Equillibrium 2: Determination of an Equillibrium Constant The equilibrium concentration of the thiocyanate ion is determined: by using the color of the complex ion at equilibrium and comparing that to the color of the unknown solution of the iron ion by adding the equilibrium concentration of the iron ion and the thiocyanate ion present initially by subtracting the equilibrium concentration of the complex ion from the initial thiocyanate concentration using the Spec 20 set at the wavelength determined in the Equilibrium One lab

Equillibrium 2: Determination of an Equillibrium Constant The equilibrium concentration of the thiocyanate ion is determined: by using the color of the complex ion at equilibrium and comparing that to the color of the unknown solution of the iron ion by adding the equilibrium concentration of the iron ion and the thiocyanate ion present initially by subtracting the equilibrium concentration of the complex ion from the initial thiocyanate concentration using the Spec 20 set at the wavelength determined in the Equilibrium One lab

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter12: Chemical Equilibrium

Section12.5: Using Equilibrium Constants

Problem 12.6PSP

See similar textbooks

Similar questions

Hard water has a high concentration of calcium and magnesium ions. Focusing on the calcium ion, a common home water -softening process is based on a reversible chemical change that can be expressed by Na2Ze(s)+Ca2+(aq)CaZe(s)+2Na+(aq). Na2Ze represents a solid resin that is like an ionic compound between sodium ions and zeolite ions, a complex arrangement of silicate and aluminate groups; CaZe is the corresponding calcium compound. When, during the day, is this system most likely to reach equilibrium? Why doesnt it reach equilibrium and stay there? Periodically it is necessary to recharge the water softner by running salt water, NaCl(aq), through it. Why is this necessary? What concept is discussed in this chapter does the recharging process illustrate? Zeolite ions are used in home water softners because they have a porous but rigid structure that is weakly attracted to cations, readily allowing an exchange among different ions.
Draw a nanoscale (particulate) level diagram for an equilibrium mixture of
In a particular experiment, the equilibrium constant measured for the reaction, Cl2(g)+NO2(g)Cl2NO2(g), is 2.8. Based on this measurement, calculate AG° for this reaction. Calculate AG° using data from Appendix E at the back of the book and discuss the agreement between your two calculations.
. Under what circumstances can we compare the solubilities of two salts by directly comparing the values of their solubility products?
A 0.64 g sample of the white crystalline dimer (4) is dissolved in 25.0 mL of benzene at 20 C. Use the equilibrium constant to calculate the concentrations of monomer (2) and dimer (4) in this solution.
The following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?
5.8. The hemoglobin in blood establishes an equilibrium with oxygen gas very quickly. The equilibrium can be represented as where “heme” stands for hemoglobin and “” stands for the hemoglobin-oxygen complex. The value for the equilibrium constant for this reaction is about . Carbon monoxide also binds with hemoglobin by the following reaction: This reaction has an equilibrium constant of . Which reaction’s equilibrium lies farther toward products? Does your answer justify the toxicity of ?
Describe a nonchemical system that is in equilibrium, and explain how the principles of equilibrium apply to the system.
In the gas phase, acetic acid exists as an equilibrium of monomer and dimer molecules. (The dimer consists of two molecules linked through hydrogen bonds.) The equilibrium constant, Kc, at 25 C for the monomer-dimer equilibrium 2 CH3CO2H (CH3CO2H)2 has been determined to be 3.2 104. Assume that acetic acid is present initially at a concentration of 5.4 104 mol/L at 25 C and that no dimer is present initially. (a) What percentage of the acetic acid is converted to dimer? (b) As the temperature increases, in which direction does the equilibrium shift? (Recall that hydrogen-bond formation is an exothermic process.)
The creation of shells by mollusk species is a fascinating process. By utilizing the Ca2+ in their food and aqueous environment, as well as some complex equilibrium processes, a hard calcium carbonate shell can be produced. One important equilibrium reaction in this complex process is HCO3(aq)H+(aq)+CO32(aq)K=5.61011 If 0.16 mole of HCO3 is placed into 1.00 L of solution, what will be the equilibrium concentration of CO32?
. Many sugars undergo a process called mutarotation, in which the sugar molecules interconvert between two isomeric forms, finally reaching an equilibrium between them. This is true for the simple sugar glucose, C6H12O6, which exists in solution in isomeric forms called alpha-glucose and beta-glucose. If a solution of glucose at a certain temperature is analyzed, and it is found that the concentration of alpha-glucose is twice the concentration of beta-glucose, what is the value of K for the inter-conversion reaction?
12.102 A chemical engineer is working to optimize the production of acrylonitrile to be used in the manufacture of carbon fibers. The reaction being used is the combination of propene gas, ammonia, and oxygen. The reaction is normally carried out at moderately high temperatures so all species are in the gas phase. (a) Write the equilibrium constant expression for this reaction. (b) The boiling point of acrylonitrile is 77 °C, and that of propene is -48 °C. What would the equilibrium expression be if this reaction were carried out at room temperature? (c) What characteristic of this reaction might cause the engineer to desire carrying out this reaction at room temperature?