If 0.2149 moles of a something weighs 69.75 g, what is the molar mass of it, in units of g/mol? Format your answer like this: • Enter your answer in decimal form with 4 sig figs. • Use the proper abbreviation for the units. Your Answer: units Answer

If 0.2149 moles of a something weighs 69.75 g, what is the molar mass of it, in units of g/mol? Format your answer like this: • Enter your answer in decimal form with 4 sig figs. • Use the proper abbreviation for the units. Your Answer: units Answer

Chemistry: Principles and Reactions

8th Edition

ISBN:9781305079373

Author:William L. Masterton, Cecile N. Hurley

Publisher:William L. Masterton, Cecile N. Hurley

Chapter3: Mass Relations In Chemistry; Stoichiometry

Section: Chapter Questions

Problem 2QAP: The meat from one hazelnut has a mass of 0.985 g. (a) What is the mass of a millionth of a mole...

See similar textbooks

Similar questions

Given that the molar mass of carbon tetrachloride, CCl4 , is 153 g, calculate the mass in grams of 1 molecule of CCl4 .
Consider a reaction represented by the following balanced equation :math>2A+3BC+4D u find that it requires equal masses of A and B so that there are no reactants left over. Which of the following is true? Justify your choice. l type='a'> The molar mass of A must be greater than the molar mass of B. i>The molar mass of A must be less than the molar mass of B. i>The molar mass of A must be the same as the molar mass of B.
An experiment is conducted in which varying amounts of solid iron are added to a fixed volume of liquid bromine. The product of the reaction is a single compound, which can be separated from the product mixture and weighed. The graph shows the relationship between the mass of iron in each trail versus the mass of the product compound. Explain why the group has a positive slope for low masses of iron and a zero slope when the mass of iron added becomes larger.
Alkali metal hydroxides are sometimes used to “scrub” excess carbon dioxide from the air in closed spaces (such as submarines and spacecraft). For example, lithium hydroxide reacts with carbon dioxide according to the unbalanced chemical equation :math>LiOH(s)+CO2(g)Li2CO3(s)+H2O(g) ppose a lithium hydroxide canister contains 155 g of LiOH(s). What mass of CO2(g)will the canister be able to absorb? If it is found that after 24 hours of use the canister has absorbed 102 g of carbon dioxide, what percentage of its capacity has been reached?
If baking soda (sodium hydrogen carbonate) is heated strongly, the following reaction occurs: :math>2NaHCO3(s)Na2CO3(s)+H2O(g)+CO2(g) lculate the mass of sodium carbonate that will remain if a 1.52-g sample of sodium hydrogen carbonate is heated.
itamin B12 , cyancobalamin, is essential for human nutrition. Its molecular formula is C63H88CoN14O14P . A lack of this vita min in the diet can lead to anemia. Cyanocohalamin is the form of the vitamin found in vitamin supplements. l type='a'> What is the molar mass of cyanocobalamin to two decimal places? How many moles of cyanocohalamin molecules are present in 250 mg of cyanocobalamin? What is the mass of 0.60 mole of cyanocobalamin? How many atoms of hydrogen are in 1 .0 mole of cyanocobalamin? What is the mass of 1.0107 molecules of cyanocobalamin? What is the mass (in grams) of one molecule of cyanocobalamin?
In a blast furnace at high temperature, iron(III) oxide in ore reacts with carbon monoxide to produce metallic iron and carbon dioxide. The liquid iron produced is cooled and weighed. The reaction is run repeatedly with the same initial mass of iron(III) oxide, 19.0 g, but differing initial masses of carbon monoxide. The masses of iron obtained arc shown in this graph. (a) Write the balanced chemical equation for this reaction. (b) Calculate the mass of CO required to react completely with 19.0 g iron(III) oxide. (c) Calculate the mass of carbon dioxide produced when the reaction converts 10.0 g iron(III) oxide completely to products. (d) From the graph, determine which reactant is limiting when less than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (e) From the graph, determine which reactant is limiting when more than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (f) Calculate the percent yield if 24.0 g iron(III) oxide reacted with 20.0 g carbon monoxide to produce 15.9 g metallic iron. (g) Calculate the minimum mass of additional limiting reactant required to react with all of the excess of nonlimiting reactant from part (f).
The meat from one hazelnut has a mass of 0.985 g. (a) What is the mass of a millionth of a mole (106) of hazelnut meats? (A millionth of a mole is also called a micromole.) (b) How many moles are in a pound of hazelnut meats?
Classify each of the following statements as true or false: a Coefficients in a chemical equation express the molar proportions among both reactants and products. b A stoichiometry problem can be solved with an unbalanced equation. c In solving a stoichiometry problem, the change from quantity of given substance to quantity of wanted substance is based on masses. d Percentage yield is actual yield expressed as a percentage of ideal yield. e The quantity of product of any reaction can be calculated only through the moles of the limiting reactant. f rH is positive for an endothermic reaction and negative for an exothermic reaction.
How many molecules of C2H4Cl2 can be prepared from 15C2H4 molecules and 8Cl2 molecules?
Sulfur dioxide gas reacts with sodium hydroxide to form sodium sulfite and water. The unbalanced chemical equation for this reaction is given below: SO2(g)+NaOH(s)Na2SO3(s)+H2O(l) Assuming you react 38.3 g sulfur dioxide with 32.8 g sodium hydroxide and assuming that the reaction goes to completion, calculate the mass of each product formed.
A possible practical way to eliminate oxides of nitrogen(such as NO2 ) from automobile exhaust gases uses cyanuricacid, C3N3(OH)3 . When heated to the relatively lowtemperature of 625°F, cyanuric acid converts to gaseousisocyanic acid (HNCO). Isocyanic acid reacts with NO2 inthe exhaust to form nitrogen, carbon dioxide, and water,all of which are normal constituents of the air. (a) Write balanced equations for these two reactions. (b) If the process described earlier became practical, howmuch cyanuric acid (in kilograms) would be requiredto absorb the 1.71010kgNO2 generated annuallyin auto exhaust in the United States?