From the data given below calculate the value of ΔS° for the reaction. T = 298.15 K. A(g) + 1B(g) ---> 1C(s) + D(l)ΔfH°/(kJ mol-1) -393.23 -44.71 -332.49 -284.45ΔfG°/(kJ mol-1) -392.07 -15.56 -197.3 -231.43

From the data given below calculate the value of ΔS° for the reaction. T = 298.15 K. A(g) + 1B(g) ---> 1C(s) + D(l)ΔfH°/(kJ mol-1) -393.23 -44.71 -332.49 -284.45ΔfG°/(kJ mol-1) -392.07 -15.56 -197.3 -231.43

Chemistry for Engineering Students

4th Edition

ISBN:9781337398909

Author:Lawrence S. Brown, Tom Holme

Publisher:Lawrence S. Brown, Tom Holme

Chapter10: Entropy And The Second Law Of Thermodynamics

Section: Chapter Questions

Problem 9CO

See similar textbooks

Related questions

Q: What is the approximate pH at the equivalence point of the titration curve shown below? A B A. O…

A: 1) Approximate pH at equivalence is at about 7.0.As equivalence point is a point where amount of…

Q: Consider the reaction described by the equation. What are the missing entries in the table? Consider…

A: Dear student,Since the table is missing, it is impossible to answer the question.Please reupload the…

Q: Use the following atomic weights and quantities to calculate the overall % yield of…

Q: Propose an efficient synthesis for the following transformations using ONLY acetoacetic ester…

A: Step 1:• In this reaction, • firstly, Strong base abstract the acidic proton of Acetoacetic ester…

Q: Question 32 Predict the FINAL (?) product for each of the following reaction or synthetic chain:…

A: Step 1: Step 2: Step 3: Step 4:

Q: Knowing that the rotational constant of the heteronuclear diatomic molecule HCl is 10.4367 cm−1 ,…

A: Approach to solving the question: Detailed solution:

Q: Provide a procedure for the synthesis of "L-gulono-Lactone" from "D-gluconic acid lactone"

A: The objective of the question is to provide a procedure for the synthesis of "L-gulono-Lactone" from…

Q: Determine if the following is aromatic, antiaromatic or nonaromatic:

A: Step 1:For a Compound to be aromatic(i) It should be cyclic(ii) It should be planar(iii) It should…

Q: Why are some elements metalloids

A: Step 1: Elements are classified as metalloids because they exhibit properties that are intermediate…

Q: dont provide handwriting solution ...

A: Step 1: abstraction of H+ from benzoyl sulphonic acid Step 2:removal of H2O+ cause it's better…

Q: Balancing and Classifying Reactions Practice Balance the following reactions and identify which of…

A: The objective of the question is to balance the given chemical reactions and classify them into one…

Q: b. H 1. NaOH 2.

Q: please give Step by Step Solution otherwise i give you DISLIKE !

A: Step 1: Abstraction of proton. Step 2: Formation of enolate. Step 3: Alkylation. Step 4:

Q: Ita Srxn Substance HCOOH(aq) S (J-mol K-1) . 92.0 HCOOH(1) 128.95 H2C2O4(s) 115.6 H2C2O4(aq) 45.61…

A: The objective of the question is to calculate the entropy change for the given reaction and discuss…

Q: None

A: Step 1:

Q: Consider the titration of a 40.0 mL of 0.153 M weak acid HA (Ka = 2.7 x 10⁻⁸) with 0.100 M LiOH.…

A: The objective of this question is to calculate the pH of a weak acid solution before any base has…

Q: Please answer the following chem quesiton

A: Step 1: A) Pyridinium dichromate (PDC) consists of a pyridinium cation (C5H5NH+) and a dichromate…

Q: Consider this chemical reaction: ATP + H2O --> ADP+ Pi. Identify the FALSE statement regarding this…

A: Step 1:The FALSE statement regarding the given chemical reaction is:"It consumes energy." This…

Q: help question 12

A: Step 1:Step 2:Hence,

Q: 3. Identify the given drugs. Write its functional groups and heterocyclic rings present. Explain…

