Draw the structures of the following compound: 8-benzyl-6-(3-chloro-2-methylbutyl)-N-ethyl-9-fluoro-N,2,2-trimethyl-7-propoxy-5-decanamine

Q: 4,4-diethyl-1-methoxy-3methyldecane draw the structure

A:

Q: m-(N,N-dichloroamino)phenylethanone

A: m-(N, N-dichloroamino)phenylethanone is a ketone derivative.  Here,  "m" represents the meta…

Q: What is the IUPAC name of the following compound? a) ethylmethylpropylamine b)…

A: The important rules for IUPAC nomenclature of organic compounds:-Select the parent chain with the…

Q: Why can’t 2-methyl-2-propanol be prepared by the reduction of a carbonyl compound?

A: Reduction is the process in which the chemical species gains the electrons and due to which its…

Q: Draw the structure of the following benzene derivatives: a) 4-bromo-1,2-dimethylbenzene b)…

A: The question is based on the concept of organic chemistry. We have to draw the molecular structure…

Q: Explain why aldehydes and ketones react with a weak acid such as hydrogen cyanide but do not react…

A: HCl and H2SO4, being strong acids, releases anions in the solution which are very weak conjugate…

Q: Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in…

A: Given Chemical reaction: CH3CH2CH2CO2H(l)+CH2CH3OH(l)⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Mass of butanoic…

Q: Write the structure of each of the following compounds.

A: given IUPAC name of compounds we have to draw the structure

Q: When 2-chloropropane treated with NaOH and 1-chloropropane treated with NaOH separately produce two…

A: In this question we have given two organic reaction and we have to write the product and explain the…

Q: 01-04

A: The question is based on the concept of organic synthesis.We need to synthesize the product using…

Q: 5. Draw a structure for the following names. 4-Chloro-2-methylphenol 2.6-dimethoxystyrene…

A:

Q: draw the structure of the following compounds g) 3-(iodomethyl)phenol (h) (2R,3R)-2,3-hexanediol (i)…

A:

Q: Thich one of the following compounds does not have a secondary carbon? cycdlopentane butane…

A: Note: As per company norms we can answer only first three sub-parts. Please post remaining parts as…

Q: Draw the condensed structural formula of the following compounds: acid a)…

A: To draw the condensed structural formula of the following compounds:

Q: What is the IUPAC name of the following compound? LOH Br N=C- 2-bromo-4-cyano-1-hydroxybenzene…

A: Given molecule is aromatic compound

Q: Draw bond-line structures of each of the following compounds.…

A: Organic compounds can be defined as the compounds that contain carbon and hydrogen atoms in a…

Q: The following compound can be prepared by a Claisen condensation followed by saponification and…

A: According to the bartleby guideline for the multiple questions, we can solve only first one so I'm…

Q: benzene

A: 1- Cl2, AlCl3  2- HNO3, H2SO4  3- NaOH, ∆  4- H+ ( workup step )

Q: What is the IUPAC name for the compound shown? OH O 1-ethylcyclohexane-3-carboxylic acid O…

A:

Designing a Synthesis

Organic synthesis is a branch of chemical synthesis that involves the planned construction of organic compounds/molecules from smaller units that possess functional groups. Friedrich Wöhler was the first scientist who designed the synthesis of an organic compound, urea from inorganic starting materials silver cyanate with ammonium chloride via a simple, one-step synthesis.