H2(g) Oz(g) 64 g 4.0 g V = 10.0 L T 300. K V = 10.0 L T= 300. K Representations of two gas samples are shown. A student claims that the pressure is the same in both containers. Which of the following most completely supports the student's claim? The number of atoms is the same in both containers. The temperature and number of atoms are the same in both containers. The volume and temperature are the same for both containers. The volume, temperature, and number of gas molecules are the same for both containers.

H2(g) Oz(g) 64 g 4.0 g V = 10.0 L T 300. K V = 10.0 L T= 300. K Representations of two gas samples are shown. A student claims that the pressure is the same in both containers. Which of the following most completely supports the student's claim? The number of atoms is the same in both containers. The temperature and number of atoms are the same in both containers. The volume and temperature are the same for both containers. The volume, temperature, and number of gas molecules are the same for both containers.

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter5: Gases

Section: Chapter Questions

Problem 156CWP: Which of the following statements is(are) true? a. If the number of moles of a gas is doubled, the...

See similar textbooks

Similar questions

You have a gas, one of the three known phosphorus-fluorine compounds (PF3, PF3, and P2F4). To find out which, you have decided to measure its molar mass. (a) First, yon determine that the density of the gas is 5.60 g/L at a pressure of 0.971 atm and a temperature of 18.2 C. Calculate the molar mass and identify the compound. (b) To check the results from part (a), you decide to measure the molar mass based on the relative rales of effusion of the unknown gas and CO2. You find that CO2 effuses at a rate of 0.050 mol/min, whereas the unknown phosphorus fluoride effuses at a rate of 0.028 mol/min. Calculate the molar mass of the unknown gas based on these results.
You have a 550.-mL tank of gas with a pressure of 1.56 atm at 24 C. You thought the gas was pure carbon monoxide gas, CO, but you later found it was contaminated by small quantities of gaseous CO2 and O2. Analysis shows that the tank pressure is 1.34 atm (at 24 C) if the CO2 is removed. Another experiment shows that 0.0870 g of O2 can be removed chemically. What are the masses of CO and CO2 in the tank, and what is the partial pressure of each of the three gases at 25 C?
Silane, SiH4, is the silicon analogue of methane, CH4. It is prepared industrially according to the following equations: Si(s)+3HC1(g)HSiCl3(l)+H2(g)4HSiCl3(l)SiH4(g)+3SiCl4(l) a. If 156 mL HSiCl3 (d = 1.34 g/mL) is isolated when 15.0 L HC1 at 10.0 atm and 35C is used, what is the percent yield of HSiCl3? b. When 156 mL HSiCl3 is heated, what volume of SiH4 at 10.0 atm and 35C will be obtained if the percent yield of the reaction is 93.1%?
Which of the following statements is(are) true? a. If the number of moles of a gas is doubled, the volume will double, assuming the pressure and temperature of the gas remain constant. b. If the temperature of a gas increases from 25C to 50C, the volume of the gas would double, assuming that the pressure and the number of moles of gas remain constant. c. The device that measures atmospheric pressure is called a barometer. d. If the volume of a gas decreases by one half, then the pressure would double, assuming that the number of moles and the temperature of the gas remain constant.
Titanium(III) chloride is used in the manufacture of polyethylene. It is produced by the reaction (at high temperatures) between TiCl4 gas and H2. 2TiCl4(g)+H2(g)2TiCl3(s)+2HCl(g)Assume 100% yield and constant temperature and pressure. (a) How many liters of HCI gas can be produced by mixing 3.72 L of TiCl4 and 4.50 L of H2? (b) How many liters of reactant in excess are present after the reaction is complete?
Many nitrate salts can be decomposed by heating. For example, blue, anhydrous copper(II) nitrate produces the gases nitrogen dioxide and oxygen when heated. In the laboratory, you find that a sample of this salt produced a 0.195-g mixture of gaseous NO2 and O2 with a total pressure of 725 mm Hg at 35 C in a 125-mL flask (and black, solid CuO was left as a residue). What is the average molar mass of the gas mixture? What are the mole fractions of NO2 and O2 in the mixture? What amount of each gas b in the mixture? Do these amounts reflect the relative amounts of NO2 and O2 expected based on the balanced equation? Is it possible that the fact that some NO2 molecules combine to give N2O4 plays a role? Heating copper(II) nitrate produces nitrogen dioxide and oxygen gas and leaves a residue of copper(ll) oxide.
Pyruvic acid, HC3H3O3, is involved in cell metabolism. It can be assayed for (that is, the amount of it determined) by using a yeast enzyme. The enzyme makes the following reaction go to completion: HC3H3O3(aq)C2H4O(aq)+CO2(g) If a sample containing pyruvic acid gives 21.2 mL of carbon dioxide gas, CO2, at 349 mmHg and 30C, how many grams of pyruvic acid are there in the sample?
What does “STP’ stand for? What conditions correspond to STP? What is the volume occupied by one mole of an ideal gas at STP
If equal masses of O2 and N2 are placed in separate containers of equal volume at the same temperature, which of the following statements is true? If false, explain why it is false. (a) The pressure in the flask containing N2 is greater than that in the flask containing O2. (b) There are more molecules in the flask containing O2 than in the flask containing N2.
How would the graph in Figure 9.12 change if the number of moles of gas in the sample used to determine the curve were doubled?