For the following electron-transfer reaction:Mg(s) + 2Ag+ (aq)Mg2+ (aq) + 2Ag(s)The oxidation half-reaction is:+-The reduction half-reaction is:+++Enter electrons as e".Use smallest possible integer coefficients.If a box is not needed, leave it blank.

Answered: For the following electron-transfer…

For the following electron-transfer reaction: Mg(s) + 2Ag+ (aq) →→→→ Mg2+ (aq) + 2Ag(s) The oxidation half-reaction is: The reduction half-reaction is: + +

Chemistry: Principles and Reactions

8th Edition

ISBN:9781305079373

Author:William L. Masterton, Cecile N. Hurley

Publisher:William L. Masterton, Cecile N. Hurley

Chapter17: Electrochemistry

Section: Chapter Questions

Problem 25QAP: For the following half-reactions, answer these questions....

See similar textbooks

Related questions

Q: Write balanced half-reactions for the following redox reaction: 2 CO₂(g) +12 H* (aq) +121¯ (aq)…

A: Write balanced half reaction of the given reaction---

Q: Balance the following redox reaction in basic solution. 3+ 2+ H₂(g)+Fe³+ (aq) H₂O(1)+Fe²+ (aq)

A: Since, In redox reaction, Oxidation and reduction reaction both takes place simultaneously.

Q: For the following electron-transfer reaction: 3Cl₂(g) + 2Cr(s) →→→→ 6Cl¯(aq) + 2Cr³+ (aq) The…

Q: For the following electron-transfer reaction: Cu²+(aq) + Sn(s) → Cu(s) + Sn²+(aq) The oxidation…

A: Oxidation Reduction take place simultaneously is called as redox reactionOxidation= oxidation number…

Q: Write balanced half-reactions for the following redox reaction: 3Cl2 (g) + 2Cr3+ (aq) + 14OH−…

A: First of all we have to identify oxidising agent and reducing agent. The species which oxidises…

Q: Write balanced half-reactions for the following redox reaction: 2+ 6 Zn²+ (aq) + C₂H₂OH(1) + 3…

Q: Write balanced half-reactions for the following redox reaction: 2CO,(g)+12H* (aq)+12C1 (aq) →…

A: Answer:

Q: Write balanced half-reactions for the following redox reaction: BiO,(aq)+3 H,O()+Zn(s) → Bi (aq)+6OH…

A: Redox reaction is the reaction in which both the oxidation reaction and the reduction reaction takes…

Q: Write balanced half-reactions for the following redox reaction: 3 Cl₂(g) + 2 Cr³+ (aq)+14 OH¯(aq) →…

Q: (1) Identify each of the following half-reactions as either an oxidation half-reaction or a…

A: Answer : Since two half cells are given and we have to tell which is oxidation half cell and which…

Q: For the following electron-transfer reaction: Mg(s) + F₂(g) Mg2+ (aq) + 2F (aq) The oxidation…

Q: A solution containing vanadium (chemical symbol V) in an unknown oxidation state was electrolyzed…

A: Given: Current = 2.96 A Time = 33.4 min Mass of V deposited at cathode = 0.784 g Molar mass of V =…

Q: A solution containing vanadium (chemical symbol V) in an unknown oxidation state was electrolyzed…

Q: Write balanced half-reactions for the following redox reaction: MnO (aq) +8 H* (aq) +5 Fe²+ (aq)…

Q: Write balanced half-reactions for the following redox reaction: 2+ 12 Cu²+ (aq) + C₂H₂OH(1) + 12…

Q: Combine these half-reactions into a balanced overall redox reaction. Zn (s) → Zn2+ (aq) + 2 e Ag"…

Q: Write balanced half-reactions for the following redox reaction: 5I2(s)+2Mn2+(aq)+8H2O(l)→…

A: Given : redox reaction

Q: Consider the following half-reactions: Half-reaction Ag+ (aq) + e → Ag(s) Cu2+ (aq) + 2e →→→ Cu(s)…

Q: Write balanced half-reactions for the following redox reaction: 5 Ch(9)+2 Mn (aq)+16 OH (aq) → 10 CI…

Q: A solution containing vanadium (chemical symbol V) in an unknown oxcidation state was electrolyzed…

Q: Write balanced half-reactions for the following redox reaction: 5 Fe³+ (aq) +Mn²+ (aq) + 4H₂O(1) 2+…

A: A redox reaction is always accompanied by two half-reactions, namely oxidation &…

Q: Balance the following redox reaction in basic solution. 3+ Cr(OH)3(s) + Fe³+ (aq) 2+ Cro(aq)+ Fe²+…

A: Answer:

Q: Write two half-reactions to describe each of these metal displacement reactions. Include phase…

A: Oxidation Reaction - Reaction in which there is increase in oxidation number or addition of oxygen…

Q: Write balanced half-reactions for the following redox reaction: 12 Cu( reduction: oxidation:…

A: Oxidation:Loss of electrons or increase in magnitude of potive oxidation state or decrease in the…

Q: Write balanced half-reactions for the following redox reaction: 2+ 4 Zn²+ (aq) +AsH₂(g) +8 OH (aq)…

Q: For the following electron-transfer reaction: Zn(s) + Cl2(g) –→ Zn²*(aq) + 2CI(aq) The oxidation…

A: The oxidation half and reduction half reaction for the reaction is given below.