A: The IUPAC name of the given drug is sodium…

Q: None

A: Shown below is an estimation of the 1H NMR of the given compound.In 1H NMR, deshielded protons are…

Q: Draw the major product of this reaction. Ignore inorganic byproducts. 1. LDA 2. CH2CHCH2Br (1 equiv)

Q: Upp solve all

A: 1. To determine the relative uncertainty of the solution, we need to calculate the relative…

Q: hich of the following substances has the largest absolute entropy at 300K? Group of answer…

A: Out of the given choices, NH3(g) (Ammonia gas) has the largest absolute entropy at 300K. Entropy is…

Q: propose a stepwise mechanism with curved arrows for the following reaction

A: Approach to solving the question: Detailed explanation: Examples: Key references:

Q: OWLv2 | Online teaching and x + CakeAssignment/takeCovalentActivity.do?locator-assignment-take Use…

Q: Part A Estimate the optimal number of neutrons for a nucleus of Ho (Z=67). Express the number of…

Q: Calculate the standard all potentials given the following data: + 2+ Cu (aq) + 2e¯ → Cu(s), E° › ·…

A: The objective of the question is to calculate the standard cell potential for the given reactions.…

Q: None

A: Explanation: This permits the occurrence of hydration to an alkene patterned to result into an…

Q: Draw the all the reactants and products involved in a condensation reaction between propanoic acid…

A: Step 1: Step 2: Step 3: Step 4:

Q: 1) Draw the products of the following reactions. Draw stereoisomers and identify them as…

Q: A buffer solution was prepared by adding 4.92 g of sodium acetate, NaCH3CO2, to 2.50 x 10^2 mL of…

A: The objective of this question is to calculate the pH of a buffer solution after adding a certain…

Q: None

Q: FO & H H3O+ N + H₂O, heat H3N O

A: Approach to solving the question: Detailed explanation: Examples: Key references:

Q: The molecular formula of the following compound is C H H

A: Explanation:

Q: help question 13

Q: Calculate the enthalpy of formation of benzene from the following data.2C6H6(g) + 15O2(g) --->…

Q: 2

A: a) Br elimination of 2-bromo-2-methyl butane with sodium ethoxide follows Zaitsev's rule giving…

Q: C. B. mage click here Predict the major product(s) for the following reactions. A. :0: CO/HCI AICI3…

A: Step 1: Step 2: Step 3: Step 4:

Q: Q1: The following are relative peak areas for chromatograms of standard solutions of methyl vinyl…

A: MKV concentration, mmol/LRelative peak area…

Q: 12.4 Recorded Macro: Insert the Ideal Gas Constant Record a macro that will insert the ideal gas…

A: Normally we use 8.314 gmolKJ for ideal gas constant in ideal gas law equation pv= nRT

Q: Provide IUPAC name for the structure shown below ОН O

A: The given structure is an ester, with 2-methylpropyl group at one end and hydroxybutyl on the other.…

Q: 7. Give the final product 1) 480+ 2) H2Cr2O7 3) RCO₂H 4) excess LAH 5) H₂O он b) HO- он <) HO- но он

A: in case of any doubt feel free to ask

Q: 4. Give the reagents 요 a) 1.LAH 2. MeMgBr 3. H₂O PH 1. Me Br 1. Me Ms Br b) c) 20 LAH 2. H₂O 3.H20

A: Step 1: This reaction converts ketone to tertiary alkane. Grignard reagent (MeMgBr) reduces ketone…

Q: A 12 MGD biological nitrogen removal (BNR) facility has an influent TKN concentration of 32 mg/L and…

A: The objective of the question is to find how many of alkalinity was consumed by…

Q: A stock solution of concentration 0.197 M is diluted in a two-step serial dilution. In the first…

Q: involve titrating a 100.0 mL sample of 0.18 M HClO4 is titrated with 0.27 M NaOH 49) Determine…

A: We can determine the pH of the solution after adding 66.67 mL of NaOH by following these steps:1.…

Q: What is the IUPAC name for the following alkane? M CHÍCH, CHÍCH CH3-CH-CH2-CH-CH3

Q: Describe Auger/screw mechanisms and dosator mechanism by which capsules are produced. Use diagrams…

A: Auger/Screw Mechanisms:The auger or screw rotates at a controlled speed to draw the powder or…

Q: Draw the x anomer product of this reaction. Ignore inorganic byproducts. AcO H- OACOA AC OAC H a…

Question

From the data given below calculate the value of ΔS° for the reaction. T = 298.15 K.

