Constants Periodic Table.. L n gH2O(1) + CC4 (1)→COCl2 (g) + 2HCI(g)You can use the following table of standard heats of formation (AH;) to calculate the enthalpy of the givenreaction.Standard Heat ofFormation (kJ/mol)Standard Heat ofElement/ CompoundElement/ CompoundFormation (kJ/mol)H(g)218N(g)473H2 (g)O2(g)0.CC4 (1)-139.5O(g)249H2O(1)-285.8HC1(g)-92.30kJareC(g)71COC2 (g)-218.8kJC(s)HNO3 (aq)-206.6Express the standard enthalpy of reaction to three significant figures and include the appropriate units.View Available Hint/s)O 1 1:31 Standard Enthalpy of Reaction33 of 42Learning Goal:To understand how standard enthalpy of reaction isrelated to the standard heats of formation of thereactants and products.Constants Periodic TableIn a generic chemical reaction involving reactants A and B and products C and D, aA + bB-cC + dD, thestandard enthalpy AHn of the reaction is given byThe standard enthalpy of reaction is the enthalpychange that occurs in a reaction when all thereactants and products are in their standard states.The symbol for the standard enthalpy of reaction isAHn, where the subscript "rxn" stands for"reaction." The standard enthalpy of a reaction iscalculated from the standard heats of formation (AH) (subscript "f" for formation) of its reactantsand products. Therefore, the standard enthalpyAHn of any reaction can be mathematicallydetermined, as long as the standard heats offormation (AH:) of its reactants and products areAH = cAH¿ (C) + dAH; (D) -aAH; (A) – bAH (B)Notice that the stoichiometric coefficients, a, b, c, d, are an important part of this equation. This formula is oftengeneralized as follows, where the first sum on the right-hand side of the equation is a sum over the products andthe second sum is over the reactants:AHn =Eoroducts nAH – Eactants mAHwhere m and n represent the appropriate stoichiometric coefficients for each substance.known.Part AWhat is AHn for the followingtion?AssignmentsP i 1:30

The reaction taking place is given as, And the standard heat of formation data given is,

In a generic chemical reaction involving reactants A and B and products C and D, aA + 6B+cC + dD, the standard enthalpy AHn of the reaction is given by AH = cAH; (C) + dAH; (D) –aAH (A) - bAH (B) Notice that the stoichiometric coefficients, a, b, c, d, are an important part of this equation. This formula is often generalized as follows, where the first sum on the right-hand side of the equation is a sum over the products and the second sum is over the reactants: AHn = Eproducts nAH - Ectants mAH %3D where m and n represent the appropriate stoichiometric coefficients for each substance. Part A What is AHn for the following ion? Assignments 1:30

In a generic chemical reaction involving reactants A and B and products C and D, aA + 6B+cC + dD, the standard enthalpy AHn of the reaction is given by AH = cAH; (C) + dAH; (D) –aAH (A) - bAH (B) Notice that the stoichiometric coefficients, a, b, c, d, are an important part of this equation. This formula is often generalized as follows, where the first sum on the right-hand side of the equation is a sum over the products and the second sum is over the reactants: AHn = Eproducts nAH - Ectants mAH %3D where m and n represent the appropriate stoichiometric coefficients for each substance. Part A What is AHn for the following ion? Assignments 1:30

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Similar questions

Find the enthalpy of reaction for the equation: H2SO4laq) + 2NAOH(aq)-Na,SO,(aq) + 2H20(), AH=? Using the following equations whose enthalpy is known (please round your answer to the tenths place): H2(g) + S(s) + 202(g) – H2SO,(aq), AH= -907.5 kJ Na(s)+ ½H2(g) + ½O2{g) – NaOH(aq), AH= -469.6 kJ 2Na(s) + S(s) + 20,(g) – Na,SOal(aq). AH= -1387.1 kJ H2(8) + ½O2(g) – H2O(1). AH= -285.8 kJ AH= kJ.
Please help me decipher what I'm doing wrong in this problem I think I may have switched factors or added unnecessary factors.
The enthalpy of combustion and the standard enthalpy of formation of a fuel can be determined by measuring the temperature change in a calorimeter when a weighed amount of the fuel is burned in oxygen. (a) Write a balanced chemical equation for the combus- tion of isooctane, C3H18(€), to CO2(g) and H2O(€). Isooctane is a component of gasoline and is used as a reference standard in determining the “octane rating" of a fuel mixture. (b) Suppose 0.542 g isooctane is placed in a fixed-volume (bomb) calorimeter, which contains 750 g water, ini- tially at 20.450°C, surrounding the reaction compart- ment. The heat capacity of the calorimeter itself (excluding the water) has been measured to be 48 J K-1 in a separate calibration. After the combustion of the isooctane is complete, the water temperature is mea- sured to be 28.670°C. Taking the specific he: to be 4.184 J K-1g¬!, calculate AU for the combustion of 0.542 g isooctane. (c) Calculate AU for the combustion of 1 mol isooctane. (d)…
Gypsum is the hydrate of calcium sulfate, CaSO4 · 2 H2O. It is the primary material in sheet rock, used to make walls in houses. If you heat 21.05 g of the hydrate and drive off the water, what is the weight of the anhydrous salt remaining? Report your response to the proper degree of certainty and include the correct unit symbol (i.e., g, mL, km, etc.).
(b) An aqueous solution of acetic acid can be prepared by the reaction of ethanol with oxygen : CH3CH2OH (1) + O2 (g) –→ CH3COOH (1) + H2O (1) Write thermochemical equations for enthalpy of formation of the given compounds and calculate AH for the reaction, given the following data. Enthalpy of formation, AHf (kJmol") -277.8 Compound CH;CH2OH (1) CH3COOH (I) H2O (1) -485.0 -286.0
C2H5OH(l)+3O2(g)=2CO2(g)+3H2O(l) The reaction enthalpy for standard conditions. I got the answer of -1,367 is this correct?
Q5.
the standard heat of formation of lead nitrate corresponds to the reaction
The enthalpy changes, AH, for three reactions are given. H, (g) + H, O(1) AH= -286 kJ/mol Ca(s) + 2 H*(aq) Ca2+(aq) + H, (g) Ca+(aq) + H, O(1) AH = -544 kJ/mol CaO(s) + 2 H*(aq) AH = -193 kJ/mol Using Hess's law, calculate the heat of formation for CaO(s) using the reaction shown. Ca(s) + O,(g) CaO(s) AH kJ/mol
3.58
A critical reaction in the production of energy to do work or drive chemical reactions in biological systems is the hydrolysis of adenosine triphosphate, ATP, to adenosine diphosphate, ADP, as described by the reaction АТР(аq) + H,О() — ADP(aq) + НРО (аq) ADP(aq) + HPO (aq) for which AGixn = -30.5 kJ/mol at 37.0 °C and pH 7.0. Calculate the value of AGrxn in a biological cell in which [ATP] = 5.0 mM, [ADP] = 0.40 mM, and [HPO;-] = 5.0 mM. AGrxn kJ/mol * TOOLS x10 Is the hydrolysis of ATP spontaneous under these conditions? yes no
15. Using the standard enthalpies of formation for the chemicals involved, calculate the enthalpy change for the following reaction. (Note: Show the math clearly and provide units in your setup) (AH; Values in kJ/mol are as follows: NO, +32, H,0 -286, HNO3 -207, NO +90) 3NO2(8) + H,Oy O 2HNO3(aq) + NO(g) (g),