Give the omega-n designation for each acid. Part 1 of 2 stearidonic acid CH3CH2(CH=CHCH2) 4 (CH2)2COOH omega- acid Part 2 of 2 linoleic acid CH3(CH2) CH=CHCH2CH=CH(CH2), COOH omega- acid
Q: Draw the product AND propose a reasonable, detailed stepwise mechanism, using curved arrow notation…
A: here in first step in presence of base H+ ion is removed from alpha position of carbonyl carbon and…
Q: 1. List four classes of membrane-associated proteins and briefly describe the differences between…
A: FEEL FREE TO ASK FOR CLARIFICATIONS
Q: What is the oxidation level in the molecule below? Type in the number: 1, 2, 3, etc. CH3 CH2-CHCH3
A: Carbon is often more electronegative than hydrogen. So while binding to oxygen C will be positive…
Q: A gas balloon has a volume of 82.28 liters when the temperature is 40.9 °C and the pressure is 799.3…
A: The first step is to convert the temperatures from Celsius to Kelvin because the gas laws are based…
Q: Can you draw the following. Around what's it suppose to look like. 1.) Clean Surface: [Gold surface…
A: Step 1: Step 2: Step 3: Step 4:
Q: Consider a reaction with the following thermodynamic properties. AH° 77.7 kJ AS° -35.7 J/(K⚫ mol) AG…
A: Step 1: GivenΔHo = 77.7 kJΔSo = -35.7 J/K.molΔGo = 88.4 kJ Step 2:ΔGo = ΔHo - TΔSoSince, reaction…
Q: For the reaction A ==> B, Delta G'° = -60 kJ/mol. The reaction is started with 10 mmol of A; no B is…
A: Step 1:Step 2: Step 3: Step 4:
Q: help please answer in text form with proper workings and explanation for each and every part and…
A: Step 1:To calculate mass of oxygen gas ,First we need to calculate the moles of ammonium…
Q: determine the structure of p2 spike. is it primary, secondary, tertiary, or quaternary?
A: Approach to solving the question:Read and understand the question.Analyze the image.Research the…
Q: phosphofructokinase reaction of Fructose-2,6-bisphosphate is a regulator of both glycolysis and…
A: Activates glycolysis and inhibits gluconeogenesis:Increased levels of…
Q: An enzyme-catalyzed reaction has a KM of 20.0 mmol L-1 and Vmax of 17.0 pmol s-1. When a mixed…
A: The objective of this question is to calculate the α value, which is a measure of the degree of…
Q: Natural products are the future of drug discovery. Discuss this statement giving three reasons why…
A: Reasons why natural products are a good source of novel drugs: Chemical Diversity: Natural products…
Q: Biochemistry Question
A: Step 1:Share the screen from your computer in a conversation with A1, to show desktop applications…
Q: Place the following gases in order of increasing average velocity at 300 K: Ar, CH4, N2, and N2O.…
A: The average velocity of a gas can be represented as Average velocity=πM8RTR = Ideal gas constantT…
Q: For the following results of Thermodynamics of Borax Solubility, the volume of Borax solution…
A: Temp oCTemp KVolume Borax, mLVolume HCl, mLTotal Volume,…
Q: 12. What is the major organic product obtained from the following reaction? OCH 3 Br2 CH3CO₂H Br 1 2…
A: This is reaction undergo electrophilic aromatic substitution. Electrophilic aromatic substitution is…
Q: With the advent of photosynthesis, the amount of oxygen in the atmosphere has varied over the eons…
A: Approach to solving the question:Detailed explanation:Examples:ANSWER IS 12 ML H20 Key references:…
Q: . An acetate/acetic acid (pKa=4.75) buffer of 500 mL includes 0.1 mol of acetate and 0.5 mol of…
A: The objective of the question is to calculate the volume of 2.0 M NaOH that was added to the buffer…
Q: please help with this
A: mRNA Sequence from the Template DNA Strand Template DNA strand: (5') CTTAACACCCCTGACTTCGCGCCGTCG…
Q: Choose the correct product for the following Diels-Alder reaction. OEt OEt product OEt OEt OEt OEt…
A:
Q: 7: Compare and contrast cholesterol and plant sterols. How plant sterols can be used to reduce the…
A: The objective of this question is to understand the differences and similarities between cholesterol…
Q: 4. i)List two reasons why membrane fusion is energy demanding. ii) List the three SNARE proteins…
A: Membrane Fusion and SNARE Proteinsi) Reasons Why Membrane Fusion is Energy DemandingElectrostatic…
Q: Draw all three staggered conformations for the following compound, viewed along the C₂-C3 bond.…
A: Hence, the most stable staggered conformer is Conformer C.