                                 A(g)       +      1B(g)      ---> 1C(s)    +   D(l)
Δ_fH°/(kJ mol-1)          -393.23        -44.71            -332.49       -284.45
Δ_fG°/(kJ mol-1)          -392.07          -15.56            -197.3          -231.43

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Similar questions

Use the data in Appendix J to calculate rG andKPat 25 C for the reaction 2HBr(g)+Cl2(g)2HCl(g)+Br2() Comment on the connection between the sign of rG and the magnitude ofKP.
What determines Ssurr for a process? To calculate Ssurr at constant pressure and temperature, we use the following equation: Ssurr = H/T. Why does a minus sign appear in the equation, and why is Ssurr inversely proportional to temperature?
What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the synthesis of ammonia? 3H2(g) + N2(g) 2NH3(g)
What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the explosive decomposition of TNT? Use your knowledge of TNT and the chemical equation, particularly the phases, to answer this question. (Thermodynamic data for TNT are not in Appendix G.) 2C7H5N3O6(s) 3N2(g) + 5H2O() + 7C(s) + 7CO(g)
Which contains greater entropy, a quantity of frozen benzene or the same quantity of liquid benzene at the same temperature? Explain in terms of the dispersal of energy in the substance.
The free energy change, G, for a process at constant temperature and pressure is related to Suniv and reflects the spontaneity of the process. How is G related to Suniv? When is a process spontaneous? Nonspontaneous? At equilibrium? G is a composite term composed of H, T, and S. What is the G equation? Give the four possible sign combinations for H and S. What temperatures are required for each sign combination to yield a spontaneous process? If G is positive, what does it say about the reverse process? How does the G = H TS equation reduce when at the melting-point temperature of a solid-to-liquid phase change or at the boiling-point temperature of a liquid-to-gas phase change? What is the sign of G for the solid-to-liquid phase change at temperatures above the freezing point? What is the sign of G for the liquid-to-gas phase change at temperatures below the boiling point?
A reaction has H298=100 kj/mol and S298=250 J/mol K. Is the reaction spontaneous at room temperature? If not, under what temperature conditions will it become spontaneous?
Elemental boron, in the form of thin fibers, can be made by reducing a boron halide with H2. BCl3(g) + 3/2 H2(g) B(s) + 3HCl(g) Calculate H, S, and G at 25 C for this reaction. Is the reaction predicted to be product favored at equilibrium at 25 C? If so, is it enthalpy driven or entropy driven?
For the reaction CH3OH(l)+32O2(g)2H2O(l)+CO2(g) the value of G is 702.2 kJ at 25C. Other data are as follows: Hf (kJ/mol) at 25C S (J/molK) at 25C CH3OH(l) 238.7 126.8 H2O(l) 285.8 70.0 CO2(g) 393.5 213.7 Calculate the standard entropy, S, per mole of O2(g).
Silver carbonate, Ag2CO3, is a light yellow compound that decomposes when heated to give silver oxide and carbon dioxide: Ag2CO3(s)Ag2O(s)+CO2(g) A researcher measured the partial pressure of carbon dioxide over a sample of silver carbonate at 220C and found that it was 1.37 atm. Calculate the partial pressure of carbon dioxide at 25C. The standard enthalpies of formation of silver carbonate and silver oxide at 25C are 505.9 kJ/mol and 31.05 kJ/mol, respectively. Make any reasonable assumptions in your calculations. State the assumptions that you make, and note why you think they are reasonable.
Tetrachloromethane (carbon tetrachloride), CCl4, has a normal boiling point of 76.7C and an enthalpy of vaporization, Hvap, of 29.82 kJ/mol. Estimate the entropy of vaporization, Svap. Estimate the free energy of vaporization, Gvap, at 25C.
What types of experiments can be carried out to determine whether a reaction is spontaneous? Does spontaneity have any relationship to the final equilibrium position of a reaction? Explain.