Answered: If the AH = 149 kJ/mol and AS = 130 J/K…

If the AH = 149 kJ/mol and AS = 130 J/K mol, at what temperature does this reaction become spontaneous? Your Answer: Answer units

Chemistry for Engineering Students

4th Edition

ISBN:9781337398909

Author:Lawrence S. Brown, Tom Holme

Publisher:Lawrence S. Brown, Tom Holme

Chapter10: Entropy And The Second Law Of Thermodynamics

Section: Chapter Questions

Problem 10.50PAE: For the reaction NO(g)+NO2(g)N2O3(g) , use tabulated thermodynamic data to calculate H and S. Then...

See similar textbooks

Similar questions

Two crystalline forms of white phosphorus are known. Both forms contain P4 molecules, but the molecules are packed together in different ways. The form is always obtained when the liquid freezes. However, below 76.9C, the form spontaneously converts to the form: P4(s,)P4(s,) a. Predict the signs of H and S for this process. b. Predict which form of phosphorus has the more ordered crystalline structure (has the smaller positional probability).
Thermodynamics provides a way to interpret everyday occurrences. If you live in northern climates, one common experience is that during early winter, snow falls but then melts when it hits the ground. Both the formation and the melting happen spontaneously. How can thermodynamics explain both of these seemingly opposed events?
How does the second law of thermodynamics explain a spontaneous change in a system that becomes more ordered when that process is exothermic?
What happens to the entropy of the universe during a spontaneous process?
How is the sign of q, heat, defined? How does it relate to the total energy of the system?
One statement of the second law of thermodynamics is that heat cannot be turned completely into work. Another is that the entropy of the universe always increases. How are these two statements related?
Nickel metal reacts with carbon monoxide to form tetra-carbonyl nickel, Ni(CO)4: Ni(s)+4CO(g)Ni(CO)4(g) This reaction is exploited in the Mond process in order to separate pure nickel from other metals. The reaction above separates nickel from impurities by dissolving it into the gas phase. Conditions are then changed so that the reaction runs in the opposite direction to recover the purified metal. (a) Predict the sign of S for the reaction as written above. (b) Use tabulated thermodynamic data to calculate H, S , and G for the reaction. (c) Find the range of temperatures at which this reaction is spontaneous in the forward direction.
Define the following: a. spontaneous process b. entropy c. positional probability d. system e. surroundings f. universe
Ethanol burns in air or oxygen according to the equation C2H5OH(l)+3O2(g)2CO2(g)+3H2O(g) Predict the sign of S for this reaction.
Coal is used as a fuel in some electric-generating plants. Coal is a complex material, but for simplicity we may consider it to be a form of carbon. The energy that can be derived from a fuel is sometimes compared with the enthalpy of the combustion reaction: C(s)+O2(g)CO2(g) Calculate the standard enthalpy change for this reaction at 25C. Actually, only a fraction of the heat from this reaction is available to produce electric energy. In electric generating plants, this reaction is used to generate heat for a steam engine, which turns the generator. Basically the steam engine is a type of heat engine in which steam enters the engine at high temperature (Th), work is done, and the steam then exits at a lower temperature (Tl). The maximum fraction, f, of heat available to produce useful energy depends on the difference between these temperatures (expressed in kelvins), f = (Th Tl)/Th. What is the maximum heat energy available for useful work from the combustion of 1.00 mol of C(s) to CO2(g)? (Assume the value of H calculated at 25C for the heat obtained in the generator.) It is possible to consider more efficient ways to obtain useful energy from a fuel. For example, methane can be burned in a fuel cell to generate electricity directly. The maximum useful energy obtained in these cases is the maximum work, which equals the free-energy change. Calculate the standard free-energy change for the combustion of 1.00 mol of C(s) to CO2(g). Compare this value with the maximum obtained with the heat engine described here.
Athletic trainers use instant ice packs that can be cooled quickly on demand. Squeezing the pact breaks an inner container, allowing two components to mix and react. This reaction makes the pack become cold. Describe the heat flow for this spontaneous process.
Enthalpy changes often help predict whether or not a process will be spontaneous. What type of reaction is more likely to be spontaneous: an exothermic or an endothermic one? Provide two examples that support your assertion and one counterexample.