Q: Consider the following mRNA sequence: 5'-UUG ACC GAC-3'. Note: Reference the Genetic code table for…
A: To decode the mRNA sequence 5'-UUG ACC GAC-3' into its corresponding amino acid sequence, we use the…
Q: Answer each question with regards to vitamin D. H. Part: 0 / 7 Part 1 of 7 How many tetrahedral…
A: Vitamin D3 Structure:Rings A, B, and C (Cyclohexane Rings): Each carbon in a cyclohexane ring,…
Q: Change the structure in the drawing area to show the aldonic acid product formed if the compound is…
A: Here given the structure of a ketose compound which oxidized to form a carboxylic acid compound,…
Q: The following data were obtained in a study of an enzyme known to follow Michaelis-Menten kinetics:…
A: All the statements other than option A is false because all those values can be determined from the…
Q: Consider the titration of a 23.0-mL sample of 0.110 M HC2H3O3 (Ka=1.8\times 10−5) with 0.120 M…
A: volume of base required to reach equivalence point = (0.110 M x 23 ml)/0.120 M = 21.1ml of NaOH pH…
Q: 4. Gentiobiose (D-Glc(ẞ1-6)D-glc) is a disaccharide found in some plant glycosides. Draw Haworth…
A: Gentiobiose has a beta-glycoside link, originating at C-1 in ring A and terminating at C-6 in ring…
Q: It's 1 question
A: First, we need to understand the metabolic pathways involved in this scenario. Anaerobic exercise…
Q: 5. Trehalose, a disaccharide produced in fungi, has the following structure: CH₂OH H OH H H H H OH H…
A: a. α-D-glucopyranosyl-(1→1)-α-D-glucopyranoside b. Trehalose is not a reducing sugar.Explanation:…
Q: Benzene is a carbohydrate ubiquitous to organic chemistry. Its structure was proposed near the end…
A: To find the molecular formula of benzene, we must first compute the empirical formula using the %…
Q: In the situations described below, what is the free energy change if 1 mole of Na+ is transported…
A: The objective of the question is to calculate the free energy change (ΔG) when 1 mole of Na+ is…
Q: Digestion of cellobiose in cows produces two glucose units which is then absorbed into the bloodand…
A: The objective of the question is to calculate the total number of ATP molecules produced from the…
Q: Explain this to me, I’m confused
A:
Q: None
A: 1) 948×102=9.48×10(2+2)=9.48×104(We moved the decimal two places to the left, so we increased the…
Q: Consider this structure. NH CH,OH 'N' NH, но OH Part: 0 / 3 Part 1 of 3 Identify the monosaccharide.…
A: Usually existing in a ring form known as a furanose, D-ribose is a five-membered ring made of four…
Q: Determine the number of biological forms that can exist for an aldopentose. 8 16 4 2
A: Step 1:Step 2: Step 3: Step 4:
Q: Digestion of cellobiose in cows produces two glucose units which is then absorbed into the bloodand…
A: Now, let's calculate: 1: Glycolysis produces 2 ATP.2:From oxidative phosphorylation, each NADH…
Q: Help pls :(
A:
Q: The phosphorylation catalyzed by hexokinase is essentially an irreversible reaction. Which of the…
A: Under cellular conditions, hexokinase converts glucose to glucose 6-phosphate while simultaneously…
Q: 2-butanol can be formed as the only product of the Markovnikov addition of H2O to two different…
A: 1. Solution: Drawing the Alkene Starting MaterialsMarkovnikov's Rule: In the addition of water to an…
Q: Balance the following redox reaction: Zn(s) + ReO4(aq) + -> Re(s) Zn2+(aq) (basic solution)
A: The balanced reaction:Redox balance in basic medium Zn(s) + ReO4-(aq) → Re(s) + Zn2+(aq) First…
Q: Which of the following accurately describes the enzymatic regulation of glycolysis? Glycolytic…
A: Glycolysis is one biological pathway included in cellular respiration and this starts with a glucose…
Q: calculate the pH of a 0.10M solution of formic acid. the Ka of formic acid is 1.8x10^-4
A:
Q: Solute Blue dextran Alkaline phosphatase Cytochrome C Na2CrO4 Molecular Weight (g/mol) Elution…
A: The objective of the question is to identify the molecular weights and elution volumes of the given…
Q: You are unable to test for every biophysical characteristic in your RFP due to time restrictions. If…
A: Approach to solving the question: Detailed explanation:Let's delve deeper into each additional…
Q: What is this TLC's Rf Value
A:
Q: For the following results of Thermodynamics of Borax Solubility, the volume of Borax solution…
A:
Q: 7. Consider the structures shown. For each structure select all that apply. a) pentose, hexose or…
A: Answer and its explanation are given below.I hope it helps you Explanation:
Step by step
Solved in 2 steps
- Give the omega-n designation for each acid. Part 1 of 2 oleic acid CH3(CH2), CH=CH(CH2), COOH omega- acid ☑ Part 2 of 2 paullinic acid CH3(CH2), CH=CH(CH2) COOH 5 11 omega- acid ХGive the omega-n designation for each acid. Part 1 of 2 DHA CH3CH2(CH=CHCH2) CH2COOH omega- acid × Part 2 of 2 G gamolenic acid CH3(CH2) CH=CHCH2CH=CHCH2CH=CH(CH2) COo omega- acidExplain the Titrimetric profile of Lysine in figure 2.
- Identify the following types of biomolecules and label and identify the functional groupsGlycine hydrochloride (Cl− H3N+CH2COOH) is a diprotic acid that contains a carboxylic acid group and an ammonium group and is therefore called an amino acid. It is often used in biochemical buffers. Solve, In analogy with Figure , sketch the titration curve of this diprotic acid.Write the saponification reaction of the following triglyceride with NaOH CH3 H-C-O CH3 Н-С-О `CH3 Н-С-О.