ELECTROCHEMISTRY: Calculate the required voltage (V) if an unknown metal (M) was electrodeposited from an aqueous solution containing M2X3 (where X is the anion) with a supplied current of 6.86 A for 9 h, and consumes 0.1573 kWh of electrical energy. Assume that the current efficiency is 80%. Input values only with 2 decimal places. Do not include the unit. Round your answer to 2 decimal places.

ELECTROCHEMISTRY: Calculate the required voltage (V) if an unknown metal (M) was electrodeposited from an aqueous solution containing M2X3 (where X is the anion) with a supplied current of 6.86 A for 9 h, and consumes 0.1573 kWh of electrical energy. Assume that the current efficiency is 80%. Input values only with 2 decimal places. Do not include the unit. Round your answer to 2 decimal places.

Principles of Instrumental Analysis

7th Edition

ISBN:9781305577213

Author:Douglas A. Skoog, F. James Holler, Stanley R. Crouch

Publisher:Douglas A. Skoog, F. James Holler, Stanley R. Crouch

Chapter24: Coulometry

Section: Chapter Questions

Problem 24.4QAP: Halide ions can he deposited at a silver anode, the reaction being Ag(s) + X- AgX(s) +e- Suppose...

See similar textbooks

Related questions

Q: Batteries are charged and discharged due to the concentration of the solutions inside. Calculate the…

Q: For the cell shown, the measured cell potential, Ecell, is -0.3559 V at 25 °C. Pt(s) | H₂(g, 0.767…

Q: Copper was electroplated from a Cu2SO4 solution onto an electrode with an active surface area of…

A: Given: Surface are of the plate = 3.34 cm2 Density of copper = 8.96 g/cm3 Current passed = 4.94 A…

Q: calculate the electrode potentials of the following half cells: HCL (3.50M) | H2 (0.950atm), Pt.

Q: At 25 °C, based upon the overall reaction Zn2+(aq) + 2 Fe2+(aq) ⟶ Zn(s) + 2…

A: The expression for the Nernst equation is shown below: Where; Ecell = cell potential E0cell =…

Q: A student was asked to answer the following: Calculate the time (in sec) that is required to plate…

A: 1st we do step by solutionThen we will find out the error Al(NO3)3 solutionAl(NO3)3 (aq) →…

Q: Gibbs energy change, A;G°, is related to cell potential, Eel, by the equation A;G° = -nFEl Part B…

A: The given reaction is as follows: Xs+2Y+(aq) → X2+(aq) + 2Y(s) ∆rG° of the reaction can be…

Q: For the cell shown, the measured cell potential, Ecell, is –0.3525 V at 25 °C. Pt(s) | H,(g, 0.851…

A: The cell given is, Given: Ecell = -0.3525 V Temperature = 25 oC And the half-reactions are,

Q: Given the following standard electrode potentals: Ag°(aq) + e¯ = Ag(s) N,(g) + 5H°(aq) + 4e° =…

A: Consider the given values as; Ag+ aq + e- ⇌ Ag s…

Question

ELECTROCHEMISTRY: Calculate the required voltage (V) if an unknown metal (M) was electrodeposited from an aqueous
solution containing M2X3 (where X is the anion) with a supplied current of 6.86 A for 9 h, and consumes 0.1573 kWh of
electrical energy. Assume that the current efficiency is 80%. Input values only with 2 decimal places. Do not include the
unit.
Round your answer to 2 decimal places.