Q: Write balanced half-reactions for the following redox reaction: 2+ Fe²+ (aq)+NO3(aq) + 2 H+ (aq) 3+…

Q: A solution containing vanadium (chemical symbol V) in an unknown oxidation state was electrolyzed…

A: Current I = 1.46 A time t = 23.1 minutes = 23.1 * 60 s = 1386 s Mass of vanadium deposited = 0.534…

Q: Write balanced half-reactions for the following redox reaction: Cr₂O2 (aq)+7H₂O()+6 Cut (aq) → 2…

Q: Complete and balance the following redox equation in basic solution. Br2(l) + Al(OH)4–(aq) ⟶ Br–(aq)…

A: Answer:- This question is answered by using the simple concept of balancing the redox reaction in…

Q: A solution containing vanadium (chemical symbol V) in an unknown oxidation state was electrolyzed…

Q: Write balanced half-reactions for the following redox reaction: 2CO,(g)+12H (aq)+12I (aq) →…

Q: What mass of Cu(s) is electroplated by running 17.5 A of current through a Cu²“(aq) solution for…

A: Part A : First we would Calculate charge using current and time. From charge , we would calculate…

Q: 1. The following reaction occurs spontaneously. 2 Fe(s) + 3 Cl2(aq)→2 Fe³*(aq) + 6 CF(aq) Write the…

Concept explainers

Electrolysis

Electrolysis is defined as the process of breaking down ionic compounds into their constituent elements by passing a direct electric current through the compound in a fluid state. The cathode reduces cations, while the anode oxidizes anions. An electrolyte, electrodes, and some form of external power source are the main components required for conducting electrolysis. A partition, such as an ion-exchange membrane or a salt bridge, may also be used, but this is optional. These are primarily used to prevent the products from diffusing near the opposing electrode.

Question

For the following electron-transfer reaction:
Mg(s) + 2Ag+ (aq)
Mg2+ (aq) + 2Ag(s)
The oxidation half-reaction is:
+
-
The reduction half-reaction is:
+
+
+
Enter electrons as e".
Use smallest possible integer coefficients.
If a box is not needed, leave it blank.

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step 3

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 3 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Consider only the species (at standard conditions) Na+, Cl, Ag+, Ag, Zn2+, Zn, Pb in answering the following questions. Give reasons for your answers. (Use data from Table 17-1.) a. Which is the strongest oxidizing agent? b. Which is the strongest reducing agent? c. Which species can be oxidized by SO42 (aq) in acid? d. Which species can be reduced by Al(s)?
1. If you wish to convert 0.0100 mol of Au3+ (aq) ions into Au(s) in a “gold-plating” process, how long must you electrolyze a solution if the current passing through the circuit is 2.00 amps? 483 seconds 4.83 104 seconds 965 seconds 1450 seconds
An aqueous solution of an unknown salt of gold is electrolyzed by a current of 2.75 amps for 3.39 hours. The electroplating is carried out with an efficiency of 93.0%, resulting in a deposit of 21.221 g of gold. a How many faradays are required to deposit the gold? b What is the charge on the gold ions (based on your calculations)?
Given the following two standard reduction potentials, solve for the standard reduction potential of the half-reaction M3++eM2+ (Hint: You must use the extensive property G to determine the standard reduction potential.)
Use the data from the table of standard reduction potentials in Appendix H to calculate the standard potential of the cell based on each of the following reactions. In each case, state whether the reaction proceeds spontaneously as written or spontaneously in the reverse direction under standard-state conditions. (a) H2(g)+Cl2(g)2H+(aq)+2Cl(aq) (b) Al3+(aq)+3Cr2+(aq)Al(s)+3Cr3+(aq) (c) Fe2+(aq)+Ag+(aq)Fe3+(aq)+Ag(s)
Describe what you expect to happen when the following solutions are electrolyzed: a aqueous Na2SO4; b aqueous KBr. That is, what are the electrode reactions? What is the overall reaction?
The standard potential for the reduction of AgSCN is 0.0895 V. AgSCN(s)+eAg(s)+SCN(aq) Find another electrode potential to use together with the above value and calculate Kspfor AgSCN.
At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.
The mass of three different metal electrodes, each from a different galvanic cell, were determined before and after the current generated by the oxidation-reduction reaction in each cell was allowed to flow for a few minutes. The first metal electrode, given the label A, was found to have increased in mass; the second metal electrode, given the label B, did not change in mass; and the third metal electrode, given the label C, was found to have lost mass. Make an educated guess as to which electrodes were active and which were inert electrodes, and which were anode(s) and which were the cathode(s).
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
• write and balance half-reactions for simple redox processes.
At 298 K, the solubility product constant for solid Ba(IO3)2 is 1.5 109. Use the standard reduction potential of Ba2+(aq) to find the standard potential for the half-reaction Ba(IO3)2(s)+2eBa(s)+2IO3(aq)