Hi, Question: An equilibrium mixtureof the following reaction has (SO3)=0.391 M and (O2) = 0.125 M at 600 oC.  What is the concentration of SO2? 2SO2(g) + O2(g) <----> 2SO3(g) Keq = 4.34 at 600 oC Thanks,

Q: At equilibrium, the concentrations in this system were found to be [N,] = [O,] = 0.200 M and [NO] =…

A: Equilibrium constant in terms of concentration of reactants and products is known as Kc. Kc is the…

Q: The acid HOCI (hypochlorous acid) is produced by bubbling chlorine gas through a suspension of solid…

A: If the two opposing process in a reversible change are chemical change and the state in this change…

Q: The equilibrium constant, Kc, for the following reaction is 10.5 at 350. K. 2CH₂Cl2 (9) CH4 (9) +…

A: We have givenThe equilibrium constant, Kc, for the following reaction is 10.5 at 350 K.2CH2Cl2(g)…

Q: The K. for 2 SO2 (g) + O2 (g) =2 SO3 (g) is 7.9 * 104. If you set up a vial with 4.0 * 10-2 M SO3,…

A: Reaction Quotient (Qc) is the ratio between the product of the concentration of the products to that…

Q: Consider the equilibrium system described by the chemical reaction below. A 2.00 L reaction vessel…

A:

Q: a. At equilibrium the concentrations of the ionized substances are: [C6H5NH₂] = 0.0537 mol/L…

A: Given , [C6H5NH2]=0.0537molL[C6H5NH3+]=4.79×10-6molL[OH-]=4.79×10-6molL

Q: At 25°C, K = 0.090 for the reaction H₂O(g) + Cl₂O(g) — 2 HOCl(g) Calculate the concentrations of all…

A: The equilibrium constant - When the value of the equilibrium constant for a chemical reaction and…

Q: 10) For the reaction below at a certain time, temperature and pressure, the [CO2] is 2.24 M, [H*] is…

A: Given:  [CO2] = 2.24 M  [H+] = 0.058 M  [HCO3-] = 0.097 M  KC = 9.81 x 10-6

Q: The equilibrium constant for the following gas phase reaction is Keg = 2.80 x 102 at 999 K. %3D (6)…

A: The equilibrium constant for required reaction can be calculated using given reaction.

Q: [4] At 25 °C, the equilibrium constant for the reaction: 2CO(g) +O2(g) = 2CO2(g) Kc = 5.0x1018. What…

A: The equilibrium reaction is as follows:(1)       (a)

Q: 5. A chemist puts 0.300 mol of N,O.(9, and 0.045mol of NO2 in a 1.5 L cylinder. If Keg is 0.91 at…

A: Here we are required to find the equilibrium concentration of both the reactant and the product for…

Q: 4 (a) Calculate the value of Kc for the reaction: PC15 ( PC13 (g) + Cl2 (g) AH = Positive Given that…

A: In the given gaseous reaction we have to tell the value of equilibrium constant (Kc). Given that -…

Q: WRITE THE EQUILIBRIUM EXPRESSION FOR EACH OF THE HETEROGENOUS EQUILIBRIUM (A) P4 (S) + 6F2 (G) ->…

A: Given(A) P4 (s) + 6F2 (g) ⇌ 4PF3 (g) (B) Xe(g) + 2F2(g) ⇌ XeF4(s)  (C) 2SiO (s) + 4Cl2(g) ⇌ 2SiCl4…

Q: Into a 1.00 liter flask is placed 0.924 moles of A. At equilibrium 38.8% has dissociated into B and…

A:

Q: following reaction. PH3BCl3(s)  PH3(g) + BCl3(g) (a) Calculate the equilibrium concentrations of…

A:

Q: Calculate the value of K for the following reaction at equilibrium. 2NCIO(g) 2NO(g) Cl,() An…

A: Given:  Moles of NClO = 1.5 mol Moles of NO = 6.0 mol Moles of Cl2 = 0.29 mol Given volume = 1…

Q: At a particular temperature, K = 3.6 x 10-6 for the following balanced reaction: 2Cl2 (g) + O₂(g) →…

A:

Q: For the reaction below at a certain time, temperature and pressure, the [CO2] is 2.24 M, [H+] is…

A:

Q: The equilibrium constant (K.) for the reaction. PCI, (9) + Cla (9) - PCI, (9) equals 49 at 230°C. If…

A: PCl3(g) + Cl2(g) ↔ PCl5(g) I(mol) 0.406   0.406   0 C -x   -x   +x E 0.406-x   0.406-x…

Q: Consider the following reaction: PCI{(g) PC13(g)+ Cl2(g) If 1.00×10-3 moles of PCI5, 0.302 moles of…

A: Equilibrium constants mainly get measured in concentration terms as well as pressure terms. The…

Q: What is the expression for the equilibrium constant for the reaction below? 2NH3(g) → N2(g) + 3H2(g)…

A: The given reaction is 2NH3 ⇔N2 + 3 H2

Q: At equilibrium, the concentrations of N2(g), O2(g), and NO(g) in a sealed reaction vessel are [N2] =…

A:

Q: 3NO3 (g)      N2O (g)   +   NO2 (g) What is the equilibrium constant if the concentrations at…

A:

Q: WRITE THE EQUILIBRIUM EXPRESSIONS FOR EACH OF THE FOLLOWING: (A) CO(G) + 2H2(G) CH3OH(G) (B) 2NO2…

A:

Q: At 25 °C, K. = 1.6 x 10-34 for the reaction 2HCI(g) + I2(s) - 2HI(g) + Cl2(g) Suppose 0.100 mol of…

A: Given,

Q: b. the system is at equilibrium, and dichlorine (Cl2) is added to the reaction (no change in…

A:

Q: Consider the following equilibrium:  N2O4 (g) ⇋ 2 NO2 (g)    Kc = 4.63 x 10-3 at 25 °C  A reaction…

A:

Q: Consider the following equilibrium: 2 NH3(g) N2 (g) + 3 H2 (g) Which of the following will happen…

A: Given -&gt; 2NH3(g) &lt;----&gt; N2(g) + 3H2(g)  When a chemical system at equilibrium is disturbed…

Q: the reaction between ammonia and oxygen, 4 NH3 (g) + 7 O2 (g) ⇋ 2N2O4 (g) + 6 H2O(g) a flask was…

A:

Ionic Equilibrium

Chemical equilibrium and ionic equilibrium are two major concepts in chemistry. Ionic equilibrium deals with the equilibrium involved in an ionization process while chemical equilibrium deals with the equilibrium during a chemical change. Ionic equilibrium is established between the ions and unionized species in a system. Understanding the concept of ionic equilibrium is very important to answer the questions related to certain chemical reactions in chemistry.

Arrhenius Acid

Arrhenius acid act as a good electrolyte as it dissociates to its respective ions in the aqueous solutions. Keeping it similar to the general acid properties, Arrhenius acid also neutralizes bases and turns litmus paper into red. 

Bronsted Lowry Base In Inorganic Chemistry

Bronsted-Lowry base in inorganic chemistry is any chemical substance that can accept a proton from the other chemical substance it is reacting with.