Ethanol, C2H5OHC2H5OH, is used as a primary fuel for motor vehicles in some countries like Brazil. The balanced chemical equation for the combustion reaction is: C2H5OH(l)+O2(g)→CO2(g)+H2O(g)C2H5OH(l)+O2(g)→CO2(g)+H2O(g) The density of ethanol is 0.7893 g/mL. Determine the enthalpy of combustion of exactly 2 L of ethanol.

Q: I need the third sub part

A:

Q: The reaction between nitrogen monoxide and oxygen is given below: 2 NO(g) + 02(g) → 2 NO2(g) We…

A:

Q: Ethanol, C₂H6 O, is most often blended with gasoline - usually as a 10 percent mix - to create a…

A:

Q: Water gas, a mixture of carbon monoxide and hydrogen, is produced by treating carbon (in the form of…

A: Given :  Mass of carbon = 5.35 kg  Since , 1 kg = 1000 gm  => Mass of carbon = 5350 gm  Also,…

Q: A student performed the procedure described in the lab manual using 48.9 mL of 1.0 M HCl and 49.9 mL…

A: Given, Acid taken: 48.9 mL of 1.0 M HCl Base taken: 49.9 mL of 1.0 M NaOH Temperature change: (24.7…

Q: When 1.3 g of KClO3 was added to 151.1 g of water in a calorimeter, the temperature dropped by 0.588…

A: Given, Mass of KClO3= 1.3g Mass of water= 151.1g Temperature dropped(dT)=0.588°C  The heat capacity…

Q: Which of the following is the formation reaction for Na2CO3 (s)?   A. 2 Na(s) + C(s, graphite) + 3…

A:

Q: Nitrosyl bromide, NOBr, can be formed from the reaction of NO and Br2:         NO(g)  +  ½ Br2(g)…

A: We have to predict the Kc for given reaction.

Q: Determine the amount of heat (in kJ) associated with the production of 1.76 × 104 g of NO2 according…

A: Molar mass of nitrogen dioxide is 46 g/mol

Q: Consider the following reactions:                  C2H6 (g)  +  7/2 O2 (g)  →  2 CO2 (g)  +  3 H2O…

A:

Q: The principal component of LPG is butane, C4H10(g). If combustion of 1 mole of butane produces 126…

A:

Q: The reaction between nitrogen and oxygen gases requires the absorption of 43 kJ of energy per mole…

A: The reactions in which heat energy is released from the system are known as exothermic reactions.…

Q: Which following reaction is exothermic? OC₂H4(g) + O₂(g) → 2C(s) + 2H₂O(g) PC13(g) + Cl₂(g) →…

A: For an exothermic reaction, the energy of the products is less than the energy of the reactants.

Q: Given the following data 2 CIF (g) + O₂(g) → Cl₂ O(g) + F2O(g) ΔΗ= 167.4 kJ 2 CIF3 (9) +202 (g) →…

A:

Q: D4, is used Calculate 10, from 25 perature of heat lorate is

A: Heat(Q) = mass(m) • specific heat capacity (C) • ( T2 - T1 )  Where : specific heat capacity =…

Q: Consider the following chemical reaction which produces nitric oxide from its constituent elements:…

A: According to the question, The reaction is given as, N2(g)+O2(g) → 2NO(g)      ∆Hr = 182.6 kJ/mol…

Q: Study the reactions. 1. C2H2 (g) + 2H2 (g) → C2H6 (9) 2. C2H4 (9) + H2 (g) → C2H6 (9) 3. C2H2 (g) +…

A:

Q: Combustion reactions involve reacting a substance with oxygen. when compounds containing carbon and…

A: The enthalpy of combustion of a substance is defined as the heat energy given out when one mole of a…

Q: When 125 mL of 0.210 M NaCl(aq) and 125 mL of 0.210 M AgNO3(aq), both at 21.0°C, are mixed in a…

A:

Q: Coal power plants burn large amounts of coal, C(s), in an O2(g) atmosphere to generate electricity.…

A: For the reaction.,  C(s)  + O2(g)  -------> CO2(g) Mass of carbon burnt = 102 metric tons Oxygen…

Q: on 22 of 22 Using the balanced chemical equation, determine how many moles of NaCl will be produced,…

A: According to the question, The given reaction is, BaCl2aq + Na2SO4aq → BaSO4s + NaClaq The moles of…

Q: when butane (C4H10) in a cigarette lighter undergoes combustion, it evolves 2880 kJ per mole of…

A: When butane (C4H10) in a cigarette lighter undergoes combustion, it evolves 2880 kJ per mole of…

Q: Ethanol, C2H6O, is most often blended with gasoline - usually as a 10 percent mix - to create a fuel…

A: Given: Heat of combustion of ethanol =  326.7 kcal/mol. Mass of 2-Methylhexane = 446 grams Molar…

Q: CHEMISTRY (Please write the complete solution legibly. Choose the correct answer. No long…

A:

Q: Do the follow reactions depict Heat of Formation Reactions? If so, mark the reaction as YES, if it…

A:

Q: Consider the reaction below for the combustion of methane (CH4, which is the principal component of…

A:

Q: When 145 mL of 0.212 M NaCl(aq) and 145 mL of 0.212 M AgNO3(aq), both at 21.1°C, are mixed in a…

A: Moles of AgNO3 = Molarity× Volume = 0.212 M × (145/1000)L = 0.03074 moles

Q: The reaction shown below represents the formation reaction of water. 2 H2 (g)   +   O2 (g)   →   2…

A: The solution is as follows :

Q: Given the following data 2 CIF (g) + O₂(g) → Cl₂ O(g) + F₂O(g) 2 CIF3 (9) +202(g) → Cl₂ O(g) +…

A: According to Hess law of heat summation , enthalpy change of net reaction remains same whether it…

Q: Suppose you had used 4.00 grams of NaOH(s) in Reaction 1. What would have  been the number of Joules…

A: Initial mass of NaOH = 2 g Volume of water used is 100 ml As density is not given, I have considered…

Q: (A) Write the balanced chemical equation for the formation of butane (C4H10). How does the potential…

A: Answer:When formation of 1 mole of a compound takes place from its constituent elements in their…

Q: Consider the combustion of liquid C5H in oxygen gas to produce carbon dioxide gas and water vapor.…

A: According to the Law of conservation of mass " all atoms of different elements must be equal on both…

Q: The reaction that was on the screen when you started and its derivative demonstrate that the…

A: given, the reaction H2O(l)→H2O(g), ΔH =44.0kJ

Q: 33.9 Given the following two reactions and their enthalpy changes,             2 ClO2 (g)   -->…

A: The enthalpy change is a state function and the Hess law states that the change of enthalpy in a…

Q: Consider the following reaction. (a) Is the reaction exothermic or endothermic? exothermic…

A: