For the cell :Ag(s)/Ag2SO4(s) / H₂SO4 (m) / H₂(1/Pt; E 298K = - 0.627V.,Calculate 1- Write the electrodes reactions and the cell reactionatm.)92- Standardelectromotive force E298K, If you know (m=0.1 M) for H2SO4 Neglecting the activitycoefficient 3- Standard electromotive force E289K, if the activity coefficientforH2SO4 (0.1 M) equal y= 0.27 4- Ksp for Ag₂SO4 if you know standard electrodePotential Vag/Ag = -0.799

The equations needed to solve these problems are given below:Nernst equation: ... (1),... (1),...…

For the cell: Ag(s) / Ag2SO4(s) / H₂SO4 (m)/ H2(1 atm.) /Pt; Eº2 298K = -0.627V., Calculate 1- Write the electrodes reactions and the cell reaction 9 2- Standard electromotive force E298K,If you know (m=0.1 M) for H₂SO4 Neglecting the activity coefficient 3- Standard electromotive force E289K, if the activity coefficient for H₂SO4 (0.1 M) equal y±= 0.27 4- Ksp for Ag₂SO4 if you know standard electrode Potential Vag/Ag = -0.799

For the cell: Ag(s) / Ag2SO4(s) / H₂SO4 (m)/ H2(1 atm.) /Pt; Eº2 298K = -0.627V., Calculate 1- Write the electrodes reactions and the cell reaction 9 2- Standard electromotive force E298K,If you know (m=0.1 M) for H₂SO4 Neglecting the activity coefficient 3- Standard electromotive force E289K, if the activity coefficient for H₂SO4 (0.1 M) equal y±= 0.27 4- Ksp for Ag₂SO4 if you know standard electrode Potential Vag/Ag = -0.799

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter17: Electrochemistry And Its Applications

