnCl2+H2 how many molecules of H2 will be produced if 19 Atoms of ZN are consumed in the reaction
Given the reaction CH 4 + 2O 2 ----------> 2H 2O + CO 2 which statement is FALSE? 16 g O2 reacts to form 18 g H2O 16 g CH4 combines with 64 g O2 1 mol CO2 is formed from 2 mol O2 1 mol CH4 reacts to form 2 mol H2O 18 g H2O is produced from 1 mol O2