[FeL6]* complex (L indicates a monodentate ligand) has a magnetic moment of approximately 1.73 B.M. a) What is the geometry of the complex? b) How many unpaired electrons does this ion have? c) What is the oxidation state of Fe? d) Calculate Ligand Field Stabilization Energy (LFSE). e) If the ligand is replaced by a bidentate ligand in the complex what would be the formula of the complex?

[FeL6]* complex (L indicates a monodentate ligand) has a magnetic moment of approximately 1.73 B.M. a) What is the geometry of the complex? b) How many unpaired electrons does this ion have? c) What is the oxidation state of Fe? d) Calculate Ligand Field Stabilization Energy (LFSE). e) If the ligand is replaced by a bidentate ligand in the complex what would be the formula of the complex?

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter21: Transition Metals And Coordination Chemistry

Section: Chapter Questions

Problem 4ALQ

See similar textbooks

Similar questions

What is the coordination number of the central metal atom in the following complexes? (a) [Fe(H2O)63+] (b) [Pt(NH3)Br3] (c) [V(en)Cl42] (d) [Au(CN)2+]
a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
Is it possible for a complex of a metal in the transition series to have six unpaired electrons? Explain.
Sketch and explain the most likely crystal field diagram for the following complex ion: Note: The CN ligand produces a much stronger crystal field than NH3. Assume the NH3 ligands lie on the z axis.
Trimethylphosphine, P(CH3)3, can act as a ligand by donating the lone pair of electrons on the phosphorus atom. If trimethylphosphine is added to a solution of nickel(Il) chloride in acetone, a blue compound that has a molecular mass of approximately 270 g and contains 21.5% Ni, 26.0% Cl, and 52.5% P(CH3)3 can be isolated. This blue compound does not have any isomeric forms. What are the geometry and molecular formula of the blue compound?