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

The table below lists the cell potentials for the 10 possible galvanic cells assembled from the metals A. B. C. D. and E. and their respective 1.00 M 2+ ions in solution. Using the data in the table, establish a standard reduction potential table similar to Table 17-1 in the text. Assign a reduction potential of 0.00 V to the half-reaction that falls in the middle of the series. You should get two different tables. Explain why, and discuss what you could do to determine which table is correct. A(s)in A2+(aq) B(s)in B2+(aq) C(s)in V2+(aq) D(s)in D2+(aq) E(s)in E2+(aq) 0.28V 0.81V 0.13V 1.00V D(s)in D2+(aq) 0.72V 0.19V 1.13V C(s)in V2+(aq) 0.41V 0.94V B(s)in B2+(aq) 0.53V
The following cell was found to have a potential of —0.492 V: Ag|AgCl(sat’d)||HA(0.200 M),NaA(0.300 M)|H2(1.00 atm),Pt Calculate the dissociation constant of HA, neglecting the junction potential.
For the following half-reaction, = 2.07 V: A1F63(aq)+3eAl(s)+6F(aq) Using data from Table 17-1, calculate the equilibrium constant at 25C for the reaction A13+(aq)+6F(aq)A1F63(aq)K=?
An aqueous solution of an unknown salt of vanadium is electrolyzed by a current of 2.50 amps for 1.90 hours. The electroplating is carried out with an efficiency of 95.0%, resulting in a deposit of 2.850 g of vanadium. a How many faradays are required to deposit the vanadium? b What is the charge on the vanadium ions (based on your calculations)?
Consider the reaction low at 25°C: 3SO42(aq)+12H+(aq)+2Cr(s)3SO2(g)+2Cr3+(aq)+6H2O Use Table 17.1 to answer the following questions. Support your answers with calculations. (a) Is the reaction spontaneous at standard conditions? (b) Is the reaction spontaneous at a pH of 3.00 with all other ionic species at 0.100 M and all gases at 1.00 atm? (c) Is the reaction spontaneous at a pH of 8.00 with all other ionic species at 0.100 M and all gases at 1.00 atm? (d) At what pH is the reaction at equilibrium with all other ionic species at 0.100 M and all gases at 1.00 atm?
A galvanic cell is based on the following half-reactions: In this cell, the copper compartment contains a copper electrode and [Cu2+] = 1.00 M, and the vanadium compartment contains a vanadium electrode and V2+ at an unknown concentration. The compartment containing the vanadium (1.00 L of solution) was titrated with 0.0800 M H2EDTA2, resulting in the reaction H2EDTA2(aq)+V2+(aq)VEDTA2(aq)+2H+(aq)K=? The potential of the cell was monitored to determine the stoichiometric point for the process, which occurred at a volume of 500.0 mL H2EDTA2 solution added. At the stoichiometric point, was observed to be 1 .98 V. The solution was buffered at a pH of 10.00. a. Calculate before the titration was carried out. b. Calculate the value of the equilibrium constant, K, for the titration reaction. c. Calculate at the halfway point in the titration.
A 0.0712-g sample of a purified organic acid was dissolved in an alcohol-water mixture and titrated with coulometrically generated hydroxide ions. With a current of 0.0392 A, 241 s was required to reach aphenolphthalein end point. Calculate the equivalent mass of the acid.
An alloy made up of tin and copper is prepared by simultaneously electroplating the two metals from a solution containing Sn(NO3)2 and Cu(NO3)2.If 20.0% of the total current is used to plate tin, while 80.0% is used to plate copper, what is the percent composition of the alloy?
Consider the reaction below at 25°C: 2MnO4(aq)+16H+(aq)+10Br(aq)2Mn2+(aq)+5Br2(l)+8H2O Use Table 17.1 to answer the following questions. Support your answers with calculations. (a) Is the reaction spontaneous at standard conditions? (b) Is the reaction spontaneous at a pH of 2.00 with all other ionic species at 0.100 M? (c) Is the reaction spontaneous at a pH of 5.00 with all other ionic species at 0.100 M? (d) At what pH is the reaction at equilibrium with all other ionic species at 0.100 M?
Galvanic cells harness spontaneous oxidationreduction reactions to produce work by producing a current. They do so by controlling the flow of electrons from the species oxidized to the species reduced. How is a galvanic cell designed? What is in the cathode compartment? The anode compartment? What purpose do electrodes serve? Which way do electrons always flow in the wire connecting the two electrodes in a galvanic cell? Why is it necessary to use a salt bridge or a porous disk in a galvanic cell? Which way do cations flow in the salt bridge? Which way do the anions flow? What is a cell potential and what is a volt?
What is the cell potential of the following cell at 25C? Ni(s)Ni2+(1.0M)Sn2(1.5104M)Sn(s)
From the standard potentials Tl++eTl(s)E0=0.336V TlCl(s)+eTl(s)+ClE0=0.557V calculate the solubility product constant for TlCl.