For the cell Ag | AgCl | CI (a = 0.0001),(aCe4+(a = 0.01), Ce³+0.1) | Pt, solve for £ in V, where the standard half-cellpotentials are 0.2225 V for AgCI|CI and 1.45 V forCe4+|Ce³+F = 96,485 C mol-¹

We know according to Nernst equation,Ecell = E0cell - 0.0591/n log [Ce3+]/[Cl-][Ce4+] Where n =…

For the cell Ag | AgCl | Cl (a = 0.0001), Ce4+ (a = 0.01), 0.1)| Pt, solve for ein V, where the standard half-cell potentials are 0.2225 V for AgCI|CI and 1.45 V for Ce++|Ce³+. F = 96,485 C mol-¹ Ce³+ (a

Principles of Instrumental Analysis

7th Edition

ISBN:9781305577213

Author:Douglas A. Skoog, F. James Holler, Stanley R. Crouch

Publisher:Douglas A. Skoog, F. James Holler, Stanley R. Crouch

Chapter23: Potentiometry

Section: Chapter Questions

Problem 23.23QAP: The following cell was found to have a potential of —0.492 V: Ag|AgCl(sat’d)||HA(0.200 M),NaA(0.300...

See similar textbooks

Similar questions

At what pH does Ecell = 0.00 V for the reduction of dichromate by iodide ion in acid solution, assuming standard-state concentrations of all species except H+ ion?
Halide ions can he deposited at a silver anode, the reaction being Ag(s) + X- AgX(s) +e- Suppose that a cell was formed by immersing a silver anode in an analyte solution that was 0.0250 M Cl-,Br-, and I -ions and connecting the half-cell to a saturated calomel cathode via a salt bridge. (a) Which halide would form first and at what potential? Is the cell galvanic or electrolytic? (b) Could I- and Br- be separated quantitatively? (Take 1.00 l0-5 M as the criterion for quantitative removal of an ion.) If a separation is feasible, what range of cell potential could he used? (c) Repeat part (b) for I- and Cl-. (d) Repeat part (b) for Br- and Cl-.
Galvanic cells harness spontaneous oxidationreduction reactions to produce work by producing a current. They do so by controlling the flow of electrons from the species oxidized to the species reduced. How is a galvanic cell designed? What is in the cathode compartment? The anode compartment? What purpose do electrodes serve? Which way do electrons always flow in the wire connecting the two electrodes in a galvanic cell? Why is it necessary to use a salt bridge or a porous disk in a galvanic cell? Which way do cations flow in the salt bridge? Which way do the anions flow? What is a cell potential and what is a volt?
How long would it take to electroplate a metal surface with 0.500 g nickel metal from a solution of Ni2+ with a current of 4.00 A?
From the standard potentials Ag2SeO4(s)+2e2Ag(s)+SeO42-E0=0.355V Ag++2eAg(s)E0=0.799V calculate the solubility product constant for Ag2SeO4.
What is the cell potential of the following cell at 25C? Ni(s)Ni2+(1.0M)Sn2(1.5104M)Sn(s)
(a) Determine the equilibrium constant at 298.15 K for the cell 3+ Zn(s) | Zn2*(aq, a = 0.0120) || Mn³*(aq, a. 0.200), Mn2+(aq, az = 0.0250)| Pt(s) %3D %D (b) Is the cell reaction spontaneous as written? II
Estimate cell potential Ag(s)|AgBr(s)||KBr(aq)||Cd(NO3)2(aq)|Cd the 25 °C. Data: [KBr(ag)) = 0.050 molkgt; [Cd(NO3)2(ag)] = 0.010 molkg!. Consider: y+(Cd²+) = y±{Cd(NO3)2} e v-(Br) = y± (KBr); lon dissociation 100 %; b° = 1 molkg-1. E® Cd2+ (aq) + 2e¯ → Cd(s) -0.40V 2AGB1(s) + 2e¯ –→ 2Ag(s) + 2B1¯ (aq) +0.07 V A. Calculate the global reaction. B. The cell's default potential.
The cell SCE // Ag2CrO4 (sat'd), CrO42- (x M) / Ag is used for the determination of pCrO4. Calculate pCrO4 when the cell potential is 0.336 V.
For the cell Zn(s) | Zn2+(2M) | | Cu2+(0.5 M) | Cu(s)(a) Write equation for each half-reaction.(b) Calculate the cell potential at 25 °C.[Given: EZn2+/Zn= – 0.76 V; ECu2+/Cu= + 0 .34V]
A conductivity cell filled with a 0.01 M KCl solution was found to have a resistance of 189 ohms at 25oC. When filled with 0.01 M HCl solution, the cell gave a resistance of 64.8 ohms at the same temperature. At 25oC, the conductivity of 0.01 M KCl solution was 1.4088 x 10-3 S cm-1. Calculate (a) the cell constant and (b) the conductivity of the HCl solution. answer is [0.266; 4.105 x 10-3] please explain. thank you!
Calculate the cell potential at 25°C for the reaction Fe(s)|Fe^3+ (aq,0.0952 M)|| C12(g,7.62 atm) Cl-(aq,0.0577 M)|Pt(s). Eᵒcell= 1.396 V. 3 sig figs in answer.