Section: Chapter Questions

Problem 50QRT

See similar textbooks

Similar questions

Halide ions can he deposited at a silver anode, the reaction being Ag(s) + X- AgX(s) +e- Suppose that a cell was formed by immersing a silver anode in an analyte solution that was 0.0250 M Cl-,Br-, and I -ions and connecting the half-cell to a saturated calomel cathode via a salt bridge. (a) Which halide would form first and at what potential? Is the cell galvanic or electrolytic? (b) Could I- and Br- be separated quantitatively? (Take 1.00 l0-5 M as the criterion for quantitative removal of an ion.) If a separation is feasible, what range of cell potential could he used? (c) Repeat part (b) for I- and Cl-. (d) Repeat part (b) for Br- and Cl-.
Table 17-1 lists common half-reactions along with the standard reduction potential associated with each half-reaction. These standard reduction potentials are all relative to some standard. What is the standard (zero point)? lf is positive for a half-reaction, what does it mean? If is negative for a half-reaction, what does it mean? Which species in Table 17-1 is most easily reduced? Least easily reduced? The reverse of the half-reactions in Table 17-1 are the oxidation half-reactions. How are standard oxidation potentials determined? In Table 17-1, which species is the best reducing agent? The worst reducing agent? To determine the standard cell potential for a redox reaction, the standard reduction potential is added to the standard oxidation potential. What must be true about this sum if the cell is to be spontaneous (produce a galvanic cell)? Standard reduction and oxidation potentials are intensive. What does this mean? Summarize how line notation is used to describe galvanic cells.
What is the cell potential of the following cell at 25C? Ni(s)Ni2+(1.0M)Sn2(1.5104M)Sn(s)
Calculate the theoretical potential of each of the following cells. Is the cell reaction spontaneous as written or spontaneous in the opposite direction? (a) Pt|Cr3+(2.00 10-4M),Cr2+(1.50 10-3 M)||Pb2+ (5.60 0215 10-2M)|Pb (b) Hg|Hg22+(2.00 10-2 M)||H+(1.50 10-2 M),V3+ (2.00 10-2M),VO2+(3.00 10-3M)|Pt (e) Pt|Fe3+(3.00 10-2 M), Fe2+ (4.00 10-5M)||Sn2+ (3.50 10-2M), Sn4+ (5.50 10-4 M)|Pt
A chemical engineering student is studying the effect of pH on the corrosion of iron. Ellie following data are collected: Corrosion Rate (mm/year) ph 0.03 13.00 0.06 12.00 0.16 11.00 0.22 10.00 0.25 9.00 0.25 8.00 0.25 7.00 0.25 6.00 0.25 5.00 0.27 4.00 0.37 3.00 0.38 2.80 0.63 2.80 1.00 2.80 Plot corrosion rate vs. pH. (HINT: Label the x axis with decreasing pH.) (a) How would you describe the dependence of corrosion on pH? (b) When the pH goes below 3, bubbles appear in the solution. What change takes place in the reduction half-reaction at low pH? (c) How do you explain the shape of the curve at the lowest pH? (Based on a graph in the Kirk-Otbmer Encyclopedia of Chemical Technology, 4th ed., vol 7. New York: John Wiley & Sons, p. 559.)
The relationship between the change in Gibbs energy and the emf of an electrochemical cell is given by: a.) Delta (G) = -E/(nF) b.) Delta (G) = -nFE c.) Delta (G) = -(nF)/E d.) Delta (G) = -nRTF
Determine the potential of a platinum electrode (vs. SHE) when placed in a mixture of 0.00207 M TICI, and 0.0362 M TICI at 25 °C. T13+ (aq) + 2e- = TIt (aq) E° = 1.25 V EPt = V Determine the potential of a platinum electrode when placed in a mixture of 0.0137 M potassium permanganate (KMNO,) and 0.0667 M manganese chloride (MnCl,) at pH 5.46 and 25 °C. Mno, (aq) + 5e- + 8 H* (aq) = Mn²+ (aq) + 4 H, O(1) E° = 1.51 V Ept = V
The standard potential of the cell calomel || nonesuch composed of a calomel electrode and a nonesuch electrode is -1978 mV at 25oC. Find the standard potential of the nonesuch electrode at 25oC.[-1.710] The answer is enclosed in the bracket, I would like to know how it was obtained. Thank you!
At 25C, you conduct a titration of 20.00 mL of a 0.0400 M AgNO3 solution with a 0.050 M NaI solution within the following cell: Saturated Calomel Electrode | Titration solution | Ag(s) for the cell as writted, what is the voltage after the addition of 16.00 mL of the NaI sooution? The reduction potential for the saturated calomel electrode is E=0.241 V. The standard reduction potential for the reaction: Ag++e- ® Ag(s) E0= 0.79993V. The solubility constant of AgI is Ksp=8.3x10-17 Note: the cell potential could be negative since the condditions are non-standard ones. a)0.041 b)0.869 c)0.083 d)0.165 e)0.340
For the reaction Ni2*(aq) + 2FE2*(aq) → Ni(s) + 2Fe³*(aq), the standard cell potentlal E'cell Is Multiple Choice O -0.52 V. -2.81 V. -1.02 V. 1.02 V. -2.81 V.
General Chemistry (Quesion -4) =====================
20. Due to COVID-19 coupled with erratic power supply from ZESCO, you decide to play around with galvanic cells and you construct a zinc-copper battery operating at a zero resistant small light emitting diode (L.E.D) at 25°C as follows: Zn | Zn²*(0.10 M) || Cu2* (2.5 M) | Cu The mass of each solid electrode is 2.00 g. a) b) c) Which of the two is a reducing agent? Calculate the cell potential when this battery is first connected. Calculate the cell potential after 10.0 A of current has flowed for 10.0 hours. (Assume each half-cell contains 1.00 L of solution.) d) e) Calculate the mass of each electrode after 10.0 hourS. What will cause the battery to die after some time? o search hp f7 f8 f9 f10 f11 f12 f3 米 f4 IOI f5 C f6 www 73 1 & 7 7 8. $ 2 3 5 8 € 6 E R T Y U P S D F G K V B 88 TECNO SPARK at gr 00 堂