If 4.25 g of A reacts to produce 8.95 g of C, what is the mass of B? Express your answer with the appropriate units.

Sulfur dioxide gas reacts with sodium hydroxide to form sodium sulfite and water. The unbalanced chemical equation for this reaction is given below: SO2(g)+NaOH(s)Na2SO3(s)+H2O(l) Assuming you react 38.3 g sulfur dioxide with 32.8 g sodium hydroxide and assuming that the reaction goes to completion, calculate the mass of each product formed.

3.50 A test of an automobile engine's exhaust revealed that g of NO2 was emitted in 10 minutes of operation. How many moles of NO2 would this engine release if it were used for a 45-minute commute, assuming that this mea- sured number is representative of the emission under all circumstances?

Consider the following unbalanced chemical equation for the combustion of pentane (C5H12): :math>C5H12(l)+O2(g)CO2(g)+H2O(l) a 20.4-gram sample of pentane is burned in excess oxygen, what mass of water can be produced, assuming 100% yield?

Copper reacts with nitric acid according to the following reaction. 3Cu(s)+8HNO3(aq)3Cu(NO3)2(aq)+2NO(g)+4H2O(l) If 2.40 g of Cu is added to a container with 2.00 mL of concentrated nitric acid (70% by mass HNO3; density = 1.42 g/cm3), what mass of nitrogen monoxide gas will be produced?

3.115 The average person exhales 1.0 kg of carbon dioxide in a day. Describe how you would estimate the number of CO2 molecules exhaled per breath for this average person.

ou know that chemical A reacts with chemical B. You react 10.0 g A with 10.0 g B. What information do you need to know to determine the amount of product that will be produced? Explain.

Fig. 5-5 illustrates a schematic diagram of a combustion device used to analyze organic compounds. Given that a certain amount of a compound containing carbon, hydrogen, and oxygen is combusted in this device, explain how the data relating to the mass of CO2 produced and the mass of H2O produced can be manipulated to determine the empirical formula.

When corn is allowed to ferment, the fructose in the corn is converted to ethyl alcohol according to the following reaction C6H12O6(aq)2C2H5OH(l)+2CO2(g)(a) What volume of ethyl alcohol (d=0.789g/mL) is produced from one pound of fructose? (b) Gasohol can be a mixture of 10 mL ethyl alcohol and 90 mL of gasoline. How many grams of fructose are required to produce the ethyl alcohol in one gallon of gasohol?

You know that chemical A reacts with chemical B. You react 10.0 g A with 10.0 g B. What information do you need to determine the amount of product that will be produced? Explain.